PREFACE This is the first edition of the CRC Handbook of Chemistry and Physics for the 21st Century (as “century” is officially defined). Few would dispute that the 20th Century was the century of science; major paradigm shifts took place first in physics and chemistry and, in the second half of the century, in biology. The “Rubber Handbook”, socalled after the original name of its publisher, the Chemical Rubber Company, was a fixture for almost all of that eventful century. When the first edition appeared in 1913, the electron had been known for only 17 years, there were 81 elements, and the Bohr theory of the hydrogen atom was still in press. The Handbook was a significant innovation. While systematic compilation of data from the chemistry and physics literature had begun earlier, especially in Germany, the massive tomes that were published by Beilstein, Gmelin, and Landolt-Börnstein were strictly for libraries. The Rubber Handbook appears to have been the first compact, low-price volume of reference data suitable for students and individual researchers to keep on their desk or laboratory bench. It quickly became a standard and grew from its original 116 pages to the present size of over 2500 pages. Generations of students have relied on the CRC Handbook as a resource in their studies, but the impact has been much broader. Senior research scientists, engineers, and workers in other fields have used the book extensively. Linus Pauling, perhaps the most influential chemist of the 20th century, made the following comments a few years before his death: “People who have interviewed me have commented on the extensive knowledge that I have about the properties of substances, especially inorganic compounds, including minerals. I attribute this knowledge in part to the fact that I possessed the Rubber Handbook. I remember clearly the five summers, beginning in 1919, when I worked as a paving-plant inspector, supervising the laying of bituminous pavement in the mountainous region of southern Oregon. For much of the time I was free to read, just keeping an eye on the operation of the paving plant. I remember the book that I read over and over was the Rubber Handbook. I puzzled over the tables of properties - hardness, color, melting and boiling point, density, magnetic properties, and others - trying to think of reasonable explanations of the empirical data. Only in the 1920s and 1930s did I have some success in this effort.” Pauling’s “success” was the first step in our ability to relate the physical and chemical behavior of bulk materials to their molecular structure in a quantitative manner. One factor in the success of the Handbook has been its annual revisions. This practice, followed throughout the century except for a few wartime years, permitted the replacement of old data with new and more accurate values, as well as the introduction of new topics that became important as science moved forward. This policy has helped the Handbook meet the needs of the scientific community in a timely fashion.
The 82nd Edition continues the tradition of updates and improvements. The major change is a revised and expanded table of Physical Constants of Inorganic Compounds. The number of compounds has been increased by 12%, the format improved, and the constants updated. In addition, quantitative data on solubility in water are now included in the table, and a formula index has been added. Other tables that have been expanded and updated include: • Critical Constants • Aqueous Solubility and Henry’s Law Constants of Organic Compounds • Chemical Carcinogens • Threshold Limits for Airborne Contaminants • Nomenclature for Organic Polymers • Standard Atomic Weights • Atomic Masses and Abundances • Table of the Isotopes New topics covered in this edition include: • Surface Tension of Aqueous Mixtures • Viscosity of Carbon Dioxide along the Saturation Line • Gibbs Energy of Formation for Important Biological Species • Optical Properties of Inorganic and Organic Solids • Interstellar Molecules • Allocation of Frequencies in the Radio Spectrum • Units for Magnetic Properties This electronic version of the Handbook of Chemistry and Physics contains all the material from the print version of the 82nd Edition, as well as some additional data that could not be accommodated in the printed book. Powerful search capabilities, which are explained in the Help messages, greatly facilitate the task of locating the data. The Editor will appreciate suggestions on new topics for the Handbook and notification of any errors. Address all comments to Editor, Handbook of Chemistry and Physics, CRC Press, Inc., 2000 Corporate Blvd. N. W., Boca Raton, FL 33431. Comments may also be sent by electronic mail to
[email protected]. The Handbook of Chemistry and Physics is dependent on the efforts of many contributors throughout the world. I appreciate the valuable suggestions that have come from the Editorial Advisory Board and from many users. I should also like to thank Susan Fox and the rest of the production team at CRC Press for their excellent support. David R. Lide January 1, 2001 This Edition is Dedicated to the Memory of David Reynolds Lide (1901-1976) and Kate Simmons Lide (1896-1991)
This work contains information obtained from authentic and highly regarded sources. Reprinted material is quoted with permission, and sources are indicated. A wide variety of references are listed. Reasonable efforts have been made to publish reliable data and information, but the author and the publisher cannot accept responsibility for the validity of all materials or for the consequences of their use.
© Copyright CRC Press LLC 2002
FUNDAMENTAL PHYSICAL CONSTANTS Peter J. Mohr and Barry N. Taylor These tables give the 1998 self-consistent set of values of the basic constants and conversion factors of physics and chemistry recommended by the Committee on Data for Science and Technology (CODATA) for international use. The 1998 set replaces the previous set of constants recommended by CODATA in 1986; assigned uncertainties have been reduced by a factor of 1/5 to 1/12 (and sometimes even greater) relative to the 1986 uncertainties. The recommended set is based on a least-squares adjustment involving all of the relevant experimental and theoretical data available through December 31, 1998. Full details of the input data and the adjustment procedure are given in Reference 1. The 1998 adjustment was carried out by P. J. Mohr and B. N. Taylor of the National Institute of Standards and Technology (NIST) under the auspices of the CODATA Task Group on Fundamental Constants. The Task Group was established in 1969 with the aim of periodically providing the scientific and technological communities with a self-consistent set of internationally recommended values of the fundamental physical constants based on all applicable information available at a given point in time. The first set was published in 1973 and was followed by a revised set first published in 1986; the current 1998 set first appeared in 1999. In the future, the CODATA Task Group plans to take advantage of the high level of automation developed for the current set in order to issue a new set of recommended values at least every four years. At the time of completion of the 1998 adjustment, the membership of the Task Group was as follows: F. Cabiati, Istituto Elettrotecnico Nazionale “Galileo Ferraris,” Italy E. R. Cohen, Science Center, Rockwell International (retired), United States of America T. Endo, Electrotechnical Laboratory, Japan R. Liu, National Institute of Metrology, China (People’s Republic of) B. A. Mamyrin, A. F. Ioffe Physical-Technical Institute, Russian Federation P. J. Mohr, National Institute of Standards and Technology, United States of America F. Nez, Laboratoire Kastler-Brossel, France B. W. Petley, National Physical Laboratory, United Kingdom T. J. Quinn, Bureau International des Poids et Mesures B. N. Taylor, National Institute of Standards and Technology, United States of America V. S. Tuninsky, D. I. Mendeleyev All-Russian Research Institute for Metrology, Russian Federation W. Wöger, Physikalisch-Technische Bundesanstalt, Germany B. M. Wood, National Research Council, Canada REFERENCES 1. Mohr, Peter J., and Taylor, Barry N., J. Phys Chem. Ref. Data 28, 1713, 1999; Rev. Mod. Phys. 72, 351, 2000. The 1998 set of recommended values is also available at the Web site of the Fundamental Constants Data Center of the NIST Physics Laboratory: http://physics.nist.gov/constants.
Fundamental Physical Constants Quantity
Symbol
Value
Unit
Relative std. uncert. u r
UNIVERSAL m s−1 N A−2 N A−2 F m−1
(exact)
ε0
299 792 458 4π × 10−7 = 12.566 370 614... × 10−7 8.854 187 817... × 10−12
Z0
376.730 313 461...
(exact)
G G/c h
6.673(10) × 10−11 6.707(10) × 10−39 6.626 068 76(52) × 10−34 4.135 667 27(16) × 10−15 1.054 571 596(82) × 10−34 6.582 118 89(26) × 10−16
m3 kg−1 s−2 (GeV/c2 )−2 Js eV s Js eV s
1.5 × 10−3 1.5 × 10−3 7.8 × 10−8 3.9 × 10−8 7.8 × 10−8 3.9 × 10−8
2.1767(16) × 10−8 1.6160(12) × 10−35 5.3906(40) × 10−44
kg m s
7.5 × 10−4 7.5 × 10−4 7.5 × 10−4
speed of light in vacuum magnetic constant
c, c0 µ0
electric constant 1/µ0 c2 characteristic√impedance of vacuum µ0 /0 = µ0 c Newtonian constant of gravitation Planck constant in eV s h/2π in eV s Planck mass (c/G)1/2 Planck length /m P c = (G/c3 )1/2 Planck time lP /c = (G/c5 )1/2
mP lP tP
(exact) (exact)
ELECTROMAGNETIC elementary charge
e e/ h
1.602 176 462(63) × 10−19 2.417 989 491(95) × 1014
C A J−1
3.9 × 10−8 3.9 × 10−8
magnetic flux quantum h/2e conductance quantum 2e2/ h inverse of conductance quantum Josephson constanta 2e/ h von Klitzing constantb h/e2 = µ0 c/2α
0 G0 G −1 0 KJ
2.067 833 636(81) × 10−15 7.748 091 696(28) × 10−5 12 906.403 786(47) 483 597.898(19) × 109
Wb S Hz V−1
3.9 × 10−8 3.7 × 10−9 3.7 × 10−9 3.9 × 10−8
RK
25 812.807 572(95)
3.7 × 10−9
Bohr magneton e/2m e in eV T−1
µB
927.400 899(37) × 10−26 5.788 381 749(43) × 10−5 13.996 246 24(56) × 109 46.686 4521(19) 0.671 7131(12)
J T−1 eV T−1 Hz T−1 m−1 T−1 K T−1
4.0 × 10−8 7.3 × 10−9 4.0 × 10−8 4.0 × 10−8 1.7 × 10−6
5.050 783 17(20) × 10−27 3.152 451 238(24) × 10−8 7.622 593 96(31) 2.542 623 66(10) × 10−2 3.658 2638(64) × 10−4
J T−1 eV T−1 MHz T−1 m−1 T−1 K T−1
4.0 × 10−8 7.6 × 10−9 4.0 × 10−8 4.0 × 10−8 1.7 × 10−6
µB / h µB / hc µB /k nuclear magneton e/2m p in eV T−1
µN µN / h µN / hc µN /k
ATOMIC AND NUCLEAR General fine-structure constant e2/4π0 c inverse fine-structure constant
α α−1
7.297 352 533(27) × 10−3 137.035 999 76(50)
3.7 × 10−9 3.7 × 10−9
Fundamental Physical Constants Quantity
Rydberg constant α2 m e c/2h
Symbol
Unit
Relative std. uncert. u r
R∞ R∞ c R∞ hc
10 973 731.568 549(83) 3.289 841 960 368(25) × 1015 2.179 871 90(17) × 10−18 13.605 691 72(53)
m−1 Hz J eV
7.6 × 10−12 7.6 × 10−12 7.8 × 10−8 3.9 × 10−8
a0
0.529 177 2083(19) × 10−10
m
3.7 × 10−9
Eh
4.359 743 81(34) × 10−18 27.211 3834(11) 3.636 947 516(27) × 10−4 7.273 895 032(53) × 10−4
J eV m2 s−1 m2 s−1
7.8 × 10−8 3.9 × 10−8 7.3 × 10−9 7.3 × 10−9
GeV−2
8.6 × 10−6
R∞ hc in eV Bohr radius α/4π R∞ = 4π0 2/m e e2 Hartree energy e2/4πε0 a0 = 2R∞ hc = α2 m e c2 in eV quantum of circulation
Value
h/2m e h/m e
Electroweak Fermi coupling constantc weak mixing angled θW (on-shell scheme) 2 ≡ 1 − (m /m )2 sin2 θW = sW W Z
G F /(c)3
1.166 39(1) × 10−5
sin2 θW
0.2224(19)
8.7 × 10−3
Electron, e− 9.109 381 88(72) × 10−31
kg
7.9 × 10−8
c2
5.485 799 110(12) × 10−4 8.187 104 14(64) × 10−14 0.510 998 902(21)
u J MeV
2.1 × 10−9 7.9 × 10−8 4.0 × 10−8
electron-muon mass ratio electron-tau mass ratio electron-proton mass ratio electron-neutron mass ratio electron-deuteron mass ratio electron to alpha particle mass ratio
m e /m µ m e /m τ m e /m p m e /m n m e /m d m e /m α
4.836 332 10(15) × 10−3 2.875 55(47) × 10−4 5.446 170 232(12) × 10−4 5.438 673 462(12) × 10−4 2.724 437 1170(58) × 10−4 1.370 933 5611(29) × 10−4
electron charge to mass quotient electron molar mass NA m e Compton wavelength h/m e c λC /2π = αa0 = α2/4π R∞ classical electron radius α2 a0 Thomson cross section (8π/3)re2
−e/m e M(e), Me λC re σe
−1.758 820 174(71) × 1011 5.485 799 110(12) × 10−7 2.426 310 215(18) × 10−12 386.159 2642(28) × 10−15 2.817 940 285(31) × 10−15 0.665 245 854(15) × 10−28
C kg−1 kg mol−1 m m m m2
4.0 × 10−8 2.1 × 10−9 7.3 × 10−9 7.3 × 10−9 1.1 × 10−8 2.2 × 10−8
µe µe /µB µe /µN
−928.476 362(37) × 10−26 −1.001 159 652 1869(41) −1 838.281 9660(39)
J T−1
4.0 × 10−8 4.1 × 10−12 2.1 × 10−9
ae ge
1.159 652 1869(41) × 10−3 −2.002 319 304 3737(82)
3.5 × 10−9 4.1 × 10−12
µe /µµ
206.766 9720(63)
3.0 × 10−8
electron mass in u, m e = Ar (e) u (electron relative atomic mass times u) energy equivalent in MeV
electron magnetic moment to Bohr magneton ratio to nuclear magneton ratio electron magnetic moment anomaly |µe |/µB − 1 electron g-factor −2(1 + ae ) electron-muon magnetic moment ratio
me
me
C
3.0 × 10−8 1.6 × 10−4 2.1 × 10−9 2.2 × 10−9 2.1 × 10−9 2.1 × 10−9
Fundamental Physical Constants Quantity electron-proton magnetic moment ratio electron to shielded proton magnetic moment ratio (H2 O, sphere, 25 ◦ C) electron-neutron magnetic moment ratio electron-deuteron magnetic moment ratio electron to shielded helione magnetic moment ratio (gas, sphere, 25 ◦ C) electron gyromagnetic ratio 2|µe |/
Symbol
Value
Unit
Relative std. uncert. u r
µe /µp
− 658.210 6875(66)
1.0 × 10−8
µe /µ p
− 658.227 5954(71)
1.1 × 10−8
µe /µn
960.920 50(23)
2.4 × 10−7
µe /µd
−2 143.923 498(23)
1.1 × 10−8
µe /µ h
864.058 255(10)
1.2 × 10−8
γe γe /2π
1.760 859 794(71) × 1011 28 024.9540(11)
s−1 T−1 MHz T−1
4.0 × 10−8 4.0 × 10−8
1.883 531 09(16) × 10−28
kg
8.4 × 10−8
0.113 428 9168(34) 1.692 833 32(14) × 10−11 105.658 3568(52)
u J MeV
3.0 × 10−8 8.4 × 10−8 4.9 × 10−8
kg mol−1
3.0 × 10−8 1.6 × 10−4 3.0 × 10−8 3.0 × 10−8 3.0 × 10−8
Muon, µ− muon mass in u, m µ = Ar (µ) u (muon relative atomic mass times u) energy equivalent in MeV
mµ
mµ
c2
muon-electron mass ratio muon-tau mass ratio muon-proton mass ratio muon-neutron mass ratio muon molar mass NA m µ
m µ /m e m µ /m τ m µ /m p m µ /m n M(µ), Mµ
206.768 2657(63) 5.945 72(97) × 10−2 0.112 609 5173(34) 0.112 454 5079(34) 0.113 428 9168(34) × 10−3
muon Compton wavelength h/m µ c λC,µ /2π muon magnetic moment to Bohr magneton ratio to nuclear magneton ratio
λC,µ
µµ µµ /µB µµ /µN
11.734 441 97(35) × 10−15 1.867 594 444(55) × 10−15 −4.490 448 13(22) × 10−26 −4.841 970 85(15) × 10−3 −8.890 597 70(27)
aµ gµ
1.165 916 02(64) × 10−3 −2.002 331 8320(13)
5.5 × 10−7 6.4 × 10−10
µµ /µp
−3.183 345 39(10)
3.2 × 10−8
muon magnetic moment anomaly |µµ |/(e/2m µ ) − 1 muon g-factor −2(1 + aµ ) muon-proton magnetic moment ratio
C,µ
m m J T−1
2.9 × 10−8 2.9 × 10−8 4.9 × 10−8 3.0 × 10−8 3.0 × 10−8
Tau, τ − tau massf in u, m τ = Ar (τ) u (tau relative atomic mass times u) energy equivalent in MeV
mτ
mτ
c2
3.167 88(52) × 10−27
kg
1.6 × 10−4
1.907 74(31) 2.847 15(46) × 10−10 1 777.05(29)
u J MeV
1.6 × 10−4 1.6 × 10−4 1.6 × 10−4
Fundamental Physical Constants Quantity
Symbol
tau-electron mass ratio tau-muon mass ratio tau-proton mass ratio tau-neutron mass ratio tau molar mass NA m τ
m τ /m e m τ /m µ m τ /m p m τ /m n M(τ), Mτ
tau Compton wavelength h/m τ c λC,τ /2π
λC,τ C,τ
Unit
Relative std. uncert. u r
3 477.60(57) 16.8188(27) 1.893 96(31) 1.891 35(31) 1.907 74(31) × 10−3
kg mol−1
1.6 × 10−4 1.6 × 10−4 1.6 × 10−4 1.6 × 10−4 1.6 × 10−4
0.697 70(11) × 10−15 0.111 042(18) × 10−15
m m
1.6 × 10−4 1.6 × 10−4
1.672 621 58(13) × 10−27
kg
7.9 × 10−8
1.007 276 466 88(13) 1.503 277 31(12) × 10−10 938.271 998(38)
u J MeV
1.3 × 10−10 7.9 × 10−8 4.0 × 10−8
C kg−1 kg mol−1
2.1 × 10−9 3.0 × 10−8 1.6 × 10−4 5.8 × 10−10 4.0 × 10−8 1.3 × 10−10
Value
Proton, p proton mass in u, m p = Ar (p) u (proton relative atomic mass times u) energy equivalent in MeV
mp
mp
c2
proton-electron mass ratio proton-muon mass ratio proton-tau mass ratio proton-neutron mass ratio proton charge to mass quotient proton molar mass NA m p
m p /m e m p /m µ m p /m τ m p /m n e/m p M(p), Mp
1 836.152 6675(39) 8.880 244 08(27) 0.527 994(86) 0.998 623 478 55(58) 9.578 834 08(38) × 107 1.007 276 466 88(13) × 10−3
proton Compton wavelength h/m p c λC,p /2π proton magnetic moment to Bohr magneton ratio to nuclear magneton ratio proton g-factor 2µp /µN
λC,p µp µp /µB µp /µN gp
1.321 409 847(10) × 10−15 0.210 308 9089(16) × 10−15 1.410 606 633(58) × 10−26 1.521 032 203(15) × 10−3 2.792 847 337(29) 5.585 694 675(57)
µp /µn µ p
−1.459 898 05(34) 1.410 570 399(59) × 10−26
µ p /µB µ p /µN
1.520 993 132(16) × 10−3 2.792 775 597(31)
1.1 × 10−8 1.1 × 10−8
σp
25.687(15) × 10−6
5.7 × 10−4
γp γp /2π
2.675 222 12(11) × 108 42.577 4825(18)
s−1 T−1 MHz T−1
4.1 × 10−8 4.1 × 10−8
γp
2.675 153 41(11) × 108
s−1 T−1
4.2 × 10−8
γp /2π
42.576 3888(18)
MHz T−1
4.2 × 10−8
proton-neutron magnetic moment ratio shielded proton magnetic moment (H2 O, sphere, 25 ◦ C) to Bohr magneton ratio to nuclear magneton ratio proton magnetic shielding correction 1 − µ p /µp (H2 O, sphere, 25 ◦ C) proton gyromagnetic ratio 2µp / shielded proton gyromagnetic ratio 2µ p / (H2 O, sphere, 25 ◦ C)
C,p
Neutron, n
m m J T−1
J T−1
7.6 × 10−9 7.6 × 10−9 4.1 × 10−8 1.0 × 10−8 1.0 × 10−8 1.0 × 10−8 2.4 × 10−7 4.2 × 10−8
Fundamental Physical Constants Quantity
Symbol
Value
Unit
Relative std. uncert. u r
mn
1.674 927 16(13) × 10−27
kg
7.9 × 10−8
m n c2
1.008 664 915 78(55) 1.505 349 46(12) × 10−10 939.565 330(38)
u J MeV
5.4 × 10−10 7.9 × 10−8 4.0 × 10−8
neutron-electron mass ratio neutron-muon mass ratio neutron-tau mass ratio neutron-proton mass ratio neutron molar mass NA m n
m n /m e m n /m µ m n /m τ m n /m p M(n), Mn
1 838.683 6550(40) 8.892 484 78(27) 0.528 722(86) 1.001 378 418 87(58) 1.008 664 915 78(55) × 10−3
kg mol−1
2.2 × 10−9 3.0 × 10−8 1.6 × 10−4 5.8 × 10−10 5.4 × 10−10
neutron Compton wavelength h/m n c λC,n /2π neutron magnetic moment to Bohr magneton ratio to nuclear magneton ratio
λC,n µn µn /µB µn /µN
1.319 590 898(10) × 10−15 0.210 019 4142(16) × 10−15 −0.966 236 40(23) × 10−26 −1.041 875 63(25) × 10−3 −1.913 042 72(45)
gn
−3.826 085 45(90)
2.4 × 10−7
µn /µe
1.040 668 82(25) × 10−3
2.4 × 10−7
µn /µp
−0.684 979 34(16)
2.4 × 10−7
µn /µ p
−0.684 996 94(16)
2.4 × 10−7
γn γn /2π
1.832 471 88(44) × 108 29.164 6958(70)
neutron mass in u, m n = Ar (n) u (neutron relative atomic mass times u) energy equivalent in MeV
neutron g-factor 2µn /µN neutron-electron magnetic moment ratio neutron-proton magnetic moment ratio neutron to shielded proton magnetic moment ratio (H2 O, sphere, 25 ◦ C) neutron gyromagnetic ratio 2|µn |/
C,n
m m J T−1
7.6 × 10−9 7.6 × 10−9 2.4 × 10−7 2.4 × 10−7 2.4 × 10−7
s−1 T−1 MHz T−1
2.4 × 10−7 2.4 × 10−7
3.343 583 09(26) × 10−27
kg
7.9 × 10−8
2.013 553 212 71(35) 3.005 062 62(24) × 10−10 1 875.612 762(75)
u J MeV
1.7 × 10−10 7.9 × 10−8 4.0 × 10−8
kg mol−1
2.1 × 10−9 2.0 × 10−10 1.7 × 10−10
Deuteron, d deuteron mass in u, m d = Ar (d) u (deuteron relative atomic mass times u) energy equivalent in MeV
md
md
c2
deuteron-electron mass ratio deuteron-proton mass ratio deuteron molar mass NA m d
m d /m e m d /m p M(d), Md
3 670.482 9550(78) 1.999 007 500 83(41) 2.013 553 212 71(35) × 10−3
deuteron magnetic moment to Bohr magneton ratio to nuclear magneton ratio
µd µd /µB µd /µN
0.433 073 457(18) × 10−26 0.466 975 4556(50) × 10−3 0.857 438 2284(94)
µd /µe
−4.664 345 537(50) × 10−4
1.1 × 10−8
µd /µp
0.307 012 2083(45)
1.5 × 10−8
deuteron-electron magnetic moment ratio deuteron-proton magnetic moment ratio
J T−1
4.2 × 10−8 1.1 × 10−8 1.1 × 10−8
Fundamental Physical Constants Quantity deuteron-neutron magnetic moment ratio
Symbol
Value
µd /µn
Unit
Relative std. uncert. u r
2.4 × 10−7
−0.448 206 52(11) Helion, h
helion masse in u, m h = Ar (h) u (helion relative atomic mass times u) energy equivalent in MeV helion-electron mass ratio helion-proton mass ratio helion molar mass NA m h shielded helion magnetic moment (gas, sphere, 25 ◦ C) to Bohr magneton ratio to nuclear magneton ratio shielded helion to proton magnetic moment ratio (gas, sphere, 25 ◦ C) shielded helion to shielded proton magnetic moment ratio (gas/H2 O, spheres, 25 ◦ C) shielded helion gyromagnetic ratio 2|µ h |/ (gas, sphere, 25 ◦ C)
mh
mh
c2
5.006 411 74(39) × 10−27
kg
7.9 × 10−8
3.014 932 234 69(86) 4.499 538 48(35) × 10−10 2 808.391 32(11)
u J MeV
2.8 × 10−10 7.9 × 10−8 4.0 × 10−8
kg mol−1 J T−1
2.1 × 10−9 3.1 × 10−10 2.8 × 10−10 4.2 × 10−8
m h /m e m h /m p M(h), Mh µ h
5 495.885 238(12) 2.993 152 658 50(93) 3.014 932 234 69(86) × 10−3 −1.074 552 967(45) × 10−26
µ h /µB µ h /µN
−1.158 671 474(14) × 10−3 −2.127 497 718(25)
1.2 × 10−8 1.2 × 10−8
µ h /µp
−0.761 766 563(12)
1.5 × 10−8
µ h /µ p
−0.761 786 1313(33)
4.3 × 10−9
γh
2.037 894 764(85) × 108
s−1 T−1
4.2 × 10−8
γh /2π
32.434 1025(14)
MHz T−1
4.2 × 10−8
6.644 655 98(52) × 10−27
kg
7.9 × 10−8
4.001 506 1747(10) 5.971 918 97(47) × 10−10 3 727.379 04(15)
u J MeV
2.5 × 10−10 7.9 × 10−8 4.0 × 10−8
kg mol−1
2.1 × 10−9 2.8 × 10−10 2.5 × 10−10
Alpha particle, α alpha particle mass in u, m α = Ar (α) u (alpha particle relative atomic mass times u) energy equivalent in MeV alpha particle to electron mass ratio alpha particle to proton mass ratio alpha particle molar mass NA m α
mα
mα
c2
m α /m e m α /m p M(α), Mα
7 294.299 508(16) 3.972 599 6846(11) 4.001 506 1747(10) × 10−3
PHYSICO-CHEMICAL Avogadro constant atomic mass constant 1 m u = 12 m(12 C) = 1 u = 10−3 kg mol−1/NA energy equivalent in MeV Faraday constantg NA e
NA , L
6.022 141 99(47) × 1023
mol−1
7.9 × 10−8
mu
1.660 538 73(13) × 10−27
kg
7.9 × 10−8
m u c2
1.492 417 78(12) × 10−10 931.494 013(37) 96 485.3415(39)
J MeV C mol−1
7.9 × 10−8 4.0 × 10−8 4.0 × 10−8
F
Fundamental Physical Constants Quantity
molar Planck constant molar gas constant Boltzmann constant R/NA in eV K−1
molar volume of ideal gas RT / p T = 273.15 K, p = 101.325 kPa Loschmidt constant NA /Vm T = 273.15 K, p = 100 kPa Sackur-Tetrode constant (absolute entropy constant)h 5 2 3/2 kT / p ] 1 0 2 + ln[(2πm u kT1 / h ) T1 = 1 K, p0 = 100 kPa T1 = 1 K, p0 = 101.325 kPa Stefan-Boltzmann constant (π 2 /60)k 4/3 c2 first radiation constant 2πhc2 first radiation constant for spectral radiance 2hc2 second radiation constant hc/k Wien displacement law constant b = λmax T = c2 /4.965 114 231...
Value
Unit
Relative std. uncert. u r
k/ h k/ hc
3.990 312 689(30) × 10−10 0.119 626 564 92(91) 8.314 472(15) 1.380 6503(24) × 10−23 8.617 342(15) × 10−5 2.083 6644(36) × 1010 69.503 56(12)
J s mol−1 J m mol−1 J mol−1 K−1 J K−1 eV K−1 Hz K−1 m−1 K−1
7.6 × 10−9 7.6 × 10−9 1.7 × 10−6 1.7 × 10−6 1.7 × 10−6 1.7 × 10−6 1.7 × 10−6
Vm n0 Vm
22.413 996(39) × 10−3 2.686 7775(47) × 1025 22.710 981(40) × 10−3
m3 mol−1 m−3 m3 mol−1
1.7 × 10−6 1.7 × 10−6 1.7 × 10−6
S0 /R
−1.151 7048(44) −1.164 8678(44)
σ c1 c1L c2
5.670 400(40) × 10−8 3.741 771 07(29) × 10−16 1.191 042 722(93) × 10−16 1.438 7752(25) × 10−2
W m−2 K−4 W m2 W m2 sr−1 mK
7.0 × 10−6 7.8 × 10−8 7.8 × 10−8 1.7 × 10−6
b
2.897 7686(51) × 10−3
mK
1.7 × 10−6
Symbol
NA h NA hc R k
3.8 × 10−6 3.7 × 10−6
a See the “Adopted values” table for the conventional value adopted internationally for realizing representations of the volt using the Joseph-
son effect. b See the “Adopted values” table for the conventional value adopted internationally for realizing representations of the ohm using the quantum Hall
effect. c Value recommended by the Particle Data Group, Caso et al., Eur. Phys. J. C 3(1-4), 1-794 (1998). d Based on the ratio of the masses of the W and Z bosons m /m recommended by the Particle Data Group (Caso et al., 1998). The value for W Z sin2 θW they recommend, which is based on a particular variant of the modified minimal subtraction (MS) scheme, is sin2 θˆW (MZ ) = 0.231 24(24). e The helion, symbol h, is the nucleus of the 3 He atom. f This and all other values involving m are based on the value of m c2 in MeV recommended by the Particle Data Group, Caso et al., Eur. Phys. τ τ J. C 3(1-4), 1-794 (1998), but with a standard uncertainty of 0.29 MeV rather than the quoted uncertainty of −0.26 MeV, +0.29 MeV. g The numerical value of F to be used in coulometric chemical measurements is 96 485.3432(76) [7.9×10−8 ] when the relevant current is measured in terms of representations of the volt and ohm based on the Josephson and quantum Hall effects and the internationally adopted conventional values of the Josephson and von Klitzing constants K J−90 and RK−90 given in the “Adopted values” table. h The entropy of an ideal monoatomic gas of relative atomic mass A is given by S = S + 3 R ln A − R ln( p/ p ) + 5 R ln(T/K). r r 0 0 2 2
Fundamental Physical Constants — Adopted values Relative std. uncert. u r
Quantity
Symbol
Value
Unit
molar mass of 12 C molar mass constanta M(12 C)/12 conventional value of Josephson constantb conventional value of von Klitzing constantc standard atmosphere standard acceleration of gravity
M(12 C) Mu
12 × 10−3 1 × 10−3
kg mol−1 kg mol−1
(exact) (exact)
K J−90
483 597.9
GHz V−1
(exact)
RK−90
25 812.807 101 325 9.806 65
Pa m s−2
(exact) (exact) (exact)
gn a The relative atomic mass A (X) of particle X with mass m(X) is defined by A (X) = m(X)/m , where m = m(12 C)/12 = M /N = 1 u is r r u u u A the atomic mass constant, NA is the Avogadro constant, and u is the atomic mass unit. Thus the mass of particle X in u is m(X) = A r (X) u and the molar mass of X is M(X) = Ar (X)Mu . b This is the value adopted internationally for realizing representations of the volt using the Josephson effect. c This is the value adopted internationally for realizing representations of the ohm using the quantum Hall effect.
Energy Equivalents J
kg
m−1
Hz
1J
(1 J) = 1J
(1 J)/c2 = 1.112 650 056 × 10−17 kg
(1 J)/hc = 5.034 117 62(39) × 1024 m−1
(1 J)/h = 1.509 190 50(12) × 1033 Hz
1 kg
(1 kg)c2 = 8.987 551 787 × 1016 J
(1 kg) = 1 kg
(1 kg)c/ h = 4.524 439 29(35) × 1041 m−1
(1 kg)c2 / h = 1.356 392 77(11) × 1050 Hz
1 m−1
(1 m−1 )hc = 1.986 445 44(16) × 10−25 J
(1 m−1 )h/c = 2.210 218 63(17) × 10−42 kg
(1 m−1 ) = 1 m−1
(1 m−1 )c = 299 792 458 Hz
1 Hz
(1 Hz)h = 6.626 068 76(52) × 10−34 J
(1 Hz)h/c2 = 7.372 495 78(58) × 10−51 kg
(1 Hz)/c = 3.335 640 952 × 10−9 m−1
(1 Hz) = 1 Hz
1K
(1 K)k = 1.380 6503(24) × 10−23 J
(1 K)k/c2 = 1.536 1807(27) × 10−40 kg
(1 K)k/ hc = 69.503 56(12) m−1
(1 K)k/ h = 2.083 6644(36) × 1010 Hz
1 eV
(1 eV) = 1.602 176 462(63) × 10−19 J
(1 eV)/ hc = (1 eV)/c2 = 1.782 661 731(70) × 10−36 kg 8.065 544 77(32) × 105 m−1
1u
(1 u)c2 = 1.492 417 78(12) × 10−10 J
(1 u) = 1.660 538 73(13) × 10−27 kg
(1 u)c/ h = 7.513 006 658(57) × 1014 m−1
(1 u)c2 / h = 2.252 342 733(17) × 1023 Hz
1 Eh
(1 E h ) = 4.359 743 81(34) × 10−18 J
(1 E h )/c2 = 4.850 869 19(38) × 10−35 kg
(1 E h )/ hc = 2.194 746 313 710(17) × 107 m−1
(1 E h )/ h = 6.579 683 920 735(50) × 1015 Hz
(1 eV)/ h = 2.417 989 491(95) × 1014 Hz
Derived from the relations E = mc2 = hc/λ = hν = kT , and based on the 1998 CODATA adjustment of the values of the constants; 1 m(12 C) = 10−3 kg mol−1/N , and E = 2R hc = α 2 m c2 is the Hartree energy (hartree). 1 eV = (e/C) J, 1 u = m u = 12 ∞ e A h
Energy Equivalents K
eV
u
Eh
1J
(1 J)/k = 7.242 964(13) × 1022 K
(1 J) = 6.241 509 74(24) × 1018 eV
(1 J)/c2 = 6.700 536 62(53) × 109 u
(1 J) = 2.293 712 76(18) × 1017 E h
1 kg
(1 kg)c2/k = 6.509 651(11) × 1039 K
(1 kg)c2 = 5.609 589 21(22) × 1035 eV
(1 kg) = 6.022 141 99(47) × 1026 u
(1 kg)c2 = 2.061 486 22(16) × 1034 E h
1 m−1
(1 m−1 )hc/k = 1.438 7752(25) × 10−2 K
(1 m−1 )hc = (1 m−1 )h/c = (1 m−1 )hc = −6 −15 1.239 841 857(49) × 10 eV 1.331 025 042(10) × 10 u 4.556 335 252 750(35) × 10−8 E h
1 Hz
(1 Hz)h/k = (1 Hz)h = 4.799 2374(84) × 10−11 K 4.135 667 27(16) × 10−15 eV
(1 Hz)h/c2 = (1 Hz)h = 4.439 821 637(34) × 10−24 u 1.519 829 846 003(12) × 10−16 E h
1K
(1 K) = 1K
(1 K)k = 8.617 342(15) × 10−5 eV
(1 K)k/c2 = 9.251 098(16) × 10−14 u
(1 K)k = 3.166 8153(55) × 10−6 E h
1 eV
(1 eV)/k = 1.160 4506(20) × 104 K
(1 eV) = 1 eV
(1 eV)/c2 = 1.073 544 206(43) × 10−9 u
(1 eV) = 3.674 932 60(14) × 10−2 E h
1u
(1 u)c2/k = 1.080 9528(19) × 1013 K
(1 u)c2 = 931.494 013(37) × 106 eV
(1 u) = 1u
(1 u)c2 = 3.423 177 709(26) × 107 E h
1 Eh
(1 E h )/k = 3.157 7465(55) × 105 K
(1 E h ) = 27.211 3834(11) eV
(1 E h )/c2 = 2.921 262 304(22) × 10−8 u
(1 E h ) = 1 Eh
Derived from the relations E = mc2 = hc/λ = hν = kT , and based on the 1998 CODATA adjustment of the values of the constants; 1 m(12 C) = 10−3 kg mol−1/N , and E = 2R hc = α 2 m c2 is the Hartree energy (hartree). 1 eV = (e/C) J, 1 u = m u = 12 ∞ e A h
STANDARD ATOMIC WEIGHTS (1997) This table of atomic weights is reprinted from the 1997 report of the IUPAC Commission on Atomic Weights and Isotopic Abundances. The Standard Atomic Weights apply to the elements as they exist naturally on Earth, and the uncertainties take into account the isotopic variation found in most laboratory samples. Further comments on the variability are given in the footnotes. The number in parentheses following the atomic weight value gives the uncertainty in the last digit. An entry in brackets indicates the mass number of the longest-lived isotope of an element that has no stable isotopes and for which a Standard Atomic Weight cannot be defined because of wide variability in isotopic composition (or complete absence) in nature. REFERENCE Vocke, R. D. (for IUPAC Commission on Atomic Weights and Isotopic Abundances), Atomic Weights of the Elements 1997, Pure Appl. Chem., 71, 1593, 1999.
Name Actinium Aluminum Americium Antimony Argon Arsenic Astatine Barium Berkelium Beryllium Bismuth Bohrium Boron Bromine Cadmium Calcium Californium Carbon Cerium Cesium Chlorine Chromium Cobalt Copper Curium Dubnium Dysprosium Einsteinium Erbium Europium Fermium Fluorine Francium Gadolinium Gallium Germanium Gold Hafnium Hassium Helium Holmium Hydrogen Indium Iodine
Symbol
At. no.
Atomic Weight
Ac Al Am Sb Ar As At Ba Bk Be Bi Bh B Br Cd Ca Cf C Ce Cs Cl Cr Co Cu Cm Db Dy Es Er Eu Fm F Fr Gd Ga Ge Au Hf Hs He Ho H In I
89 13 95 51 18 33 85 56 97 4 83 107 5 35 48 20 98 6 58 55 17 24 27 29 96 105 66 99 68 63 100 9 87 64 31 32 79 72 108 2 67 1 49 53
[227] 26.981538(2) [243] 121.760(1) 39.948(1) 74.92160(2) [210] 137.327(7) [247] 9.012182(3) 208.98038(2) [264] 10.811(7) 79.904(1) 112.411(8) 40.078(4) [251] 12.0107(8) 140.116(1) 132.90545(2) 35.4527(9) 51.9961(6) 58.933200(9) 63.546(3) [247] [262] 162.50(3) [252] 167.26(3) 151.964(1) [257] 18.9984032(5) [223] 157.25(3) 69.723(1) 72.61(2) 196.96655(2) 178.49(2) [269] 4.002602(2) 164.93032(2) 1.00794(7) 114.818(3) 126.90447(3)
1-12
Footnotes
g g
g
r
m
r
g g g g
r
m
r
g g g
g
g g
r m
r
STANDARD ATOMIC WEIGHTS (1997) (continued)
Name
Symbol
At. no.
Iridium Iron Krypton Lanthanum Lawrencium Lead Lithium Lutetium Magnesium Manganese Meitnerium Mendelevium Mercury Molybdenum Neodymium Neon Neptunium Nickel Niobium Nitrogen Nobelium Osmium Oxygen Palladium Phosphorus Platinum Plutonium Polonium Potassium Praseodymium Promethium Protactinium Radium Radon Rhenium Rhodium Rubidium Ruthenium Rutherfordium Samarium Scandium Seaborgium Selenium Silicon Silver Sodium Strontium Sulfur Tantalum Technetium Tellurium Terbium Thallium Thorium Thulium Tin Titanium Tungsten
Ir Fe Kr La Lr Pb Li Lu Mg Mn Mt Md Hg Mo Nd Ne Np Ni Nb N No Os O Pd P Pt Pu Po K Pr Pm Pa Ra Rn Re Rh Rb Ru Rf Sm Sc Sg Se Si Ag Na Sr S Ta Tc Te Tb Tl Th Tm Sn Ti W
77 26 36 57 103 82 3 71 12 25 109 101 80 42 60 10 93 28 41 7 102 76 8 46 15 78 94 84 19 59 61 91 88 86 75 45 37 44 104 62 21 106 34 14 47 11 38 16 73 43 52 65 81 90 69 50 22 74
Atomic Weight 192.217(3) 55.845(2) 83.80(1) 138.9055(2) [262] 207.2(1) 6.941(2)* 174.967(1) 24.3050(6) 54.938049(9) [268] [258] 200.59(2) 95.94(1) 144.24(3) 20.1797(6) [237] 58.6934(2) 92.90638(2) 14.00674(7) [259] 190.23(3) 15.9994(3) 106.42(1) 30.973761(2) 195.078(2) [244] [209] 39.0983(1) 140.90765(2) [145] 231.03588(2) [226] [222] 186.207(1) 102.90550(2) 85.4678(3) 101.07(2) [261] 150.36(3) 44.955910(8) [266] 78.96(3) 28.0855(3) 107.8682(2) 22.989770(2) 87.62(1) 32.066(6) 180.9479(1) [98] 127.60(3) 158.92534(2) 204.3833(2) 232.0381(1) 168.93421(2) 118.710(7) 47.867(1) 183.84(1)
1-13
Footnotes
g g g g g
g g g
m
m
r r
m
g
r
g g g
r
g
g g g
r g g g
g
g g
r r
STANDARD ATOMIC WEIGHTS (1997) (continued) Name Uranium Vanadium Xenon Ytterbium Yttrium Zinc Zirconium * g m r
Symbol
At. no.
Atomic Weight
U V Xe Yb Y Zn Zr
92 23 54 70 39 30 40
238.0289(1) 50.9415(1) 131.29(2) 173.04(3) 88.90585(2) 65.39(2) 91.224(2)
Footnotes g
m
g g
m
g
Commercially available Li materials have atomic weights that are known to range between 6.939 and 6.996; if a more accurate value is required, it must be determined for the specific material. geological specimens are known in which the element has an isotopic composition outside the limits for normal material. The difference between the atomic weight of the element in such specimens and that given in the table may exceed the stated uncertainty. modified isotopic compositions may be found in commercially available material because it has been subjected to an undisclosed or inadvertent isotopic fractionation. Substantial deviations in atomic weight of the element from that given the table can occur. range in isotopic composition of normal terrestrial material prevents a more precise atomic weight being given; the tabulated atomic weight value should be applicable to any normal material.
1-14
ATOMIC MASSES AND ABUNDANCES This table lists the mass (in atomic mass units, symbol u) and the natural abundance (in percent) of the stable nuclides and a few important radioactive nuclides. A complete table of all nuclides may be found in Section 11 (“Table of the Isotopes”). The atomic masses are based on the 1995 evaluation of Audi and Wapstra (Reference 2). The number in parentheses following the mass value is the uncertainty in the last digit(s) given. Natural abundance values are also followed by uncertainties in the last digit(s) of the stated values. This uncertainty includes both the estimated measurement uncertainty and the reported range of variation in different terrestrial sources of the element (see Reference 3 and 4 for more details). The absence of an entry in the Abundance column indicates a radioactive nuclide not present in nature or an element whose isotopic composition varies so widely that a meaningful natural abundance cannot be defined. An electronic version of these data is available on the Web site of the NIST Physics Laboratory (Reference 5). REFERENCES 1. Holden, N. E., “Table of the Isotopes”, in Lide, D. R., Ed., CRC Handbook of Chemistry and Physics, 82nd Ed., CRC Press, Boca Raton FL, 2001. 2. Audi, G., and Wapstra, A. H., Nucl. Phys., A595, 409, 1995. 3. Rosman, K. J. R., and Taylor, P. D. P., J. Phys. Chem. Ref. Data, 27, 1275, 1998. 4. R. D. Vocke (for IUPAC Commission on Atomic Weights and Isotopic Abundances), Pure Appl. Chem., 71, 1593, 1999. 5. Coursey, J. S., and Dragoset, R. A., Atomic Weights and Isotopic Compositions (version 2.1). Available: http://physics.nist.gov/Compositions/ National Institute of Standards and Technology, Gaithersburg, MD. Z 1
Isotope 1H 2D 3T
2
3He 4He
3
6Li 7Li
4 5
9Be 10B 11B
6
12C 13C
7
14N 15N
8
16O 17O 18O
9 10
19F 20Ne 21Ne 22Ne
11 12
23Na 24Mg 25Mg 26Mg
13 14
27Al 28Si 29Si 30Si
15 16
31P 32S 33S 34S 36S
17
35Cl 37Cl
18
36Ar 38Ar
Mass in u 1.0078250321(4) 2.0141017780(4) 3.0160492675(11) 3.0160293097(9) 4.0026032497(10) 6.0151223(5) 7.0160040(5) 9.0121821(4) 10.0129370(4) 11.0093055(5) 12.0000000(0) 13.0033548378(10) 14.0030740052(9) 15.0001088984(9) 15.9949146221(15) 16.99913150(22) 17.9991604(9) 18.99840320(7) 19.9924401759(20) 20.99384674(4) 21.99138551(23) 22.98976967(23) 23.98504190(20) 24.98583702(20) 25.98259304(21) 26.98153844(14) 27.9769265327(20) 28.97649472(3) 29.97377022(5) 30.97376151(20) 31.97207069(12) 32.97145850(12) 33.96786683(11) 35.96708088(25) 34.96885271(4) 36.96590260(5) 35.96754628(27) 37.9627322(5)
Abundance in %
Z
Isotope 40Ar
99.9850(70) 0.0115(70)
19
39K 40K 41K
0.000137(3) 99.999863(3) 7.59(4) 92.41(4) 100 19.9(7) 80.1(7) 98.93(8) 1.07(8) 99.632(7) 0.368(7) 99.757(16) 0.038(1) 0.205(14) 100 90.48(3) 0.27(1) 9.25(3) 100 78.99(4) 10.00(1) 11.01(3) 100 92.2297(7) 4.6832(5) 3.0872(5) 100 94.93(31) 0.76(2) 4.29(28) 0.02(1) 75.78(4) 24.22(4) 0.3365(30) 0.0632(5)
20
40Ca 42Ca 43Ca 44Ca 46Ca 48Ca
21 22
45Sc 46Ti 47Ti 48Ti 49Ti 50Ti
23
50V 51V
24
50Cr 52Cr 53Cr 54Cr
25 26
55Mn 54Fe 56Fe 57Fe 58Fe
27 28
59Co 58Ni 60Ni 61Ni 62Ni 64Ni
29
63Cu 65Cu
30
64Zn 66Zn 67Zn
1-15
Mass in u 39.962383123(3) 38.9637069(3) 39.96399867(29) 40.96182597(28) 39.9625912(3) 41.9586183(4) 42.9587668(5) 43.9554811(9) 45.9536928(25) 47.952534(4) 44.9559102(12) 45.9526295(12) 46.9517638(10) 47.9479471(10) 48.9478708(10) 49.9447921(11) 49.9471628(14) 50.9439637(14) 49.9460496(14) 51.9405119(15) 52.9406538(15) 53.9388849(15) 54.9380496(14) 53.9396148(14) 55.9349421(15) 56.9353987(15) 57.9332805(15) 58.9332002(15) 57.9353479(15) 59.9307906(15) 60.9310604(15) 61.9283488(15) 63.9279696(16) 62.9296011(15) 64.9277937(19) 63.9291466(18) 65.9260368(16) 66.9271309(17)
Abundance in % 99.6003(30) 93.2581(44) 0.0117(1) 6.7302(44) 96.941(156) 0.647(23) 0.135(10) 2.086(110) 0.004(3) 0.187(21) 100 8.25(3) 7.44(2) 73.72(3) 5.41(2) 5.18(2) 0.250(4) 99.750(4) 4.345(13) 83.789(18) 9.501(17) 2.365(7) 100 5.845(35) 91.754(36) 2.119(10) 0.282(4) 100 68.0769(89) 26.2231(77) 1.1399(6) 3.6345(17) 0.9256(9) 69.17(3) 30.83(3) 48.63(60) 27.90(27) 4.10(13)
ATOMIC MASSES AND ABUNDANCES (continued) Z
Isotope 68Zn 70Zn
31
69Ga 71Ga
32
70Ge 72Ge 73Ge 74Ge 76Ge
33 34
75As 74Se 76Se 77Se 78Se 80Se 82Se
35
79Br 81Br
36
78Kr 80Kr 82Kr 83Kr 84Kr 86Kr
37
85Rb 87Rb
38
84Sr 86Sr 87Sr 88Sr
39 40
89Y 90Zr 91Zr 92Zr 94Zr 96Zr
41 42
93Nb 92Mo 94Mo 95Mo 96Mo 97Mo 98Mo 100Mo
43
97Tc 98Tc 99Tc
44
96Ru 98Ru 99Ru 100Ru 101Ru 102Ru 104Ru
45 46
103Rh 102Pd 104Pd 105Pd
Mass in u 67.9248476(17) 69.925325(4) 68.925581(3) 70.9247050(19) 69.9242504(19) 71.9220762(16) 72.9234594(16) 73.9211782(16) 75.9214027(16) 74.9215964(18) 73.9224766(16) 75.9192141(16) 76.9199146(16) 77.9173095(16) 79.9165218(20) 81.9167000(22) 78.9183376(20) 80.916291(3) 77.920386(7) 79.916378(4) 81.9134846(28) 82.914136(3) 83.911507(3) 85.9106103(12) 84.9117893(25) 86.9091835(27) 83.913425(4) 85.9092624(24) 86.9088793(24) 87.9056143(24) 88.9058479(25) 89.9047037(23) 90.9056450(23) 91.9050401(23) 93.9063158(25) 95.908276(3) 92.9063775(24) 91.906810(4) 93.9050876(20) 94.9058415(20) 95.9046789(20) 96.9060210(20) 97.9054078(20) 99.907477(6) 96.906365(5) 97.907216(4) 98.9062546(21) 95.907598(8) 97.905287(7) 98.9059393(21) 99.9042197(22) 100.9055822(22) 101.9043495(22) 103.905430(4) 102.905504(3) 101.905608(3) 103.904035(5) 104.905084(5)
Abundance in %
Z
Isotope 106Pd
18.75(51) 0.62(3) 60.108(9) 39.892(9) 20.84(87) 27.54(34) 7.73(5) 36.28(73) 7.61(38) 100 0.89(4) 9.37(29) 7.63(16) 23.77(28) 49.61(41) 8.73(22) 50.69(7) 49.31(7) 0.35(1) 2.28(6) 11.58(14) 11.49(6) 57.00(4) 17.30(22) 72.17(2) 27.83(2) 0.56(1) 9.86(1) 7.00(1) 82.58(1) 100 51.45(40) 11.22(5) 17.15(8) 17.38(28) 2.80(9) 100 14.84(35) 9.25(12) 15.92(13) 16.68(2) 9.55(8) 24.13(31) 9.63(23)
108Pd 110Pd
47
107Ag 109Ag
48
106Cd 108Cd 110Cd 111Cd 112Cd 113Cd 114Cd 116Cd
49
113In 115In
50
112Sn 114Sn 115Sn 116Sn 117Sn 118Sn 119Sn 120Sn 122Sn 124Sn
51
121Sb 123Sb
52
120Te 122Te 123Te 124Te 125Te 126Te 128Te 130Te
53 54
127I 124Xe 126Xe 128Xe 129Xe 130Xe 131Xe 132Xe 134Xe 136Xe
55 56
133Cs 130Ba 132Ba
5.54(14) 1.87(3) 12.76(14) 12.60(7) 17.06(2) 31.55(14) 18.62(27) 100 1.02(1) 11.14(8) 22.33(8)
134Ba 135Ba 136Ba 137Ba 138Ba
57
138La 139La
58
136Ce 138Ce 140Ce
1-16
Mass in u 105.903483(5) 107.903894(4) 109.905152(12) 106.905093(6) 108.904756(3) 105.906458(6) 107.904183(6) 109.903006(3) 110.904182(3) 111.9027572(30) 112.9044009(30) 113.9033581(30) 115.904755(3) 112.904061(4) 114.903878(5) 111.904821(5) 113.902782(3) 114.903346(3) 115.901744(3) 116.902954(3) 117.901606(3) 118.903309(3) 119.9021966(27) 121.9034401(29) 123.9052746(15) 120.9038180(24) 122.9042157(22) 119.904020(11) 121.9030471(20) 122.9042730(19) 123.9028195(16) 124.9044247(20) 125.9033055(20) 127.9044614(19) 129.9062228(21) 126.904468(4) 123.9058958(21) 125.904269(7) 127.9035304(15) 128.9047795(9) 129.9035079(10) 130.9050819(10) 131.9041545(12) 133.9053945(9) 135.907220(8) 132.905447(3) 129.906310(7) 131.905056(3) 133.904503(3) 134.905683(3) 135.904570(3) 136.905821(3) 137.905241(3) 137.907107(4) 138.906348(3) 135.907140(50) 137.905986(11) 139.905434(3)
Abundance in % 27.33(3) 26.46(9) 11.72(9) 51.839(8) 48.161(8) 1.25(6) 0.89(3) 12.49(18) 12.80(12) 24.13(21) 12.22(12) 28.73(42) 7.49(18) 4.29(5) 95.71(5) 0.97(1) 0.66(1) 0.34(1) 14.54(9) 7.68(7) 24.22(9) 8.59(4) 32.58(9) 4.63(3) 5.79(5) 57.21(5) 42.79(5) 0.09(1) 2.55(12) 0.89(3) 4.74(14) 7.07(15) 18.84(25) 31.74(8) 34.08(62) 100 0.09(1) 0.09(1) 1.92(3) 26.44(24) 4.08(2) 21.18(3) 26.89(6) 10.44(10) 8.87(16) 100 0.106(1) 0.101(1) 2.417(18) 6.592(12) 7.854(24) 11.232(24) 71.698(42) 0.090(1) 99.910(1) 0.185(2) 0.251(2) 88.450(51)
ATOMIC MASSES AND ABUNDANCES (continued) Z
Isotope 142Ce
59 60
141Pr 142Nd 143Nd 144Nd 145Nd 146Nd 148Nd 150Nd
61
145Pm 147Pm
62
144Sm 147Sm 148Sm 149Sm 150Sm 152Sm 154Sm
63
151Eu 153Eu
64
152Gd 154Gd 155Gd 156Gd 157Gd 158Gd 160Gd
65 66
159Tb 156Dy 158Dy 160Dy 161Dy 162Dy 163Dy 164Dy
67 68
165Ho 162Er 164Er 166Er 167Er 168Er 170Er
69 70
169Tm 168Yb 170Yb 171Yb 172Yb 173Yb 174Yb 176Yb
71
175Lu 176Lu
72
174Hf 176Hf 177Hf 178Hf 179Hf 180Hf
Mass in u 141.909240(4) 140.907648(3) 141.907719(3) 142.909810(3) 143.910083(3) 144.912569(3) 145.913112(3) 147.916889(3) 149.920887(4) 144.912744(4) 146.915134(3) 143.911995(4) 146.914893(3) 147.914818(3) 148.917180(3) 149.917271(3) 151.919728(3) 153.922205(3) 150.919846(3) 152.921226(3) 151.919788(3) 153.920862(3) 154.922619(3) 155.922120(3) 156.923957(3) 157.924101(3) 159.927051(3) 158.925343(3) 155.924278(7) 157.924405(4) 159.925194(3) 160.926930(3) 161.926795(3) 162.928728(3) 163.929171(3) 164.930319(3) 161.928775(4) 163.929197(4) 165.930290(3) 166.932045(3) 167.932368(3) 169.935460(3) 168.934211(3) 167.933894(5) 169.934759(3) 170.936322(3) 171.9363777(30) 172.9382068(30) 173.9388581(30) 175.942568(3) 174.9407679(28) 175.9426824(28) 173.940040(3) 175.9414018(29) 176.9432200(27) 177.9436977(27) 178.9458151(27) 179.9465488(27)
Abundance in %
Z
11.114(51) 100 27.2(5) 12.2(2) 23.8(3) 8.3(1) 17.2(3) 5.7(1) 5.6(2)
73
Isotope 180Ta 181Ta
74
180W 182W 183W 184W 186W
75
185Re 187Re
76
184Os 186Os 187Os
3.07(7) 14.99(18) 11.24(10) 13.82(7) 7.38(1) 26.75(16) 22.75(29) 47.81(3) 52.19(3) 0.20(1) 2.18(3) 14.80(12) 20.47(9) 15.65(2) 24.84(7) 21.86(19) 100 0.06(1) 0.10(1) 2.34(8) 18.91(24) 25.51(26) 24.90(16) 28.18(37) 100 0.14(1) 1.61(3) 33.61(35) 22.93(17) 26.78(26) 14.93(27) 100 0.13(1) 3.04(15) 14.28(57) 21.83(67) 16.13(27) 31.83(92) 12.76(41) 97.41(2) 2.59(2) 0.16(1) 5.26(7) 18.60(9) 27.28(7) 13.62(2) 35.08(16)
188Os 189Os 190Os 192Os
77
191Ir 193Ir
78
190Pt 192Pt 194Pt 195Pt 196Pt 198Pt
79 80
197Au 196Hg 198Hg 199Hg 200Hg 201Hg 202Hg 204Hg
81
203Tl 205Tl
82
204Pb 206Pb 207Pb 208Pb
83 84
209Bi 209Po 210Po
85
210At 211At
86
211Rn 220Rn 222Rn
87 88
223Fr 223Ra 224Ra 226Ra 228Ra
89 90
227Ac 230Th 232Th
91 92
231Pa 233U 234U 235U
1-17
Mass in u 179.947466(3) 180.947996(3) 179.946706(5) 181.948206(3) 182.9502245(29) 183.9509326(29) 185.954362(3) 184.9529557(30) 186.9557508(30) 183.952491(3) 185.953838(3) 186.9557479(30) 187.9558360(30) 188.9581449(30) 189.958445(3) 191.961479(4) 190.960591(3) 192.962924(3) 189.959930(7) 191.961035(4) 193.962664(3) 194.964774(3) 195.964935(3) 197.967876(4) 196.966552(3) 195.965815(4) 197.966752(3) 198.968262(3) 199.968309(3) 200.970285(3) 201.970626(3) 203.973476(3) 202.972329(3) 204.974412(3) 203.973029(3) 205.974449(3) 206.975881(3) 207.976636(3) 208.980383(3) 208.982416(3) 209.982857(3) 209.987131(9) 210.987481(4) 210.990585(8) 220.0113841(29) 222.0175705(27) 223.0197307(29) 223.018497(3) 224.0202020(29) 226.0254026(27) 228.0310641(27) 227.0277470(29) 230.0331266(22) 232.0380504(22) 231.0358789(28) 233.039628(3) 234.0409456(21) 235.0439231(21)
Abundance in % 0.012(2) 99.988(2) 0.12(1) 26.50(16) 14.31(4) 30.64(2) 28.43(19) 37.40(2) 62.60(2) 0.02(1) 1.59(3) 1.96(2) 13.24(8) 16.15(5) 26.26(2) 40.78(19) 37.3(2) 62.7(2) 0.014(1) 0.782(7) 32.967(99) 33.832(10) 25.242(41) 7.163(55) 100 0.15(1) 9.97(20) 16.87(22) 23.10(19) 13.18(9) 29.86(26) 6.87(15) 29.524(14) 70.476(14) 1.4(1) 24.1(1) 22.1(1) 52.4(1) 100
100 100 0.0055(2) 0.7200(51)
ATOMIC MASSES AND ABUNDANCES (continued) Z
Isotope
236U 238U
93
237Np 239Np
94
238Pu 239Pu 240Pu 241Pu 242Pu 244Pu
95
241Am 243Am
96
243Cm 244Cm 245Cm 246Cm 247Cm 248Cm
97
247Bk
Mass in u
236.0455619(21) 238.0507826(21) 237.0481673(21) 239.0529314(23) 238.0495534(21) 239.0521565(21) 240.0538075(21) 241.0568453(21) 242.0587368(21) 244.064198(5) 241.0568229(21) 243.0613727(23) 243.0613822(24) 244.0627463(21) 245.0654856(29) 246.0672176(24) 247.070347(5) 248.072342(5) 247.070299(6)
Abundance in %
Z
Isotope
249Bk
99.2745(106)
98
249Cf 250Cf 251Cf 252Cf
99 100 101
252Es 257Fm 256Md 258Md
102 103 104 105 106 107 108 109 110 111
259No 262Lr 261Rf 262Db 263Sg 264Bh 265Hs 268Mt 269Uun 272Uuu
*Mass values derived not purely from experimental data, but at least partly from systematic trends.
1-18
Mass in u
249.074980(3) 249.074847(3) 250.0764000(24) 251.079580(5) 252.081620(5) 252.082970(50) 257.095099(7) 256.094050(60) 258.098425(5) 259.101020(110)* 262.109690(320)* 261.108750(110)* 262.114150(200)* 263.118310(130)* 264.124730(300)* 265.130000(320)* 268.138820(340)* 269.145140(310)* 272.153480(360)*
Abundance in %
ELECTRON CONFIGURATION OF NEUTRAL ATOMS IN THE GROUND STATE Atomic no.
n= Element
K 1 s
L 2 s
p
1 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20 21 22 23 24 25 26 27 28 29 30 31 32 33 34 35 36 37 38 39 40 41 42 43 44 45 46 47 48 49 50 51 52 53 54 55 56
H He Li Be B C N O F Ne Na Mg Al Si P S Cl Ar K Ca Sc Ti V Cr Mn Fe Co Ni Cu Zn Ga Ge As Se Br Kr Rb Sr Y Zr Nb Mo Tc Ru Rh Pd Ag Cd In Sn Sb Te I Xe Cs Ba
1 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2
1 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2
1 2 3 4 5 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6
s
M 3 p d
s
N 4 p d
1 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2
1 2 3 4 5 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6
1 2 2 2 2 1 2 2 2 2 1 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2
1 2 3 4 5 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6
1 2 3 5* 5 6 7 8 10* 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10
1-13
1 2 4* 5 5 7 8 10* 10 10 10 10 10 10 10 10 10 10
O 5 f
s
p
d
f
s
1 2 2 2 1 1 2 1 1 1 2 2 2 2 2 2 2 2 2
1 2 3 4 5 6 6 6
1 2
P 6 p d
Q 7 s
ELECTRON CONFIGURATION OF NEUTRAL ATOMS IN THE GROUND STATE (continued) Atomic no. 57 58 59 60 61 62 63 64 65 66 67 68 69 70 71 72 73 74 75 76 77 78 79 80 81 82 83 84 85 86 87 88 89 90 91 92 93 94 95 96 97 98 99 100 101 102 103 104 *
n= Element
K 1 s
L 2 s
p
La Ce Pr Nd Pm Sm Eu Gd Tb Dy Ho Er Tm Yb Lu Hf Ta W Re Os Ir Pt Au Hg Tl Pb Bi Po At Rn Fr Ra Ac Th Pa U Np Pu Am Cm Bk Cf Es Fm Md No Lr Rf
2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2
2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2
6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6
s
M 3 p d
s
N 4 p d
2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2
6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6
2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2
6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6
10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10
10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10
O 5 f
s
1* 3 4 5 6 7 7 9* 10 11 12 13 14 14 14 14 14 14 14 14 14 14 14 14 14 14 14 14 14 14 14 14 14 14 14 14 14 14 14 14 14 14 14 14 14 14 14
2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2
p 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6
d
f
s
2* 3 4 6* 7 7* 9 10 11 12 13 14 14 14
2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 1 1 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2
1 1
1
1 2 3 4 5 6 7 9 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10 10
P 6 p d
1 2 3 4 5 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6 6
Note irregularity.
REFERENCE W. L. Wiese and G. A. Martin, in A Physicist’s Desk Reference, American Institute of Physics, New York, 1989, 94.
1-14
1 2 1 1 1
1
1 2
Q 7 s
1 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2 2
INTERNATIONAL TEMPERATURE SCALE OF 1990 (ITS-90) B. W. Mangum A new temperature scale, the International Temperature Scale of 1990 (ITS-90), was officially adopted by the Comité International des Poids et Mesures (CIPM), meeting 26—28 September 1989 at the Bureau International des Poids et Mesures (BIPM). The ITS-90 was recommended to the CIPM for its adoption following the completion of the final details of the new scale by the Comité Consultatif de Thermométrie (CCT), meeting 12—14 September 1989 at the BIPM in its 17th Session. The ITS-90 became the official international temperature scale on 1 January 1990. The ITS90 supersedes the present scales, the International Practical Temperature Scale of 1968 (IPTS-68) and the 1976 Provisional 0.5 to 30 K Temperature Scale (EPT-76). The ITS-90 extends upward from 0.65 K, and temperatures on this scale are in much better agreement with thermodynamic values that are those on the IPTS-68 and the EPT-76. The new scale has subranges and alternative definitions in certain ranges that greatly facilitate its use. Furthermore, its continuity, precision, and reproducibility throughout its ranges are much improved over that of the present scales. The replacement of the thermocouple with the platinum resistance thermometer at temperatures below 961.78°C resulted in the biggest improvement in reproducibility. The ITS-90 is divided into four primary ranges: 1. Between 0.65 and 3.2 K, the ITS-90 is defined by the vapor pressure-temperature relation of 3He, and between 1.25 and 2.1768 K (the λ point) and between 2.1768 and 5.0 K by the vapor pressure-temperature relations of 4He. T90 is defined by the vapor pressure equations of the form: 9
[(
)
T90 / K = A0 + ∑ Ai ln( p/ Pa ) – B / C i =1
]
i
The values of the coefficients Ai, and of the constants Ao, B, and C of the equations are given below. 2. Between 3.0 and 24.5561 K, the ITS-90 is defined in terms of a 3He or 4He constant volume gas thermometer (CVGT). The thermometer is calibrated at three temperatures — at the triple point of neon (24.5561 K), at the triple point of equilibrium hydrogen (13.8033 K), and at a temperature between 3.0 and 5.0 K, the value of which is determined by using either 3He or 4He vapor pressure thermometry. 3. Between 13.8033 K (–259.3467°C) and 1234.93 K (961.78°C), the ITS-90 is defined in terms of the specified fixed points given below, by resistance ratios of platinum resistance thermometers obtained by calibration at specified sets of the fixed points, and by reference functions and deviation functions of resistance ratios which relate to T90 between the fixed points. 4. Above 1234.93 K, the ITS-90 is defined in terms of Planck’s radiation law, using the freezing-point temperature of either silver, gold, or copper as the reference temperature. Full details of the calibration procedures and reference functions for various subranges are given in: The International Temperature Scale of 1990, Metrologia, 27, 3, 1990; errata in Metrologia, 27, 107, 1990.
Defining Fixed Points of the ITS-90 Materiala
Equilibrium stateb
Temperature T90 (K)
He e-H2 e-H2 (or He) e-H2 (or He) Nec O2 Ar Hgc H2O Gac Inc Sn Zn Alc Ag Au
VP TP VP (or CVGT) VP (or CVGT) TP TP TP TP TP MP FP FP FP FP FP FP
Cuc
FP
3 to 5 13.8033 ≈17 ≈20.3 24.5561 54.3584 83.8058 234.3156 273.16 302.9146 429.7485 505.078 692.677 933.473 1234.93 1337.33 1357.77
1-15
t90 (°C)
–270.15 to –268.15 –259.3467 ≈ –256.15 ≈ –252.85 –248.5939 –218.7916 –189.3442 –38.8344 0.01 29.7646 156.5985 231.928 419.527 660.323 961.78 1064.18 1084.62
INTERNATIONAL TEMPERATURE SCALE OF 1990 (ITS-90) (continued) Defining Fixed Points of the ITS-90 (continued) a
b
c
e-H2 indicates equilibrium hydrogen, that is, hydrogen with the equilibrium distribution of its ortho and para states. Normal hydrogen at room temperature contains 25% para hydrogen and 75% ortho hydrogen. VP indicates vapor pressure point; CVGT indicates constant volume gas thermometer point; TP indicates triple point (equilibrium temperature at which the solid, liquid, and vapor phases coexist); FP indicates freezing point, and MP indicates melting point (the equilibrium temperatures at which the solid and liquid phases coexist under a pressure of 101 325 Pa, one standard atmosphere). The isotopic composition is that naturally occurring. Previously, these were secondary fixed points.
Values of Coefficients in the Vapor Pressure Equations for Helium Coef.or constant A0 A1 A2 A3 A4 A5 A6 A7 A8 A9 B C
3He 0.65—3.2 K
4He 1.25—2.1768 K
1.053 447 0.980 106 0.676 380 0.372 692 0.151 656 –0.002 263 0.006 596 0.088 966 –0.004 770 –0.054 943 7.3 4.3
1.392 408 0.527 153 0.166 756 0.050 988 0.026 514 0.001 975 –0.017 976 0.005 409 0.013 259 0 5.6 2.9
1-16
4He 2.1768—5.0 K
3.146 631 1.357 655 0.413 923 0.091 159 0.016 349 0.001 826 –0.004 325 –0.004 973 0 0 10.3 1.9
CONVERSION OF TEMPERATURES FROM THE 1948 AND 1968 SCALES TO ITS-90 This table gives temperature corrections from older scales to the current International Temperature Scale of 1990 (see the preceding table for details on ITS-90). The first part of the table may be used for converting Celsius temperatures in the range -180 to 4000°C from IPTS-68 or IPTS-48 to ITS90. Within the accuracy of the corrections, the temperature in the first column may be identified with either t68, t48, or t90. The second part of the table is designed for use at lower temperatures to convert values expressed in kelvins from EPT-76 or IPTS-68 to ITS-90. The references give analytical equations for expressing these relations. Note that Reference 1 supersedes Reference 2 with respect to corrections in the 630 to 1064°C range. REFERENCES 1. Burns, G. W. et al., in Temperature: Its Measurement and Control in Science and Industry, Vol. 6, Schooley, J. F., Ed., American Institute of Physics, New York, 1993. 2. Goldberg, R. N. and Weir, R. D., Pure and Appl. Chem., 1545, 1992. t/°C
t90-t68
t90-t48
t/°C
t90-t68
t90-t48
t/°C
t90-t68
t90-t48
-180 -170 -160 -150 -140 -130 -120 -110 -100 -90 -80 -70 -60 -50 -40 -30 -20 -10 0 10 20 30 40 50 60 70 80 90 100 110 120 130 140 150 160 170 180 190 200 210 220 230 240 250 260
0.008 0.010 0.012 0.013 0.014 0.014 0.014 0.013 0.013 0.012 0.012 0.011 0.010 0.009 0.008 0.006 0.004 0.002 0.000 -0.002 -0.005 -0.007 -0.010 -0.013 -0.016 -0.018 -0.021 -0.024 -0.026 -0.028 -0.030 -0.032 -0.034 -0.036 -0.037 -0.038 -0.039 -0.039 -0.040 -0.040 -0.040 -0.040 -0.040 -0.040 -0.040
0.020 0.017 0.007 0.000 0.001 0.008 0.017 0.026 0.035 0.041 0.045 0.045 0.042 0.038 0.032 0.024 0.016 0.008 0.000 -0.006 -0.012 -0.016 -0.020 -0.023 -0.026 -0.026 -0.027 -0.027 -0.026 -0.024 -0.023 -0.020 -0.018 -0.016 -0.012 -0.009 -0.005 -0.001 0.003 0.007 0.011 0.014 0.018 0.021 0.024
270 280 290 300 310 320 330 340 350 360 370 380 390 400 410 420 430 440 450 460 470 480 490 500 510 520 530 540 550 560 570 580 590 600 610 620 630 640 650 660 670 680 690 700 710
-0.039 -0.039 -0.039 -0.039 -0.039 -0.039 -0.040 -0.040 -0.041 -0.042 -0.043 -0.045 -0.046 -0.048 -0.051 -0.053 -0.056 -0.059 -0.062 -0.065 -0.068 -0.072 -0.075 -0.079 -0.083 -0.087 -0.090 -0.094 -0.098 -0.101 -0.105 -0.108 -0.112 -0.115 -0.118 -0.122 -0.125 -0.11 -0.10 -0.09 -0.07 -0.05 -0.04 -0.02 -0.01
0.028 0.030 0.032 0.034 0.035 0.036 0.036 0.037 0.036 0.035 0.034 0.032 0.030 0.028 0.024 0.022 0.019 0.015 0.012 0.009 0.007 0.004 0.002 0.000 -0.001 -0.002 -0.001 0.000 0.002 0.007 0.011 0.018 0.025 0.035 0.047 0.060 0.075 0.12 0.15 0.19 0.24 0.29 0.32 0.37 0.41
720 730 740 750 760 770 780 790 800 810 820 830 840 850 860 870 880 890 900 910 920 930 940 950 960 970 980 990 1000 1010 1020 1030 1040 1050 1060 1070 1080 1090 1100 1200 1300 1400 1500 1600 1700
0.00 0.02 0.03 0.03 0.04 0.05 0.05 0.05 0.05 0.05 0.04 0.04 0.03 0.02 0.01 0.00 -0.02 -0.03 -0.05 -0.06 -0.08 -0.10 -0.11 -0.13 -0.15 -0.16 -0.18 -0.19 -0.20 -0.22 -0.23 -0.23 -0.24 -0.25 -0.25 -0.25 -0.26 -0.26 -0.26 -0.30 -0.35 -0.39 -0.44 -0.49 -0.54
0.45 0.49 0.53 0.56 0.60 0.63 0.66 0.69 0.72 0.75 0.76 0.79 0.81 0.83 0.85 0.87 0.87 0.89 0.90 0.92 0.93 0.94 0.96 0.97 0.97 0.99 1.00 1.02 1.04 1.05 1.07 1.10 1.12 1.14 1.17 1.19 1.20 1.20 1.2 1.4 1.5 1.6 1.8 1.9 2.1
1-17
CONVERSION OF TEMPERATURES FROM THE 1948 AND 1968 SCALES TO ITS-90 (continued) t/°C
t90-t68
t90-t48
T/K
1800 1900 2000 2100 2200 2300 2400 2500 2600 2700 2800 2900 3000 3100 3200 3300 3400 3500 3600 3700 3800 3900 4000
-0.60 -0.66 -0.72 -0.79 -0.85 -0.93 -1.00 -1.07 -1.15 -1.24 -1.32 -1.41 -1.50 -1.59 -1.69 -1.78 -1.89 -1.99 -2.10 -2.21 -2.32 -2.43 -2.55
2.2 2.3 2.5 2.7 2.9 3.1 3.2 3.4 3.7 3.8 4.0 4.2 4.4 4.6 4.8 5.1 5.3 5.5 5.8 6.0 6.3 6.6 6.8
T/K
T90-T76
T90-T68
-0.0001 -0.0002 -0.0003 -0.0004 -0.0005 -0.0006 -0.0007 -0.0008 -0.0010 -0.0011 -0.0013 -0.0014 -0.0016 -0.0018 -0.0020 -0.0022 -0.0025 -0.0027 -0.0030 -0.0032 -0.0035 -0.0038 -0.0041
-0.006 -0.003 -0.004 -0.006 -0.008 -0.009 -0.009 -0.008 -0.007 -0.007 -0.006 -0.005 -0.004 -0.004
28 29 30 31 32 33 34 35 36 37 38 39 40 41 42 43 44 45 46 47 48 49 50 51 52 53 54 55 56 57 58 59 60 61 62 63 64 65 66 67 68 69 70 71 72 73 74 75 76
5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20 21 22 23 24 25 26 27
T90-T76
1-18
T90-T68
T/K
-0.005 -0.006 -0.006 -0.007 -0.008 -0.008 -0.008 -0.007 -0.007 -0.007 -0.006 -0.006 -0.006 -0.006 -0.006 -0.006 -0.006 -0.007 -0.007 -0.007 -0.006 -0.006 -0.006 -0.005 -0.005 -0.004 -0.003 -0.002 -0.001 0.000 0.001 0.002 0.003 0.003 0.004 0.004 0.005 0.005 0.006 0.006 0.007 0.007 0.007 0.007 0.007 0.007 0.007 0.008 0.008
77 78 79 80 81 82 83 84 85 86 87 88 89 90 91 92 93 94 95 96 97 98 99 100 110 120 130 140 150 160 170 180 190 200 210 220 230 240 250 260 270 273.16 300 400 500 600 700 800 900
T90-T76
T90-T68 0.008 0.008 0.008 0.008 0.008 0.008 0.008 0.008 0.008 0.008 0.008 0.008 0.008 0.008 0.008 0.008 0.008 0.008 0.008 0.008 0.009 0.009 0.009 0.009 0.011 0.013 0.014 0.014 0.014 0.014 0.013 0.012 0.012 0.011 0.010 0.009 0.008 0.007 0.005 0.003 0.001 0.000 -0.006 -0.031 -0.040 -0.040 -0.055 -0.089 -0.124
INTERNATIONAL SYSTEM OF UNITS (SI) 1 SI base units Table 1 gives the seven base quantities, assumed to be mutually independent, on which the SI is founded; and the names and symbols of their respective units, called ``SI base units.' ' Definitions of the SI base units are given in Appendix A. The kelvin and its symbol K are also used to express the value of a temperature interval or a temperature difference.
Table 1. SI base units SI base unit Base quantity length mass time electric current thermodynamic temperature amount of substance luminous intensity
Name
Symbol
meter kilogram second ampere kelvin mole candela
m kg s A K mol cd
2 SI deriived units Derived units are expressed algebraically in terms of base units or other derived units (including the radian and steradian which are the two supplementary units – see Sec. 3). The symbols for derived units are obtained by means of the mathematical operations of multiplication and division. For example, the derived unit for the derived quantity molar mass (mass divided by amount of substance) is the kilogram per mole, symbol kg/mol. Additional examples of derived units expressed in terms of SI base units are given in Table 2.
Table 2. Examples of SI derived units expressed in terms of SI base units SI derived unit Derived quantity area volume speed, velocity acceleration wave number mass density (density) specific volume current density magnetic field strength amount-of-substance concentration (concentration) luminance
2.1
Name
Symbol
square meter cubic meter meter per second meter per second squared reciprocal meter kilogram per cubic meter cubic meter per kilogram ampere per square meter ampere per meter
m2 m3 m/s m/s 2 m21 kg/m 3 m 3 /kg A/m 2 A/m
mole per cubic meter candela per square meter
mol/m 3 cd/m 2
SI derived units with special names and symbols
Certain SI derived units have special names and symbols; these are given in Tables 3a and 3b. As discussed in Sec. 3, the radian and steradian, which are the two supplementary units, are included in Table 3a.
INTERNATIONAL SYSTEM OF UNITS (SI) (continued) Table 3a. SI derived units with special names and symbols, including the radian and steradian SI derived unit Derived quantity
Special name
plane angle solid angle frequency force pressure, stress energy, work, quantity of heat power, radiant flux electric charge, quantity of electricity electric potential, potential difference, electromotive force capacitance electric resistance electric conductance magnetic flux magnetic flux density inductance Celsius temperature(a) luminous flux illuminance (a) (b)
Special symbol
Expression in terms of other SI units
Expression in terms of SI base units
radian steradian hertz newton pascal
rad sr Hz N Pa
N/m2
m ? m21 = 1 m 2 ? m22 = 1 s21 m ? kg ? s22 m21 ? kg ? s22
joule watt
J W
N?m J/s
m2 ? kg ? s22 m2 ? kg ? s23
coulomb
C
volt farad ohm siemens weber tesla henry degree Celsius lumen lux
V F V S Wb T H 8C lm lx
s?A W/A C/V V/A A/V V?s Wb/m2 Wb/A cd ? sr lm/m2
m2 ? kg ? s23 ? A21 m22 ? kg21 ? s4 ? A2 m2 ? kg ? s23 ? A22 m22 ? kg21 ? s3 ? A2 m2 ? kg ? s22 ? A21 kg ? s22 ? A21 m2 ? kg ? s22 ? A22 K cd ? sr (b) m22 ? cd ? sr (b)
See Sec. 2.1.1. The steradian (sr) is not an SI base unit. However, in photometry the steradian (sr) is maintained in expressions for units (see Sec. 3).
Table 3b. SI derived units with special names and symbols admitted for reasons of safeguarding human health (a) SI derived unit Derived quantity
Special name
Special symbol
Expression in terms of other SI units
Expression in terms of SI base units
activity (of a radionuclide)
becquerel
Bq
absorbed dose, specific energy (imparted), kerma
gray
Gy
J/kg
m2 ? s22
dose equivalent, ambient dose equivalent, directional dose equivalent, personal dose equivalent, equivalent dose
sievert
Sv
J/kg
m2 ? s22
(a)
s21
The derived quantities to be expressed in the gray and the sievert have been revised in accordance with the recommendations of the International Commission on Radiation Units and Measurements (ICRU).
2.1.1 Degree Celsius In addition to the quantity thermodynamic temperature (symbol T ), expressed in the unit kelvin, use is also made of the quantity Celsius temperature (symbol t ) defined by the equation t = T2T 0 , where T 0 = 273.15 K by definition. To express Celsius temperature, the unit degree Celsius, symbol 8C, which is equal in magnitude to the unit kelvin, is used; in this case, ``degree Celsius' ' is a special name used in place of ``kelvin.' ' An interval or difference of Celsius temperature can, however, be expressed in the unit kelvin as well as in the unit degree Celsius. (Note that the thermodynamic temperature T0 is exactly 0.01 K below the thermodynamic temperature of the triple point of water.)
INTERNATIONAL SYSTEM OF UNITS (SI) (continued) 2.2
Use of SI derived units with special names and symbols
Examples of SI derived units that can be expressed with the aid of SI derived units having special names and symbols (including the radian and steradian) are given in Table 4. Table 4. Examples of SI derived units expressed with the aid of SI derived units having special names and symbols SI derived unit Derived quantity angular velocity angular acceleration dynamic viscosity moment of force surface tension heat flux density, irradiance radiant intensity radiance heat capacity, entropy specific heat capacity, specific entropy specific energy thermal conductivity energy density electric field strength electric charge density electric flux density permittivity permeability molar energy molar entropy, molar heat capacity exposure (x and g rays) absorbed dose rate (a)
Name
Symbol
Expression in terms of SI base units
radian per second radian per second squared pascal second newton meter newton per meter
rad/s rad/s 2 Pa ? s N?m N/m
m ? m 21 ? s 21 = s 21 m ? m 21 ? s 22 = s 22 m21 ? kg ? s21 m 2 ? kg ? s22 kg ? s22
watt per square meter watt per steradian watt per square meter steradian joule per kelvin joule per kilogram kelvin joule per kilogram watt per meter kelvin joule per cubic meter volt per meter coulomb per cubic meter coulomb per square meter farad per meter henry per meter joule per mole
W/m 2 W/sr
kg ? s23 m 2 ? kg ? s 23 ? sr 21 (a)
W/(m 2 ? sr) J/K
kg ? s 23 ? sr 21 (a) m 2 ? kg ? s22 ? K21
J/(kg ? K) J/kg W/(m ? K) J/m 3 V/m C/m 3 C/m 2 F/m H/m J/mol
m 2 ? s22 ? K21 m 2 ? s22 m ? kg ? s23 ? K21 m21 ? kg ? s22 m ? kg ? s23 ? A21 m23 ? s ? A m22 ? s ? A m23 ? kg21 ? s4 ? A2 m ? kg ? s22 ? A22 m 2 ? kg ? s22 ? mol21
joule per mole kelvin coulomb per kilogram gray per second
J/(mol ? K) C/kg Gy/s
m 2 ? kg ? s22 ? K21 ? mol21 kg21 ? s ? A m 2 ? s23
The steradian (sr) is not an SI base unit. However, in radiometry the steradian (sr) is maintained in expressions for units (see Sec. 3).
The advantages of using the special names and symbols of SI derived units are apparent in Table 4. Consider, for example, the quantity molar entropy: the unit J/(mol ? K) is obviously more easily understood than its SI base-unit equivalent, m 2 ? kg ? s 22 ? K 21 ? mol 21. Nevertheless, it should always be recognized that the special names and symbols exist for convenience; either the form in which special names or symbols are used for certain combinations of units or the form in which they are not used is correct. For example, because of the descriptive value implicit in the compound-unit form, communication is sometimes facilitated if magnetic flux (see Table 3a) is expressed in terms of the volt second (V ? s) instead of the weber (Wb). Tables 3a, 3b, and 4 also show that the values of several different quantities are expressed in the same SI unit. For example, the joule per kelvin (J/K) is the SI unit for heat capacity as well as for entropy. Thus the name of the unit is not sufficient to define the quantity measured. A derived unit can often be expressed in several different ways through the use of base units and derived units with special names. In practice, with certain quantities, preference is given to using certain units with special names, or combinations of units, to facilitate the distinction between quantities whose values have identical expressions in terms of SI base units. For example, the SI unit of frequency is specified as the hertz (Hz) rather than the reciprocal second (s 21 ), and the SI unit of moment of force is specified as the newton meter (N ? m) rather than the joule (J).
INTERNATIONAL SYSTEM OF UNITS (SI) (continued) Similarly, in the field of ionizing radiation, the SI unit of activity is designated as the becquerel (Bq) rather than the reciprocal second (s 21 ), and the SI units of absorbed dose and dose equivalent are designated as the gray (Gy) and the sievert (Sv), respectively, rather than the joule per kilogram (J/kg). 3 SI supplementary units As previously stated, there are two units in this class: the radian, symbol rad, the SI unit of the quantity plane angle; and the steradian, symbol sr, the SI unit of the quantity solid angle. Definitions of these units are given in Appendix A. The SI supplementary units are now interpreted as so-called dimensionless derived units for which the CGPM allows the freedom of using or not using them in expressions for SI derived units.3 Thus the radian and steradian are not given in a separate table but have been included in Table 3a together with other derived units with special names and symbols (seeSec.2.1). This interpretation of the supplementary units implies that plane angle and solid angle are considered derived quantities of dimension one (so-called dimensionless quantities), each of which has the which has the unit one, symbol 1, as its coherent SI unit. However, in practice, when one expresses the values of derived quantities involving plane angle or solid angle, it often aids understanding if the special names (or symbols) ``radian' ' (rad) or ``steradian' ' (sr) are used in place of the number 1. For example, although values of the derived quantity angular velocity (plane angle divided by time) may be expressed in the unit s21, such values are usually expressed in the unit rad/s. Because the radian and steradian are now viewed as so-called dimensionless derived units, the Consultative Committee for Units (CCU, Comité Consultatif des Unités) of the CIPM as result of a 1993 request it received from ISO/TC12, recommended to the CIPM that it request the CGPM to abolish the class of supplementary units as a separate class in the SI. The CIPM accepted the CCU recommendation, and if the abolishment is approved by the CGPM as is likely (the question will be on the agenda of the 20th CGPM, October 1995), the SI will consist of only two classes of units: base units and derived units, with the radian and steradian subsumed into the class of derived units of the SI. (The option of using or not using them in expressions for SI derived units, as is convenient, would remain unchanged.) 4 Decimal multiples and submultiples of SI units: SI prefixes Table 5 gives the SI prefixes that are used to form decimal multiples and submultiples of SI units. They allow very large or very small numerical values to be avoided. A prefix attaches directly to the name of a unit, and a prefix symbol attaches directly to the symbol for a unit. For example, one kilometer, symbol 1 km, is equal to one thousand meters, symbol 1000 m or 103 m. When prefixes are attached to SI units, the units so formed are called ``multiples and submultiples of SI units' ' in order to distinguish them from the coherent system of SI units.
Note:
3
Alternative definitions of the SI prefixes and their symbols are not permitted. For example, it is unacceptable to use kilo (k) to represent 2 10 = 1024, mega (M) to represent 2 20 = 1 048 576, or giga (G) to represent 2 30 = 1 073 741 824.
This interpretation was given in 1980 by the CIPM . It was deemed necessary because Resolution 12 of the 11th CGPM, which established the SI in 1960 , did not specify the nature of the supplementary units. The interpretation is based on two principal considerations: that plane angle is generally expressed as the ratio of two lengths and solid angle as the ratio of an area and the square of a length, and are thus quantities of dimension one (so-called dimensionless quantities); and that treating the radian and steradian as SI base units – a possibility not disallowed by Resolution 12 – could compromise the internal coherence of the SI based on only seven base units. (See ISO 31-0 for a discussion of the concept of dimension.)
INTERNATIONAL SYSTEM OF UNITS (SI) (continued) Table 5. SI prefixes Factor
Prefix
10 24 10 21 10 18 10 15 10 12 10 9 10 6 10 3 10 2 10 1
= = = = = = = =
(10 3 ) 8 (10 3 ) 7 (10 3 ) 6 (10 3 ) 5 (10 3 ) 4 (10 3 ) 3 (10 3 ) 2 (10 3 ) 1
5
Units Outside the SI
Symbol
yotta zetta exa peta tera giga mega kilo hecto deka
Y Z E P T G M k h da
Factor 1021 1022 1023 1026 1029 10212 10215 10218 10221 10224
= = = = = = = =
Prefix
Symbol
deci centi milli micro nano pico femto atto zepto yocto
(10 3 ) 21 (10 3 ) 22 (10 3 ) 23 (10 3 ) 24 (10 3 ) 25 (10 3 ) 26 (10 3 ) 27 (10 3 ) 28
d c m m n p f a z y
Units that are outside the SI may be divided into three categories: –
those units that are accepted for use with the SI;
– those units that are temporarily accepted for use with the SI; and – those units that are not accepted for use with the SI and thus must strictly be avoided. 5.1
Units accepted for use with the SI The following sections discuss in detail the units that are acceptable for use with the SI.
5.1.1
Hour, degree, liter, and the like
Certain units that are not part of the SI are essential and used so widely that they are accepted by the CIPM for use with the SI. These units are given in Table 6. The combination of units of this table with SI units to form derived units should be restricted to special cases in order not to lose the advantages of the coherence of SI units. Additionally, it is recognized that it may be necessary on occasion to use time-related units other than those given in Table 6; in particular, circumstances may require that intervals of time be expressed in weeks, months, or years. In such cases, if a standardized symbol for the unit is not available, the name of the unit should be written out in full.
Table 6. Units accepted for use with the SI Name
Symbol
6 6
minute hour time day degree minute plane angle second liter metric ton (c)
min h d 8 ' " l, L (b) t
Value in SI units 1 min 1h 1d 18 1' 1" 1L 1t
= = = = = = = =
60 s 60 min = 3600 s 24 h = 86 400 s (p/180) rad (1/60)8=(p/10 800) rad (1/60)' =(p/648 000) rad 1 dm3 = 1023 m3 10 3 kg
(b)
The alternative symbol for the liter, L, was adopted by the CGPM in order to avoid the risk of confusion between the letter l and the number 1 . Thus, although both l and L are internationally accepted symbols for the liter, to avoid this risk the symbol to be used in the United States is L . The script letter , is not an approved symbol for the liter.
(c)
This is the name to be used for this unit in the United States; it is also used in some other English-speaking countries. However, ``tonne' ' is used in many countries.
INTERNATIONAL SYSTEM OF UNITS (SI) (continued) 5.1.2
Neper, bel, shannon, and the like
There are a few highly specialized units not listed in Table 6 that are given by the International Organization for Standardization (ISO) or the International Electrotechnical Commission (IEC) and which are also acceptable for use with the SI. They include the neper (Np), bel (B), octave, phon, and sone, and units used in information technology, including the baud (Bd), bit (bit), erlang (E), hartley (Hart), and shannon (Sh).4 It is the position of NIST that the only such additional units that may be used with the SI are those given in either the International Standards on quantities and units of ISO or of IEC . 5.1.3
Electronvolt and unified atomic mass unit
The CIPM also finds it necessary to accept for use with the SI the two units given in Table 7. These units are used in specialized fields; their values in SI units must be obtained from experiment and, therefore, are not known exactly.
Note :
In some fields the unified atomic mass unit is called the dalton, symbol Da; however, this name and symbol are not accepted by the CGPM, CIPM, ISO, or IEC for use with the SI. Similarly, AMU is not an acceptable unit symbol for the unified atomic mass unit. The only allowed name is ``unified atomic mass unit' ' and the only allowed symbol is u.
Table 7. Units accepted for use with the SI whose values in SI units are obtained experimentally Name electronvolt unified atomic mass unit (a)
Symbol eV u
Definition (a) (b)
The electronvolt is the kinetic energy acquired by an electron in passing through a potential difference of 1 V in vacuum; 1 eV = 1.602 177 33310219 J with a combined standard uncertainty of 0.000 000 49310219 J . The unified atomic mass unit is equal to 1/12 of the mass of an atom of the nuclide 12 C; 1 u = 1.660 540 23 10227 kg with a combined standard uncertainty of 0.000 001 0310227 kg .
(b)
5.1.4
Natural and atomic units
In some cases, particularly in basic science, the values of quantities are expressed in terms of fundamental constants of nature or so-called natural units.The use of these units with the SI is permissible when it is necessary for the most effective communication of information. In such cases, the specific natural units that are used must be identified. This requirement applies even to the system of units customarily called ``atomicunits' ' used in theoretical atomic physics and chemistry, inasmuch as there are several different systems that have the appellation ``atomic units.'' Examples of physical quantities used as natural units are given in Table 8. NIST also takes the position that while theoretical results intended primarily for other theorists may be left in natural units, if they are also intended for experimentalists, they must also be given in acceptable units.
4
The symbol in parentheses following the name of the unit is its internationally accepted unit symbol, but the octave, phon, and sone have no such unit symbols. For additional information on the neper and bel, see Sec. 0.5 of ISO 31-2. The question of the byte (B) is under international consideration.
INTERNATIONAL SYSTEM OF UNITS (SI) (continued) Table 8. Examples of physical quantities sometimes used as natural units Kind of quantity
Physical quantity used as a unit
action electric charge energy length length magnetic flux magnetic moment magnetic moment mass mass speed
Planck constant divided by 2p elementary charge Hartree energy Bohr radius Compton wavelength (electron) magnetic flux quantum Bohr magneton nuclear magneton electron rest mass proton rest mass speed of electromagnetic waves in vacuum
5.2
Symbol
h e Eh a0 lC F0 mB mN me mp c
Units temporarily accepted for use with the SI
Because of existing practice in certain fields or countries, in 1978 the CIPM considered that it was permissible for the units given in Table 9 to continue to be used with the SI until the CIPM considers that their use is no longer necessary. However, these units must not be introduced where they are not presently used. Further, NIST strongly discourages the continued use of these units except for the nautical mile, knot, are, and hectare; and except for the curie, roentgen, rad, and rem until the year 2000 (the cessation date suggested by the Committee for Ineragency Radiation Research and Policy Coordination or CIRRPC, a United States Government interagency group). 5 Table 9. Units temporarily accepted for use with the SI (a) Name nautical mile knot ångström are(b) hectare(b) barn bar gal curie roentgen rad rem (a) (b) (c)
Symbol
Å a ha b bar Gal Ci R rad (c) rem
Value in SI units 1 nautical mile = 1852 m 1 nautical mile per hour = (1852/3600) m/s 1 Å = 0.1 nm = 10210 m 1 a = 1 dam2 = 10 2 m2 1 ha = 1 hm2 = 10 4 m2 1 b = 100 fm2 = 10228 m2 1 bar=0.1 MPa=100 kPa=1000 hPa=10 5 Pa 1 Gal = 1 cm/s 2 = 1022 m/s 2 1 Ci = 3.731010 Bq 1 R = 2.5831024 C/kg 1 rad = 1 cGy = 1022 Gy 1 rem = 1 cSv = 1022 Sv
See Sec. 5.2 regarding the continued use of these units. This unit and its symbol are used to express agrarian areas. When there is risk of confusion with the symbol for the radian, rd may be used as the symbol for rad.
5 In 1993 the CCU (see Sec. 3) was requested by ISO/TC 12 to consider asking the CIPM to deprecate the use of the units of Table 9 except for the nautical mile and knot, and possibly the are and hectare. The CCU discussed this request at its February 1995 meeting.
INTERNATIONAL SYSTEM OF UNITS (SI) (continued)
Appendix A. A.1
Definitions of the SI Base Units and the Radian and Steradian
Introduction
The following definitions of the SI base units are taken from NIST SP 330; the definitions of the SI supplementary units, the radian and steradian, which are now interpreted as SI derived units (see Sec. 3), are those generally accepted and are the same as those given in ANSI/IEEE Std 268-1992. SI derived units are uniquely defined only in terms of SI base units; for example, 1 V = 1 m 2 ? kg ? s 23 ? A 21. A.2
Meter (17th CGPM, 1983)
The meter is the length of the path travelled by light in vacuum during a time interval of 1/299 792 458 of a second. A.3
Kilogram (3d CGPM, 1901)
The kilogram is the unit of mass; it is equal to the mass of the international prototype of the kilogram. A.4
Second (13th CGPM, 1967)
The second is the duration of 9 192 631 770 periods of the radiation corresponding to the transition between the two hyperfine levels of the ground state of the cesium- 133 atom. A.5
Ampere (9th CGPM, 1948)
The ampere is that constant current which, if maintained in two straight parallel conductors of infinite length, of negligible circular cross section, and placed 1 meter apart in vacuum, would produce between these conductors a force equal to 2 3 10 27 newton per meter of length. A.6
Kelvin (13th CGPM, 1967)
The kelvin, unit of thermodynamic temperature, is the fraction 1/273.16 of the thermodynamic temperature of the triple point of water. A.7
Mole (14th CGPM, 1971)
1. The mole is the amount of substance of a system which contains as many elementary entities as there are atoms in 0.012 kilogram of carbon 12. 2. When the mole is used, the elementary entities must be specified and may be atoms, molecules, ions, electrons, other particles, or specified groups of such particles. In the definition of the mole, it is understood that unbound atoms of carbon 12, at rest and in their ground state, are referred to. Note that this definition specifies at the same time the nature of the quantity whose unit is the mole. A.8
Candela (16th CGPM, 1979)
The candela is the luminous intensity, in a given direction, of a source that emits monochromatic radiation of frequency 540 3 10 12 hertz and that has a radiant intensity in that direction of ( 1/ 683) watt per steradian. A.9
Radian
The radian is the plane angle between two radii of a circle that cut off on the circumference an arc equal in length to the radius. A.10
Steradian
The steradian is the solid angle that, having its vertex in the center of a sphere, cuts off an area of the surface of the sphere equal to that of a square with sides of length equal to the radius of the sphere.
CONVERSION FACTORS The following table gives conversion factors from various units of measure to SI units. It is reproduced from NIST Special Publication 811, Guide for the Use of the International System of Units (SI). The table gives the factor by which a quantity expressed in a non-SI unit should be multiplied in order to calculate its value in the SI. The SI values are expressed in terms of the base, supplementary, and derived units of SI in order to provide a coherent presentation of the conversion factors and facilitate computations (see the table “International System of Units” in this Section). If desired, powers of ten can be avoided by using SI Prefixes and shifting the decimal point if necessary. Conversion from a non-SI unit to a different non-SI unit may be carried out by using this table in two stages, e.g., 1 calth = 4.184 J 1 BtuIT = 1.055056 E+03 J Thus, 1 BtuIT = (1.055056 E+03 ÷ 4.184) calth = 252.164 calth Conversion factors are presented for ready adaptation to computer readout and electronic data transmission. The factors are written as a number equal to or greater than one and less than ten with six or fewer decimal places. This number is followed by the letter E (for exponent), a plus or a minus sign, and two digits which indicate the power of 10 by which the number must be multiplied to obtain the correct value. For example: 3.523 907 E-02 is 3.523 907 × 10-2 or 0.035 239 07 Similarly: 3.386 389 E+03 is 3.386 389 × 103 or 3 386.389 A factor in boldface is exact; i.e., all subsequent digits are zero. All other conversion factors have been rounded to the figures given in accordance with accepted practice. Where less than six digits after the decimal point are shown, more precision is not warranted. It is often desirable to round a number obtained from a conversion of units in order to retain information on the precision of the value. The following rounding rules may be followed: (1) If the digits to be discarded begin with a digit less than 5, the digit preceding the first discarded digit is not changed. Example: 6.974 951 5 rounded to 3 digits is 6.97 (2) If the digits to be discarded begin with a digit greater than 5, the digit preceding the first discarded digit is increased by one. Example: 6.974 951 5 rounded to 4 digits is 6.975 (3) If the digits to be discarded begin with a 5 and at least one of the following digits is greater than 0, the digit preceding the 5 is increased by 1. Example: 6.974 851 rounded to 5 digits is 6.974 9 (4) If the digits to be discarded begin with a 5 and all of the following digits are 0, the digit preceding the 5 is unchanged if it is even and increased by one if it is odd. (Note that this means that the final digit is always even.) Examples: 6.974 951 5 rounded to 7 digits is 6.974 952 6.974 950 5 rounded to 7 digits is 6.974 950
REFERENCE Taylor, B. N., Guide for the Use of the International System of Units (SI), NIST Special Publication 811, 1995 Edition, Superintendent of Documents, U.S. Government Printing Office, Washington, DC 20402, 1995.
© 2000 by CRC PRESS LLC
Factors in boldface are exact To convert from
to
Multiply by
abampere. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ampere (A) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.0 abcoulomb . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . coulomb (C) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.0
E+01 E+01
abfarad . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . farad (F) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.0 abhenry . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . henry (H) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.0 abmho. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . siemens (S) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.0
E+09 Eⴚ09 E+09
abohm. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ohm (⍀) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.0 abvolt . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . volt (V) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.0 acceleration of free fall, standard (g n ). . . . . . . . . . . . . . . meter per second squared (m/s 2 ) . . . . . . . . . . . . . . 9.806 65 acre (based on U.S. survey foot)9 . . . . . . . . . . . . . . . . . . . square meter (m2). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4.046 873
Eⴚ09 Eⴚ08
acre foot (based on U.S. survey foot)9 . . . . . . . . . . . . . . cubic meter (m3) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.233 489 ampere hour (A ⭈ h) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . coulomb (C) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3.6
E+03 E+03
ångstro¨ m (Å) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . meter (m) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ångstro¨ m (Å) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . nanometer (nm). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . are (a) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . square meter (m2). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . astronomical unit (AU). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . meter (m) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . atmosphere, standard (atm). . . . . . . . . . . . . . . . . . . . . . . . . . pascal (Pa) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . atmosphere, standard (atm). . . . . . . . . . . . . . . . . . . . . . . . . . kilopascal (kPa). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . atmosphere, technical (at) 10 . . . . . . . . . . . . . . . . . . . . . . . . . pascal (Pa) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
Eⴚ10 Eⴚ01 E+02 E+11 E+05 E+02
1.0 1.0 1.0 1.495 979 1.013 25 1.013 25
9.806 65 atmosphere, technical (at) 10 . . . . . . . . . . . . . . . . . . . . . . . . . kilopascal (kPa). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 9.806 65
bar (bar). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . pascal (Pa) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . bar (bar). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilopascal (kPa). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . barn (b) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . square meter (m2). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . barrel [for petroleum, 42 gallons (U.S.)](bbl) . . . . . . . cubic meter (m3) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . barrel [for petroleum, 42 gallons (U.S.)](bbl) . . . . . . . liter (L) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . biot (Bi) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ampere (A) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . British thermal unit IT (BtuIT )11 . . . . . . . . . . . . . . . . . . . . . . joule (J). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . British thermal unit th (Btuth )11 . . . . . . . . . . . . . . . . . . . . . . joule (J). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . British thermal unit (mean) (Btu) . . . . . . . . . . . . . . . . . . . joule (J). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . British thermal unit (39 ⬚F) (Btu) . . . . . . . . . . . . . . . . . . . joule (J). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . British thermal unit (59 ⬚F) (Btu) . . . . . . . . . . . . . . . . . . . joule (J). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . British thermal unit (60 ⬚F) (Btu) . . . . . . . . . . . . . . . . . . . joule (J). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . British thermal unitIT foot per hour square foot degree Fahrenheit [BtuIT ⭈ ft/(h ⭈ ft2 ⭈ ⬚F)] . . . . . . . . . . . . . . . . . . . . . . . . . . . watt per meter kelvin [W/(m ⭈ K)]. . . . . . . . . . . . . British thermal unitth foot per hour square foot degree Fahrenheit [Btuth ⭈ ft/(h ⭈ ft2 ⭈ ⬚F)]. . . . . . . . . . . . . . . . . . . . . . . . . . . . watt per meter kelvin [W/(m ⭈ K)]. . . . . . . . . . . . .
E+03
E+04 E+01
1.0 1.0 1.0 1.589 873 1.589 873 1.0 1.055 056
E+05 E+02 Eⴚ28 E⫺01 E+02 E+01 E+03
1.054 350 1.055 87 1.059 67 1.054 80 1.054 68
E+03 E+03 E+03 E+03 E+03
1.730 735
E+00
1.729 577
E+00
British thermal unitIT inch per hour square foot degree Fahrenheit [BtuIT ⭈ in/(h ⭈ ft2 ⭈ ⬚F)] . . . . . . . . . . . . . . . . . . . . . . . . . . . watt per meter kelvin [W/(m ⭈ K)]. . . . . . . . . . . . . 1.442 279 British thermal unitth inch per hour square foot degree Fahrenheit [Btuth ⭈ in/(h ⭈ ft2 ⭈ ⬚F)] . . . . . . . . . . . . . . . . . . . . . . . . . . . watt per meter kelvin [W/(m ⭈ K)]. . . . . . . . . . . . . 1.441 314 British thermal unitIT inch per second square foot degree Fahrenheit [BtuIT ⭈ in/(s ⭈ ft2 ⭈ ⬚F)] . . . . . . . . . . . . . . . . . . . . . . . . . . . watt per meter kelvin [W/(m ⭈ K)]. . . . . . . . . . . . . 5.192 204
9
E+00
E⫺01 E⫺01 E+02
The U.S. survey foot equals (1200/3937) m. 1 international foot = 0.999998 survey foot. One technical atmosphere equals one kilogram-force per square centimeter (1 at = 1 kgf/cm 2 ). 11 The Fifth International Conference on the Properties of Steam (London, July 1956) defined the International Table calorie as 4.1868 J. Therefore the exact conversion factor for the International Table Btu is 1.055 055 852 62 kJ. Note that the notation for International Table used in this listing is subscript ‘‘IT’’. Similarily, the notation for thermochemical is subscript ‘‘th.’’ Further, the thermochemical Btu, Btu th , is based on the thermochemical calorie, cal th , where cal th = 4.184 J exactly. 10
© 2000 by CRC PRESS LLC
To convert from
to
British thermal unitth inch per second square foot degree Fahrenheit [Btuth ⭈ in/(s ⭈ ft2 ⭈ ⬚F)] . . . . . . . . . . . . . . . . . . . . . . . . . . . watt per meter kelvin [W/(m ⭈ K)]. . . . . . . . . . . . . British thermal unitIT per cubic foot (BtuIT /ft3). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule per cubic meter (J/m3) . . . . . . . . . . . . . . . . . . . British thermal unitth per cubic foot (Btuth /ft3). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule per cubic meter (J/m3) . . . . . . . . . . . . . . . . . . . British thermal unitIT per degree Fahrenheit (BtuIT / ⬚F) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule per kelvin (J/ k) . . . . . . . . . . . . . . . . . . . . . . . . . . British thermal unitth per degree Fahrenheit (Btuth /⬚F) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule per kelvin (J/ k) . . . . . . . . . . . . . . . . . . . . . . . . . . British thermal unitIT per degree Rankine (BtuIT /⬚R) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule per kelvin (J/ k) . . . . . . . . . . . . . . . . . . . . . . . . . . British thermal unitth per degree Rankine (Btuth /⬚R) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule per kelvin (J/ k) . . . . . . . . . . . . . . . . . . . . . . . . . . British thermal unitIT per hour (BtuIT /h) . . . . . . . . . . . . watt (W) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . British thermal unitth per hour (Btuth /h). . . . . . . . . . . . . watt (W) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . British thermal unitIT per hour square foot degree Fahrenheit [BtuIT /(h ⭈ ft2 ⭈ ⬚F)] . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . watt per square meter kelvin [W/(m2 ⭈ K)] . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . British thermal unitth per hour square foot degree Fahrenheit [Btuth /(h ⭈ ft2 ⭈ ⬚F)] . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . watt per square meter kelvin [W/(m2 ⭈ K)] . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . British thermal unitth per minute (Btuth /min) . . . . . . . watt (W) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . British thermal unitIT per pound (BtuIT /lb). . . . . . . . . . joule per kilogram (J/kg) . . . . . . . . . . . . . . . . . . . . . . British thermal unitth per pound (Btuth /lb) . . . . . . . . . . joule per kilogram (J/kg) . . . . . . . . . . . . . . . . . . . . . . British thermal unitIT per pound degree Fahrenheit [BtuIT /(lb ⭈ ⬚F)]. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule per kilogram kelvin (J/(kg ⭈ K)]. . . . . . . . . . British thermal unitth per pound degree Fahrenheit [Btuth /(lb ⭈ ⬚F)] . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule per kilogram kelvin [J/(kg ⭈ K)]. . . . . . . . . . British thermal unitIT per pound degree Rankine [BtuIT /(lb ⭈ ⬚R)] . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule per kilogram kelvin [J/(kg ⭈ K)]. . . . . . . . . . British thermal unitth per pound degree Rankine [Btuth /(lb ⭈ ⬚R)]. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule per kilogram kelvin [J/(kg ⭈ K)]. . . . . . . . . . British thermal unitIT per second (BtuIT /s) . . . . . . . . . . watt (W) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . British thermal unitth per second (Btuth /s) . . . . . . . . . . watt (W) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . British thermal unitIT per second square foot degree Fahrenheit [BtuIT /(s ⭈ ft2 ⭈ ⬚F)] . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . watt per square meter kelvin [W/(m2 ⭈ K)] . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . British thermal unitth per second square foot degree Fahrenheit [Btuth /(s ⭈ ft2 ⭈ ⬚F)] . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . watt per square meter kelvin [W/(m2 ⭈ K)] . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . British thermal unitIT per square foot (BtuIT /ft2) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule per square meter (J/m2) . . . . . . . . . . . . . . . . . . British thermal unitth per square foot (Btuth /ft2). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule per square meter (J/m2) . . . . . . . . . . . . . . . . . . British thermal unitIT per square foot hour [(BtuIT /(ft2 ⭈ h)] . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . watt per square meter (W/m2) . . . . . . . . . . . . . . . . . British thermal unitth per square foot hour [Btuth /(ft2 ⭈ h)]. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . watt per square meter (W/m2) . . . . . . . . . . . . . . . . . British thermal unitth per square foot minute [Btuth /(ft2 ⭈ min)] . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . watt per square meter (W/m2) . . . . . . . . . . . . . . . . . British thermal unitIT per square foot second [(BtuIT /(ft2 ⭈ s)] . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . watt per square meter (W/m2) . . . . . . . . . . . . . . . . . British thermal unitth per square foot second [Btuth /(ft2 ⭈ s)] . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . watt per square meter (W/m2) . . . . . . . . . . . . . . . . . British thermal unitth per square inch second [Btuth /(in2 ⭈ s)] . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . watt per square meter (W/m2) . . . . . . . . . . . . . . . . .
© 2000 by CRC PRESS LLC
Multiply by 5.188 732
E+02
3.725 895
E+04
3.723 403
E+04
1.899 101
E+03
1.897 830
E+03
1.899 101
E+03
1.897 830 2.930 711
E+03 E⫺01
2.928 751
E⫺01
5.678 263
E+00
5.674 466 1.757 250
E+00 E+01
2.326 2.324 444
E+03 E+03
4.1868
E+03
4.184
E+03
4.1868
E+03
4.184 1.055 056 1.054 350
E+03 E+03 E+03
2.044 175
E+04
2.042 808
E+04
1.135 653
E+04
1.134 893
E+04
3.154 591
E+00
3.152 481
E+00
1.891 489
E+02
1.135 653
E+04
1.134 893
E+04
1.634 246
E+06
To convert from
to
Multiply by 3
bushel (U.S.) (bu) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . cubic meter (m ) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3.523 907
E⫺02
bushel (U.S.) (bu) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . liter (L) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3.523 907
E+01
calorie IT (calIT) 11 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule (J). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . calorie th (calth) 11 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule (J). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . calorie (cal) (mean) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule (J). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . calorie (15 ⬚C) (cal 15) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule (J). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . calorie (20 ⬚C) (cal 20) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule (J). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
4.1868 4.184
E+00 E+00
4.190 02 4.185 80 4.181 90
E+00 E+00 E+00
4.1868 4.184 4.190 02
E+03 E+03 E+03
4.184 4.1868 4.184
E+02 E+03 E+03
4.1868
E+03
4.184 4.1868 4.184 6.973 333 4.184 4.184
E+03 E+03 E+03 E⫺02 E+00 E+04
6.973 333
E+02
4.184 1.550 003 2.0 2.0 1.333 22 1.333 22 1.333 224 1.333 224 9.806 38
E+04 E+03 Eⴚ04 Eⴚ01 E+03 E+00 E+03 E+00 E+01
9.806 65 1.0 1.0 2.011 684 5.067 075 5.067 075 1.55 3.624 556 2.831 685 4.719 474 4.719 474 2.831 685
E+01 Eⴚ03 Eⴚ06 E+01 E⫺10 E⫺04 E⫺01 E+00 E⫺02 E⫺04 E⫺01 E⫺02
calorieIT , kilogram (nutrition) 12 . . . . . . . . . . . . . . . . . . . . . joule (J). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . calorieth , kilogram (nutrition) 12 . . . . . . . . . . . . . . . . . . . . . joule (J). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . calorie (mean), kilogram (nutrition) 12 . . . . . . . . . . . . . . . joule (J). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . calorieth per centimeter second degree Celsius [calth /(cm ⭈ s ⭈ ⬚C)] . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . watt per meter kelvin [W/(m ⭈ K)]. . . . . . . . . . . . . calorieIT per gram (calIT /g). . . . . . . . . . . . . . . . . . . . . . . . . . joule per kilogram (J/kg) . . . . . . . . . . . . . . . . . . . . . . calorieth per gram (calth /g) . . . . . . . . . . . . . . . . . . . . . . . . . . joule per kilogram (J/kg) . . . . . . . . . . . . . . . . . . . . . . calorieIT per gram degree Celsius [calIT /(g ⭈ ⬚C)] . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule per kilogram kelvin [J/(kg ⭈ K)]. . . . . . . . . . calorieth per gram degree Celsius [calth /(g ⭈ ⬚C)] . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule per kilogram kelvin [J/(kg ⭈ K)]. . . . . . . . . . calorieIT per gram kelvin [cal IT /(g ⭈ K)] . . . . . . . . . . . . . joule per kilogram kelvin [J / (kg ⭈ K)] . . . . . . . . . calorieth per gram kelvin [cal th / (g ⭈ K)] . . . . . . . . . . . . . joule per kilogram kelvin [J / (kg ⭈ K)] . . . . . . . . . calorieth per minute (calth /min). . . . . . . . . . . . . . . . . . . . . . watt (W) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . calorieth per second (calth /s). . . . . . . . . . . . . . . . . . . . . . . . . watt (W) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . calorieth per square centimeter (calth /cm2). . . . . . . . . . . joule per square meter (J/m2) . . . . . . . . . . . . . . . . . . calorieth per square centimeter minute [calth /(cm2 ⭈ min)] . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . watt per square meter (W/m2) . . . . . . . . . . . . . . . . . calorieth per square centimeter second [calth /(cm2 ⭈ s)] . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . watt per square meter (W/m2) . . . . . . . . . . . . . . . . . candela per square inch (cd/in2) . . . . . . . . . . . . . . . . . . . . candela per square meter (cd/m2). . . . . . . . . . . . . . carat, metric . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilogram (kg) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . carat, metric . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . gram (g) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . centimeter of mercury (0 ⬚C) 13 . . . . . . . . . . . . . . . . . . . . . . pascal (Pa) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . centimeter of mercury (0 ⬚C) 13 . . . . . . . . . . . . . . . . . . . . . . kilopascal (kPa). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . centimeter of mercury, conventional (cmHg) 13 . . . . . . . pascal (Pa) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . centimeter of mercury, conventional (cmHg) 13 . . . . . . . kilopascal (kPa). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . centimeter of water (4 ⬚C) 13 . . . . . . . . . . . . . . . . . . . . . . . . . pascal (Pa) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . centimeter of water, conventional (cmH 2 O) 13 . . . . . . . . pascal (Pa) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . centipoise (cP) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . pascal second (Pa ⭈ s) . . . . . . . . . . . . . . . . . . . . . . . . . . centistokes (cSt) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . meter squared per second (m2 /s). . . . . . . . . . . . . . . chain (based on U.S. survey foot) (ch)9 . . . . . . . . . . . . . meter (m) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . circular mil. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . square meter (m2). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . circular mil. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . square millimeter (mm2) . . . . . . . . . . . . . . . . . . . . . . . clo . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . square meter kelvin per watt (m2 ⭈ K /W). . . . . . . cord (128 ft 3 ) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . cubic meter (m 3 ) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . cubic foot (ft3) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . cubic meter (m3) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . cubic foot per minute (ft3 /min) . . . . . . . . . . . . . . . . . . . . . cubic meter per second (m3 /s) . . . . . . . . . . . . . . . . . cubic foot per minute (ft3 /min) . . . . . . . . . . . . . . . . . . . . . liter per second (L / s) . . . . . . . . . . . . . . . . . . . . . . . . . . cubic foot per second (ft3 /s) . . . . . . . . . . . . . . . . . . . . . . . . cubic meter per second (m3 /s) . . . . . . . . . . . . . . . . . 12
The kilogram calorie or ‘‘large calorie’’ is an obsolete term used for the kilocalorie, which is the calorie used to express the energy content of foods. However, in practice, the prefix ‘‘kilo’’ is usually omitted. 13 Conversion factors for mercury manometer pressure units are calculated using the standard value for the acceleration of gravity and the density of mercury at the stated temperature. Additional digits are not justified because the definitions of the units do not take into account the compressibility of mercury or the change in density caused by the revised practical temperature scale, ITS-90. Similar comments also apply to water manometer pressure units. Conversion factors for conventional mercury and water manometer pressure units are based on ISO 31-3.
© 2000 by CRC PRESS LLC
To convert from
to
Multiply by
cubic inch (in3) 14 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . cubic meter (m3) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.638 706 cubic inch per minute (in3 /min). . . . . . . . . . . . . . . . . . . . . cubic meter per second (m3 /s) . . . . . . . . . . . . . . . . . 2.731 177 cubic mile (mi3) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . cubic meter (m3) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4.168 182 cubic yard (yd3) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . cubic meter (m3) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 7.645 549
E⫺05 E⫺07 E+09 E⫺01
cubic yard per minute (yd3 /min) . . . . . . . . . . . . . . . . . . . . cubic meter per second (m3 /s) . . . . . . . . . . . . . . . . . 1.274 258 cup (U.S.) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . cubic meter (m 3). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2.365 882 cup (U.S.) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . liter (L) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2.365 882
E⫺02 E⫺04 E⫺01
cup (U.S.) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . milliliter (mL) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2.365 882 curie (Ci) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . becquerel (Bq) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3.7
E+02 E+10
darcy15 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . meter squared (m2) . . . . . . . . . . . . . . . . . . . . . . . . . . . . 9.869 233 day (d) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . second (s). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 8.64
E⫺13 E+04
day (sidereal). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . second (s). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 8.616 409 debye (D) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . coulomb meter (C ⭈ m) . . . . . . . . . . . . . . . . . . . . . . . . 3.335 641
E+04 E⫺30
degree (angle) (⬚). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . radian (rad) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.745 329 E⫺02 degree Celsius (temperature) (⬚C) . . . . . . . . . . . . . . . . . . . kelvin (K). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . T / K = t / ⬚C+273.15 degree Celsius (temperature interval) (⬚C) . . . . . . . . . . kelvin (K). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.0 E+00 degree centigrade (temperature) 16 . . . . . . . . . . . . . . . . . . . degree Celsius (⬚C) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . t / ⬚C ≈ t / deg. cent. degree centigrade (temperature interval) 16 . . . . . . . . . . degree Celsius (⬚C) . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.0 E+00 degree Fahrenheit (temperature) (⬚F). . . . . . . . . . . . . . . . degree Celsius (⬚C) . . . . . . . . . . . . . . . . . . . . . . . . . . .t / ⬚C = (t / ⬚F ⫺ 32) / 1.8 degree Fahrenheit (temperature) (⬚F). . . . . . . . . . . . . . . . kelvin (K). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . T / K = (t / ⬚F + 459.67)/1.8 degree Fahrenheit (temperature interval)(⬚F) . . . . . . . . degree Celsius (⬚C) . . . . . . . . . . . . . . . . . . . . . . . . . . . . 5.555 556 E⫺01 degree Fahrenheit (temperature interval)(⬚F) . . . . . . . . kelvin (K). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 5.555 556 E⫺01 degree Fahrenheit hour per British thermal unit IT (⬚F ⭈ h / Btu IT) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kelvin per watt (K / W) . . . . . . . . . . . . . . . . . . . . . . . . . 1.895 634 E+00 degree Fahrenheit hour per British thermal unit th (⬚F ⭈ h / Btu th). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kelvin per watt (K / W) . . . . . . . . . . . . . . . . . . . . . . . . . 1.896 903 E+00 degree Fahrenheit hour square foot per British thermal unitIT (⬚F ⭈ h ⭈ ft2 /BtuIT). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . square meter kelvin per watt (m2 ⭈ K /W) . . . . . . 1.761 102 E⫺01 degree Fahrenheit hour square foot per British thermal unitth (⬚F ⭈ h ⭈ ft2 /Btuth) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . square meter kelvin per watt (m2 ⭈ K /W) . . . . . . 1.762 280 E⫺01 degree Fahrenheit hour square foot per British thermal unitIT inch [⬚F ⭈ h ⭈ ft2 /(BtuIT ⭈ in)] . . . . . . . . . . . . . . . . . . . . . . . . . . . meter kelvin per watt (m ⭈ K /W) . . . . . . . . . . . . . . 6.933 472 E+00 degree Fahrenheit hour square foot per British thermal unitth inch [⬚F ⭈ h ⭈ ft2 /(Btuth ⭈ in)] . . . . . . . . . . . . . . . . . . . . . . . . . . . meter kelvin per watt (m ⭈ K /W) . . . . . . . . . . . . . . 6.938 112 E+00 degree Fahrenheit second per British thermal unit IT (⬚F ⭈ s / Btu IT). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kelvin per watt (K / W) . . . . . . . . . . . . . . . . . . . . . . . . . 5.265 651 E⫺04 degree Fahrenheit second per British thermal unit th (⬚F ⭈ s / Btu th) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kelvin per watt (K / W) . . . . . . . . . . . . . . . . . . . . . . . . . 5.269 175 E⫺04 degree Rankine (⬚R) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kelvin (K). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .T / K = (T / ⬚R) / 1.8 degree Rankine (temperature interval) (⬚R) . . . . . . . . . kelvin (K). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 5.555 556 E⫺01 denier . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilogram per meter (kg/m) . . . . . . . . . . . . . . . . . . . . 1.111 111 E⫺07 denier . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . gram per meter (g/m) . . . . . . . . . . . . . . . . . . . . . . . . . 1.111 111 E⫺04 dyne (dyn) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . newton (N) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.0
Eⴚ05
dyne centimeter (dyn ⭈ cm). . . . . . . . . . . . . . . . . . . . . . . . . . newton meter (N ⭈ m). . . . . . . . . . . . . . . . . . . . . . . . . . 1.0 dyne per square centimeter (dyn/cm2) . . . . . . . . . . . . . . pascal (Pa) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.0
Eⴚ07 Eⴚ01
electronvolt (eV) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule (J). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.602 177
E⫺19
EMU of capacitance (abfarad) . . . . . . . . . . . . . . . . . . . . . . farad (F) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.0 EMU of current (abampere). . . . . . . . . . . . . . . . . . . . . . . . . ampere (A) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.0 EMU of electric potential (abvolt) . . . . . . . . . . . . . . . . . . volt (V) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.0
E+09 E+01 Eⴚ08
EMU of inductance (abhenry) . . . . . . . . . . . . . . . . . . . . . . henry (H) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.0
Eⴚ09
14
The exact conversion factor is 1.638 706 4 E⫺05. The darcy is a unit for expressing the permeability of porous solids, not area. 16 The centigrade temperature scale is obsolete; the degree centigrade is only approximately equal to the degree Celsius. 15
© 2000 by CRC PRESS LLC
To convert from
to
Multiply by
EMU of resistance (abohm) . . . . . . . . . . . . . . . . . . . . . . . . . ohm (⍀) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.0
Eⴚ09
erg (erg). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule (J). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.0
Eⴚ07
erg per second (erg/s). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . watt (W) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.0
Eⴚ07
erg per square centimeter second |1obrkt㜸1ru|/ (cm2 ⭈ s)]. . . . . . . . . . . . . . . . . . . . . . . . . . . . watt per square meter (W/m2) . . . . . . . . . . . . . . . . . ESU of capacitance (statfarad) . . . . . . . . . . . . . . . . . . . . . . farad (F) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ESU of current (statampere) . . . . . . . . . . . . . . . . . . . . . . . . ampere (A) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ESU of electric potential (statvolt) . . . . . . . . . . . . . . . . . . volt (V) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ESU of inductance (stathenry) . . . . . . . . . . . . . . . . . . . . . . henry (H) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ESU of resistance (statohm) . . . . . . . . . . . . . . . . . . . . . . . . . ohm (⍀) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
1.0
Eⴚ03
1.112 650 3.335 641 2.997 925 8.987 552 8.987 552
E⫺12 E⫺10 E+02 E+11 E+11
faraday (based on carbon 12) . . . . . . . . . . . . . . . . . . . . . . . coulomb (C) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 9.648 531 fathom (based on U.S. survey foot)9 . . . . . . . . . . . . . . . . meter (m) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.828 804 fermi . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . meter (m) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.0 fermi . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . femtometer (fm) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.0 fluid ounce (U.S.) (fl oz). . . . . . . . . . . . . . . . . . . . . . . . . . . . cubic meter (m3) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2.957 353 fluid ounce (U.S.) (fl oz). . . . . . . . . . . . . . . . . . . . . . . . . . . . milliliter (mL) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2.957 353 foot (ft) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . meter (m) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3.048 foot (U.S. survey) (ft)9 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . meter (m) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3.048 006
E+04
footcandle . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . lux (lx) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.076 391 footlambert. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . candela per square meter (cd/m2). . . . . . . . . . . . . . 3.426 259 foot of mercury, conventional (ftHg) 13 . . . . . . . . . . . . . . pascal (Pa) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4.063 666
E+00 Eⴚ15 E+00 E⫺05 E+01 Eⴚ01 E⫺01 E+01 E+00
4.063 666 2.988 98
E+04 E+01 E+03
2.988 98 2.989 067 2.989 067 8.466 667 5.08 3.048
E+00 E+03 E+00 E⫺05 Eⴚ03 Eⴚ01
3.048 4.214 011 1.355 818 3.766 161 2.259 697 1.355 818
Eⴚ01 E⫺02 E+00 E⫺04 E⫺02 E+00
8.630 975 franklin (Fr) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . coulomb (C) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3.335 641
E⫺03 E⫺10
gal (Gal) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . meter per second squared (m/s2). . . . . . . . . . . . . . . gallon [Canadian and U.K. (Imperial)] (gal) . . . . . . . . cubic meter (m3) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . gallon [Canadian and U.K. (Imperial)] (gal) . . . . . . . . liter (L) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . gallon (U.S.) (gal) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . cubic meter (m3) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
1.0 4.546 09 4.546 09
Eⴚ02 Eⴚ03 E+00
3.785 412 3.785 412 4.381 264 4.381 264
E⫺03 E+00 E⫺08 E⫺05
1.410 089 gallon (U.S.) per horsepower hour [gal / (hp ⭈ h)] . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . liter per joule (L / J) . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.410 089 gallon (U.S.) per minute (gpm)(gal / min) . . . . . . . . . . . cubic meter per second (m3 /s) . . . . . . . . . . . . . . . . . 6.309 020 gallon (U.S.) per minute (gpm) (gal / min) . . . . . . . . . . . liter per second (L / s) . . . . . . . . . . . . . . . . . . . . . . . . . . 6.309 020
E⫺09
foot of mercury, conventional (ftHg) 13 . . . . . . . . . . . . . . kilopascal (kPa). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . foot of water (39.2 ⬚F) 13 . . . . . . . . . . . . . . . . . . . . . . . . . . . . pascal (Pa) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . foot of water (39.2 ⬚F) 13 . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilopascal (kPa). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . foot of water, conventional (ftH 2 O) 13 . . . . . . . . . . . . . . . pascal (Pa) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . foot of water, conventional (ftH 2 O) 13 . . . . . . . . . . . . . . . kilopascal (kPa). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . foot per hour (ft/h). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . meter per second (m/s) . . . . . . . . . . . . . . . . . . . . . . . . foot per minute (ft/min) . . . . . . . . . . . . . . . . . . . . . . . . . . . . meter per second (m/s) . . . . . . . . . . . . . . . . . . . . . . . . foot per second (ft/s). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . meter per second (m/s) . . . . . . . . . . . . . . . . . . . . . . . . foot per second squared (ft/s2) . . . . . . . . . . . . . . . . . . . . . . meter per second squared (m/s2). . . . . . . . . . . . . . . foot foot foot foot foot foot
poundal. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule (J). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . pound-force (ft ⭈ lbf) . . . . . . . . . . . . . . . . . . . . . . . . . . . joule (J). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . pound-force per hour (ft ⭈ lbf/h). . . . . . . . . . . . . . . . watt (W) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . pound-force per minute (ft ⭈ lbf/min) . . . . . . . . . . watt (W) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . pound-force per second (ft ⭈ lbf/s) . . . . . . . . . . . . . watt (W) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . to the fourth power (ft 4) 17 . . . . . . . . . . . . . . . . . . . . . . meter to the fourth power (m4) . . . . . . . . . . . . . . . .
gallon (U.S.) (gal) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . liter (L) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . gallon (U.S.) per day (gal / d) . . . . . . . . . . . . . . . . . . . . . . . . cubic meter per second (m3 /s) . . . . . . . . . . . . . . . . . gallon (U.S.) per day (gal / d) . . . . . . . . . . . . . . . . . . . . . . . . liter per second (L / s) . . . . . . . . . . . . . . . . . . . . . . . . . . gallon (U.S.) per horsepower hour [gal / (hp ⭈ h)] . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . cubic meter per joule (m3 /J) . . . . . . . . . . . . . . . . . . .
17 This is a unit for the quantity second moment of area, which is sometimes called the ‘‘moment of section’’ or ‘‘area moment of inertia’’ of a plane section about a specified axis.
© 2000 by CRC PRESS LLC
E⫺06 E⫺05 E⫺02
To convert from
to
Multiply by
gamma (␥) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . tesla (T) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.0
Eⴚ09
gauss (Gs, G) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . tesla (T) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.0
Eⴚ04
gilbert (Gi) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ampere (A) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . gill [Canadian and U.K. (Imperial)] (gi) . . . . . . . . . . . . cubic meter (m3) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . gill [Canadian and U.K. (Imperial)] (gi) . . . . . . . . . . . . liter (L) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . gill (U.S.) (gi). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . cubic meter (m3) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . gill (U.S.) (gi). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . liter (L) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . gon (also called grade) (gon) . . . . . . . . . . . . . . . . . . . . . . . . radian (rad) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . gon (also called grade) (gon) . . . . . . . . . . . . . . . . . . . . . . . . degree (angle) (⬚) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . grain (gr) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilogram (kg) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . grain (gr) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . milligram (mg) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . grain per gallon (U.S.) (gr / gal) . . . . . . . . . . . . . . . . . . . . . kilogram per cubic meter (kg/m3) . . . . . . . . . . . . .
7.957 747 1.420 653 1.420 653 1.182 941 1.182 941 1.570 796 9.0 6.479 891 6.479 891
E⫺01 E⫺04 E⫺01 E⫺04 E⫺01 E⫺02 Eⴚ01 Eⴚ05 E+01
1.711 806 grain per gallon (U.S.) (gr / gal) . . . . . . . . . . . . . . . . . . . . . milligram per liter (mg / L). . . . . . . . . . . . . . . . . . . . . 1.711 806 gram-force per square centimeter (gf / cm 2). . . . . . . . . . pascal (Pa) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 9.806 65 gram per cubic centimeter (g / cm 3) . . . . . . . . . . . . . . . . . kilogram per cubic meter (kg/m3) . . . . . . . . . . . . . 1.0
E⫺02 E+01 E+01
hectare (ha) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . square meter (m2). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . horsepower (550 ft ⭈ lbf/s) (hp) . . . . . . . . . . . . . . . . . . . . . watt (W) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . horsepower (boiler) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . watt (W) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . horsepower (electric). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . watt (W) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . horsepower (metric). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . watt (W) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . horsepower (U.K.) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . watt (W) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . horsepower (water). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . watt (W) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . hour (h) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . second (s). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . hour (sidereal) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . second (s). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . hundredweight (long, 112 lb). . . . . . . . . . . . . . . . . . . . . . . . kilogram (kg) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . hundredweight (short, 100 lb) . . . . . . . . . . . . . . . . . . . . . . . kilogram (kg) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
1.0 7.456 999 9.809 50 7.46 7.354 988 7.4570 7.460 43 3.6 3.590 170 5.080 235 4.535 924
E+04 E+02 E+03 E+02 E+02 E+02 E+02 E+03 E+03 E+01 E+01
inch (in) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . meter (m) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . inch (in) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . centimeter (cm) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . inch of mercury (32 ⬚F) 13 . . . . . . . . . . . . . . . . . . . . . . . . . . . pascal (Pa) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . inch of mercury (32 ⬚F) 13 . . . . . . . . . . . . . . . . . . . . . . . . . . . kilopascal (kPa). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . inch of mercury (60 ⬚F) 13 . . . . . . . . . . . . . . . . . . . . . . . . . . . pascal (Pa) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . inch of mercury (60 ⬚F) 13 . . . . . . . . . . . . . . . . . . . . . . . . . . . kilopascal (kPa). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . inch of mercury, conventional (inHg) 13 . . . . . . . . . . . . . pascal (Pa) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . inch of mercury, conventional (inHg) 13 . . . . . . . . . . . . . kilopascal (kPa). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . inch of water (39.2 ⬚F) 13 . . . . . . . . . . . . . . . . . . . . . . . . . . . . pascal (Pa) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . inch of water (60 ⬚F) 13 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . pascal (Pa) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . inch of water, conventional (inH 2 O) 13 . . . . . . . . . . . . . . pascal (Pa) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
2.54 2.54 3.386 38 3.386 38 3.376 85
Eⴚ02 E+00 E+03 E+00 E+03
3.376 85 3.386 389 3.386 389 2.490 82 2.4884
E+00 E+03 E+00 E+02 E+02
2.490 889 inch per second (in/s). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . meter per second (m/s) . . . . . . . . . . . . . . . . . . . . . . . . 2.54 inch per second squared (in/s2) . . . . . . . . . . . . . . . . . . . . . meter per second squared (m/s2). . . . . . . . . . . . . . . 2.54 inch to the fourth power (in4) 17 . . . . . . . . . . . . . . . . . . . . . meter to the fourth power (m4) . . . . . . . . . . . . . . . . 4.162 314
E+03
E+02 Eⴚ02 Eⴚ02 E⫺07
E+02 kayser (K) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . reciprocal meter (m ⫺1 ) . . . . . . . . . . . . . . . . . . . . . . . . 1.0 kelvin (K) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . degree Celsius (⬚C) . . . . . . . . . . . . . . . . . . . . . . . . . . . .t / ⬚C = T / K ⫺ 273.15 E+03 kilocalorieIT (kcalIT) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule (J). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4.1868 E+03 kilocalorieth (kcalth) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule (J). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4.184 kilocalorie (mean) (kcal) . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule (J). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4.190 02 E+03 E+01 kilocalorieth per minute (kcalth /min) . . . . . . . . . . . . . . . . watt (W) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 6.973 333 kilocalorieth per second (kcalth / s) . . . . . . . . . . . . . . . . . . . watt (W) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4.184 E+03 kilogram-force (kgf) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . newton (N) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 9.806 65 kilogram-force meter (kgf ⭈ m) . . . . . . . . . . . . . . . . . . . . . . newton meter (N ⭈ m). . . . . . . . . . . . . . . . . . . . . . . . . . 9.806 65
© 2000 by CRC PRESS LLC
E+00 E+00
To convert from
to
Multiply by
kilogram-force per square centimeter (kgf/cm 2). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . pascal (Pa) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 9.806 65
E+04
kilogram-force per square centimeter (kgf/cm 2). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilopascal (kPa). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 9.806 65
E+01
kilogram-force per square meter (kgf/m2). . . . . . . . . . . pascal (Pa) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 9.806 65
E+00
kilogram-force per square millimeter (kgf/mm 2) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . pascal (Pa) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 9.806 65
E+06
kilogram-force per square millimeter (kgf/mm 2) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . megapascal (MPa) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 9.806 65
E+00
kilogram-force second squared per meter (kgf ⭈ s 2 /m). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilogram (kg) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 9.806 65
E+00
kilometer per hour (km/h) . . . . . . . . . . . . . . . . . . . . . . . . . . meter per second (m/s) . . . . . . . . . . . . . . . . . . . . . . . . 2.777 778 kilopond (kilogram-force) (kp) . . . . . . . . . . . . . . . . . . . . . . newton (N) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 9.806 65
E⫺01 E+00
kilowatt hour (kW ⭈ h) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule (J). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3.6
E+06
kilowatt hour (kW ⭈ h) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . megajoule (MJ) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3.6 kip (1 kip=1000 lbf) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . newton (N) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4.448 222
E+00 E+03
kip (1 kip=1000 lbf) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilonewton (kN) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4.448 222
E+00
kip per square inch (ksi) (kip/in2). . . . . . . . . . . . . . . . . . . pascal (Pa) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 6.894 757 kip per square inch (ksi) (kip/in2). . . . . . . . . . . . . . . . . . . kilopascal (kPa). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 6.894 757 knot (nautical mile per hour) . . . . . . . . . . . . . . . . . . . . . . . . meter per second (m/s) . . . . . . . . . . . . . . . . . . . . . . . . 5.144 444
E+06 E+03 E⫺01
lambert 18 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . candela per square meter (cd/m2). . . . . . . . . . . . . . 3.183 099 langley (cal th /cm 2 ) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule per square meter (J/m2) . . . . . . . . . . . . . . . . . . 4.184 light year (l.y.)19 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . meter (m) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 9.460 73 liter (L) 20 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . cubic meter (m3) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.0
E+03 E+04 E+15 Eⴚ03
lumen per square foot (lm/ft 2) . . . . . . . . . . . . . . . . . . . . . . lux (lx) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.076 391
E+01
maxwell (Mx) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . weber (Wb) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.0 mho . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . siemens (S) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.0
Eⴚ08 E+00
microinch . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . meter (m) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2.54 microinch . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . micrometer (m) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2.54 micron () . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . meter (m) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.0
Eⴚ08 Eⴚ02 Eⴚ06
micron () . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . micrometer (m) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.0 mil (0.001 in). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . meter (m) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2.54 mil (0.001 in). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . millimeter (mm) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2.54
E+00 Eⴚ05 Eⴚ02
mil (angle) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . radian (rad) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 9.817 477 mil (angle) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . degree (⬚) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 5.625 mile (mi) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . meter (m) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.609 344
E⫺04 Eⴚ02 E+03
mile (mi) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilometer (km). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.609 344 mile (based on U.S. survey foot) (mi) 9 . . . . . . . . . . . . . . meter (m) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.609 347 mile (based on U.S. survey foot) (mi) 9 . . . . . . . . . . . . . . kilometer (km). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.609 347
E+00 E+03
E+00 mile, nautical 21 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . meter (m) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.852 E+03 mile per gallon (U.S.) (mpg) (mi/gal) . . . . . . . . . . . . . . . meter per cubic meter (m/m 3) . . . . . . . . . . . . . . . . . 4.251 437 E+05 mile per gallon (U.S.) (mpg) (mi/gal) . . . . . . . . . . . . . . . kilometer per liter (km /L) . . . . . . . . . . . . . . . . . . . . . 4.251 437 E⫺01 mile per gallon (U.S.) (mpg) (mi/gal) 22 . . . . . . . . . . . . . liter per 100 kilometer (L/100 km) . . . . . . . .divide 235.215 by number of miles per gallon mile per hour (mi/h) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . meter per second (m/s) . . . . . . . . . . . . . . . . . . . . . . . . 4.4704 Eⴚ01 mile per hour (mi/h) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilometer per hour (km/h) . . . . . . . . . . . . . . . . . . . . . 1.609 344 E+00
18
The exact conversion factor is 10 4 /. This conversion factor is based on 1 d = 86 400 s; and 1 Julian century = 36 525 d. (See The Astronomical Almanac for the Year 1995 , page K6, U.S. Government Printing Office, Washington, DC, 1994). 20 In 1964 the General Conference on Weights and Measures reestablished the name ‘‘liter’’ as a special name for the cubic decimeter. Between 1901 and 1964 the liter was slightly larger (1.000 028 dm3); when one uses high-accuracy volume data of that time, this fact must be kept in mind. 21 The value of this unit, 1 nautical mile = 1852 m, was adopted by the First International Extraordinary Hydrographic Conference, Monaco, 1929, under the name ‘‘International nautical mile.’’ 22 For converting fuel economy, as used in the U.S., to fuel consumption. 19
© 2000 by CRC PRESS LLC
To convert from
to
Multiply by
mile per minute (mi/min) . . . . . . . . . . . . . . . . . . . . . . . . . . . meter per second (m/s) . . . . . . . . . . . . . . . . . . . . . . . . 2.682 24
E+01
mile per second (mi/s) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . meter per second (m/s) . . . . . . . . . . . . . . . . . . . . . . . . 1.609 344 millibar (mbar) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . pascal (Pa) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.0
E+03 E+02
millibar (mbar) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilopascal (kPa). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.0 1.333 224 9.806 65
Eⴚ01 E+02 E+00
2.908 882 6.0
E⫺04 E+01
minute (sidereal) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . second (s). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 5.983 617
E+01
oersted (Oe) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ampere per meter (A/m). . . . . . . . . . . . . . . . . . . . . . . 7.957 747 ohm centimeter (⍀ ⭈ cm). . . . . . . . . . . . . . . . . . . . . . . . . . . . ohm meter (⍀ ⭈ m). . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.0
E+01 Eⴚ02
ohm circular-mil per foot . . . . . . . . . . . . . . . . . . . . . . . . . . . ohm meter (⍀ ⭈ m). . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.662 426
E⫺09
ohm circular-mil per foot . . . . . . . . . . . . . . . . . . . . . . . . . . . ohm square millimeter per meter (⍀ ⭈ mm 2 / m). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.662 426
E⫺03
ounce (avoirdupois) (oz). . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilogram (kg) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ounce (avoirdupois) (oz). . . . . . . . . . . . . . . . . . . . . . . . . . . . . gram (g) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ounce (troy or apothecary) (oz) . . . . . . . . . . . . . . . . . . . . . kilogram (kg) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ounce (troy or apothecary) (oz) . . . . . . . . . . . . . . . . . . . . . gram (g) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
E⫺02 E+01 E⫺02 E+01
millimeter of mercury, conventional (mmHg)13 . . . . . . . pascal (Pa) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . millimeter of water, conventional (mmH 2 O)13 . . . . . . . . pascal (Pa) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . minute (angle) (') . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . radian (rad) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . minute (min) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . second (s). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
2.834 952 2.834 952 3.110 348 3.110 348
ounce [Canadian and U.K. fluid (Imperial)] (fl oz). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . cubic meter (m3) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2.841 306 ounce [Canadian and U.K. fluid (Imperial)] (fl oz) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . milliliter (mL) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2.841 306
E+01
ounce (U.S. fluid) (fl oz). . . . . . . . . . . . . . . . . . . . . . . . . . . . cubic meter (m3) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2.957 353 ounce (U.S. fluid) (fl oz). . . . . . . . . . . . . . . . . . . . . . . . . . . . millimeter (mL) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2.957 353
E⫺05 E+01
ounce (avoirdupois)-force (ozf). . . . . . . . . . . . . . . . . . . . . . newton (N) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ounce (avoirdupois)-force inch (ozf ⭈ in) . . . . . . . . . . . . newton meter (N ⭈ m). . . . . . . . . . . . . . . . . . . . . . . . . . ounce (avoirdupois)-force inch (ozf ⭈ in) . . . . . . . . . . . . millinewton meter (mN ⭈ m) . . . . . . . . . . . . . . . . . . . ounce (avoirdupois) per cubic inch (oz / in3) . . . . . . . . . kilogram per cubic meter (kg/m3) . . . . . . . . . . . . . ounce (avoirdupois) per gallon [Canadian and U.K. (Imperial)] (oz / gal). . . . . . . . . . . . . . . . . . . . . . . . . kilogram per cubic meter (kg/m3) . . . . . . . . . . . . . ounce (avoirdupois) per gallon [Canadian and U.K. (Imperial)] (oz / gal). . . . . . . . . . . . . . . . . . . . . . . . . gram per liter (g / L) . . . . . . . . . . . . . . . . . . . . . . . . . . . ounce (avoirdupois) per gallon (U.S.)(oz / gal) . . . . . . . kilogram per cubic meter (kg/m3) . . . . . . . . . . . . . ounce (avoirdupois) per gallon(U.S.)(oz / gal). . . . . . . . gram per liter (g / L) . . . . . . . . . . . . . . . . . . . . . . . . . . . ounce (avoirdupois) per square foot (oz / ft2). . . . . . . . . kilogram per square meter (kg/m2) . . . . . . . . . . . . ounce (avoirdupois) per square inch (oz / in2) . . . . . . . . kilogram per square meter (kg/m2) . . . . . . . . . . . . ounce (avoirdupois) per square yard (oz / yd2) . . . . . . . . kilogram per square meter (kg/m2) . . . . . . . . . . . .
2.780 139 7.061 552 7.061 552 1.729 994
E⫺01 E⫺03 E+00 E+03
6.236 023
E+00
6.236 023 7.489 152 7.489 152 3.051 517
E+00 E+00 E+00 E⫺01
4.394 185 3.390 575
E+01 E⫺02
parsec (pc) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . meter (m) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . peck (U.S.) (pk) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . cubic meter (m3) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . peck (U.S.) (pk) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . liter (L) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . pennyweight (dwt). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilogram (kg) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . pennyweight (dwt). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . gram (g) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . perm (0 ⬚C) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilogram per pascal second square meter [kg/(Pa ⭈ s ⭈ m2)] . . . . . . . . . . . . . . . . . . . . . . . . . . . . perm (23 ⬚C) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilogram per pascal second square meter [kg/(Pa ⭈ s ⭈ m2)] . . . . . . . . . . . . . . . . . . . . . . . . . . . . perm inch (0 ⬚C) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilogram per pascal second meter [kg/(Pa ⭈ s ⭈ m)] . . . . . . . . . . . . . . . . . . . . . . . . . . . . . perm inch (23 ⬚C) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilogram per pascal second meter [kg/(Pa ⭈ s ⭈ m)] . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
3.085 678 8.809 768 8.809 768 1.555 174 1.555 174
E+16 E⫺03 E+00 E⫺03 E+00
5.721 35
E⫺11
5.745 25
E⫺11
1.453 22
E⫺12
1.459 29
E⫺12
© 2000 by CRC PRESS LLC
E⫺05
To convert from
to
phot (ph) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . lux (lx) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . pica (computer) (1/6 in) . . . . . . . . . . . . . . . . . . . . . . . . . . . . meter (m) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . pica (computer) (1/6 in) . . . . . . . . . . . . . . . . . . . . . . . . . . . . millimeter (mm) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . pica (printer’s) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . meter (m) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
Multiply by 1.0 4.233 333 4.233 333 4.217 518
E+04 E⫺03 E+00 E⫺03
pica (printer’s) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . millimeter (mm) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4.217 518 pint (U.S. dry) (dry pt). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . cubic meter (m3) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 5.506 105 pint (U.S. dry) (dry pt). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . liter (L) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 5.506 105 pint (U.S. liquid) (liq pt) . . . . . . . . . . . . . . . . . . . . . . . . . . . . cubic meter (m3) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4.731 765
E+00
pint (U.S. liquid) (liq pt) . . . . . . . . . . . . . . . . . . . . . . . . . . . . liter (L) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4.731 765 point (computer) (1/72 in). . . . . . . . . . . . . . . . . . . . . . . . . . meter (m) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3.527 778 point (computer) (1/72 in). . . . . . . . . . . . . . . . . . . . . . . . . . millimeter (mm) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3.527 778
E⫺04 E⫺01 E⫺04 E⫺01 E⫺04 E⫺01
point (printer’s) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . meter (m) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . point (printer’s) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . millimeter (mm) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . poise (P) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . pascal second (Pa ⭈ s) . . . . . . . . . . . . . . . . . . . . . . . . . . pound (avoirdupois) (lb)23 . . . . . . . . . . . . . . . . . . . . . . . . . . . kilogram (kg) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
3.514 598 3.514 598 1.0
E⫺04 E⫺01 Eⴚ01
4.535 924 pound (troy or apothecary) (lb) . . . . . . . . . . . . . . . . . . . . . kilogram (kg) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3.732 417 poundal . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . newton (N) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.382 550 poundal per square foot . . . . . . . . . . . . . . . . . . . . . . . . . . . . . pascal (Pa) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.488 164
E⫺01 E⫺01 E⫺01 E+00
poundal second per square foot . . . . . . . . . . . . . . . . . . . . . pascal second (Pa ⭈ s) . . . . . . . . . . . . . . . . . . . . . . . . . . pound foot squared (lb ⭈ ft2) . . . . . . . . . . . . . . . . . . . . . . . . . kilogram meter squared (kg ⭈ m2) . . . . . . . . . . . . . . pound-force (lbf)24 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . newton (N) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . pound-force foot (lbf ⭈ ft) . . . . . . . . . . . . . . . . . . . . . . . . . . . newton meter (N ⭈ m). . . . . . . . . . . . . . . . . . . . . . . . . . pound-force foot per inch (lbf ⭈ ft/in) . . . . . . . . . . . . . . . newton meter per meter (N ⭈ m/m) . . . . . . . . . . . .
1.488 164
E+00
4.214 011 4.448 222 1.355 818 5.337 866
E⫺02 E+00 E+00 E+01
pound-force inch (lbf ⭈ in). . . . . . . . . . . . . . . . . . . . . . . . . . . newton meter (N ⭈ m). . . . . . . . . . . . . . . . . . . . . . . . . . 1.129 848 pound-force inch per inch (lbf ⭈ in/in) . . . . . . . . . . . . . . newton meter per meter (N ⭈ m/m) . . . . . . . . . . . . 4.448 222 pound-force per foot (lbf/ft) . . . . . . . . . . . . . . . . . . . . . . . . newton per meter (N/m). . . . . . . . . . . . . . . . . . . . . . . 1.459 390
E⫺01 E+00 E+01
pound-force per inch (lbf/in). . . . . . . . . . . . . . . . . . . . . . . . newton per meter (N/m). . . . . . . . . . . . . . . . . . . . . . . 1.751 268 pound-force per pound (lbf/lb) (thrust to mass ratio) . . . . . . . . . . . . . . . . . . . . . newton per kilogram (N/kg) . . . . . . . . . . . . . . . . . . . 9.806 65 pound-force per square foot (lbf/ft2) . . . . . . . . . . . . . . . . pascal (Pa) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4.788 026 pound-force per square inch (psi) (lbf/in2 ) . . . . . . . . . . pascal (Pa) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 6.894 757
E+02
pound-force per square inch (psi) (lbf/in2 ) . . . . . . . . . . kilopascal (kPa). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . pound-force second per square foot (lbf ⭈ s/ft2) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . pascal second (Pa ⭈ s) . . . . . . . . . . . . . . . . . . . . . . . . . . pound-force second per square inch (lbf ⭈ s/in2) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . pascal second (Pa ⭈ s) . . . . . . . . . . . . . . . . . . . . . . . . . . pound inch squared (lb ⭈ in2) . . . . . . . . . . . . . . . . . . . . . . . . kilogram meter squared (kg ⭈ m2) . . . . . . . . . . . . . . pound per cubic foot (lb/ft3) . . . . . . . . . . . . . . . . . . . . . . . . kilogram per cubic meter (kg/m3) . . . . . . . . . . . . . pound per cubic inch (lb/in3) . . . . . . . . . . . . . . . . . . . . . . . kilogram per cubic meter (kg/m3) . . . . . . . . . . . . . pound per cubic yard (lb/yd3) . . . . . . . . . . . . . . . . . . . . . . . kilogram per cubic meter (kg/m3) . . . . . . . . . . . . . pound per foot (lb/ft) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilogram per meter (kg/m) . . . . . . . . . . . . . . . . . . . . pound per foot hour [lb/(ft ⭈ h)] . . . . . . . . . . . . . . . . . . . . . pascal second (Pa ⭈ s) . . . . . . . . . . . . . . . . . . . . . . . . . .
6.894 757
E+00
4.788 026
E+01
6.894 757
E+03
2.926 397 1.601 846
E⫺04 E+01
2.767 990 5.932 764 1.488 164 4.133 789
E+04 E⫺01 E+00 E⫺04
pound per foot second [lb/(ft ⭈ s)]. . . . . . . . . . . . . . . . . . . pascal second (Pa ⭈ s) . . . . . . . . . . . . . . . . . . . . . . . . . . 1.488 164 pound per gallon [Canadian and U.K. (Imperial)] (lb/gal) . . . . . . . . . . . . . . . . . . . . . . . . . kilogram per cubic meter (kg/m3) . . . . . . . . . . . . . 9.977 637 pound per gallon [Canadian and U.K. (Imperial)] (lb/gal) . . . . . . . . . . . . . . . . . . . . . . . . . kilogram per liter (kg/L) . . . . . . . . . . . . . . . . . . . . . . 9.977 637 pound per gallon (U.S.) (lb/gal). . . . . . . . . . . . . . . . . . . . . kilogram per cubic meter (kg/m3) . . . . . . . . . . . . . 1.198 264
E+00
E+00 E+01 E+03
E+01 E⫺02
pound per gallon (U.S.) (lb/gal). . . . . . . . . . . . . . . . . . . . . kilogram per liter (kg/L) . . . . . . . . . . . . . . . . . . . . . . 1.198 264
E+02 E⫺01
pound per horsepower hour [lb/(hp ⭈ h)] . . . . . . . . . . . . kilogram per joule (kg/J) . . . . . . . . . . . . . . . . . . . . . . 1.689 659 pound per hour (lb/h) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilogram per second (kg/s) . . . . . . . . . . . . . . . . . . . . 1.259 979
E⫺07 E⫺04
23
The exact conversion factor is 4.535 923 7 E⫺01. All units that contain the pound refer to the avoirdupois pound.
24
If the local value of the acceleration of free fall is taken as g n= 9.806 65 m / s 2 (the standard value), the exact conversion factor is 4.448 221 615 260 5 E+00.
© 2000 by CRC PRESS LLC
To convert from
to
Multiply by
pound per inch (lb/in). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilogram per meter (kg/m) . . . . . . . . . . . . . . . . . . . . 1.785 797 pound per minute (lb/min) . . . . . . . . . . . . . . . . . . . . . . . . . . kilogram per second (kg/s) . . . . . . . . . . . . . . . . . . . . 7.559 873
E+01 E⫺03
pound per second (lb/s) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilogram per second (kg/s) . . . . . . . . . . . . . . . . . . . . pound per square foot (lb/ft2) . . . . . . . . . . . . . . . . . . . . . . . kilogram per square meter (kg/m2) . . . . . . . . . . . . pound per square inch (not pound-force) (lb/in2) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilogram per square meter (kg/m2) . . . . . . . . . . . . pound per yard (lb/yd) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilogram per meter (kg/m) . . . . . . . . . . . . . . . . . . . . psi (pound-force per square inch) (lbf/in 2) . . . . . . . . . . pascal (Pa) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . psi (pound-force per square inch) (lbf/in 2) . . . . . . . . . . kilopascal (kPa). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
4.535 924 4.882 428
E⫺01 E+00
7.030 696 4.960 546 6.894 757 6.894 757
E+02 E⫺01 E+03 E+00
quad (10 15 Btu IT ) 11 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule (J). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.055 056 quart (U.S. dry) (dry qt) . . . . . . . . . . . . . . . . . . . . . . . . . . . . cubic meter (m3) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.101 221 quart (U.S. dry) (dry qt) . . . . . . . . . . . . . . . . . . . . . . . . . . . . liter (L) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.101 221 quart (U.S. liquid) (liq qt). . . . . . . . . . . . . . . . . . . . . . . . . . . cubic meter (m3) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 9.463 529 quart (U.S. liquid) (liq qt). . . . . . . . . . . . . . . . . . . . . . . . . . . liter (L) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 9.463 529
E+18
rad (absorbed dose) (rad) . . . . . . . . . . . . . . . . . . . . . . . . . . . gray (Gy) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . rem (rem) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . sievert (Sv) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . revolution (r) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . radian (rad) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . revolution per minute (rpm) (r/min). . . . . . . . . . . . . . . . . radian per second (rad/s) . . . . . . . . . . . . . . . . . . . . . . rhe . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . reciprocal pascal second [(Pa ⭈ s) ⫺1 ]. . . . . . . . . . . rod (based on U.S. survey foot) (rd)9. . . . . . . . . . . . . . . . meter (m) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . roentgen (R) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . coulomb per kilogram (C/kg). . . . . . . . . . . . . . . . . . rpm (revolution per minute) (r/min). . . . . . . . . . . . . . . . . radian per second (rad/s) . . . . . . . . . . . . . . . . . . . . . .
1.0 1.0 6.283 185 1.047 198 1.0 5.029 210 2.58 1.047 198
Eⴚ02 Eⴚ02 E+00 E⫺01 E+01 E+00 Eⴚ04 E⫺01
second (angle) (") . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . radian (rad) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . second (sidereal) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . second (s). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . shake . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . second (s). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . shake . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . nanosecond (ns) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . slug (slug). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilogram (kg) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . slug per cubic foot (slug/ft 3 ). . . . . . . . . . . . . . . . . . . . . . . . kilogram per cubic meter (kg/m3) . . . . . . . . . . . . . slug per foot second [slug/(ft ⭈ s)] . . . . . . . . . . . . . . . . . . pascal second (Pa ⭈ s) . . . . . . . . . . . . . . . . . . . . . . . . . . square foot (ft2) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . square meter (m2). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . square foot per hour (ft2 /h) . . . . . . . . . . . . . . . . . . . . . . . . . square meter per second (m2 /s) . . . . . . . . . . . . . . . . square foot per second (ft2 /s) . . . . . . . . . . . . . . . . . . . . . . . square meter per second (m2 /s) . . . . . . . . . . . . . . . . square inch (in2) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . square meter (m2). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . square inch (in2) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . square centimeter (cm2). . . . . . . . . . . . . . . . . . . . . . . . square mile (mi2). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . square meter (m2). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . square mile (mi2). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . square kilometer (km2). . . . . . . . . . . . . . . . . . . . . . . . . square mile (based on U.S. survey foot) (mi 2)9 . . . . . . . . . . . . . . . . square meter (m2). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . square mile (based on U.S. survey foot) (mi 2)9 . . . . . . . . . . . . . . . . square kilometer (km2). . . . . . . . . . . . . . . . . . . . . . . . . square yard (yd2 ). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . square meter (m2). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . statampere . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ampere (A) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
4.848 137 9.972 696 1.0 1.0 1.459 390 5.153 788 4.788 026 9.290 304 2.580 64
E⫺06 E⫺01 Eⴚ08 E+01 E+01 E+02 E+01 Eⴚ02 Eⴚ05
9.290 304 6.4516 6.4516 2.589 988 2.589 988
Eⴚ02 Eⴚ04 E+00 E+06 E+00
2.589 998
E+06
2.589 998 8.361 274 3.335 641
E+00 E⫺01 E⫺10
statcoulomb . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . coulomb (C) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3.335 641 statfarad . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . farad (F) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.112 650
E⫺10 E⫺12
stathenry . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . henry (H) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . statmho . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . siemens (S) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . statohm. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ohm (⍀) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . statvolt . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . volt (V) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . stere (st) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . cubic meter (m3) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . stilb (sb). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . candela per square meter (cd/m2). . . . . . . . . . . . . .
E+11 E⫺12 E+11 E+02 E+00
8.987 552 1.112 650 8.987 552 2.997 925 1.0
1.0 stokes (St) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . meter squared per second (m2 /s). . . . . . . . . . . . . . . 1.0
© 2000 by CRC PRESS LLC
E⫺03 E+00 E⫺04 E⫺01
E+04 Eⴚ04
To convert from
to
Multiply by
tablespoon. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . cubic meter (m 3) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.478 676
E⫺05
tablespoon. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . milliliter (mL) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.478 676
E+01
teaspoon . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . cubic meter (m 3). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4.928 922
E⫺06
teaspoon . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . milliliter (mL) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . tex . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilogram per meter (kg/m) . . . . . . . . . . . . . . . . . . . . therm (EC)25 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule (J). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . therm (U.S.)25 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule (J). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
4.928 922 1.0 1.055 06
E+00 Eⴚ06 E+08
1.054 804 2.916 667 2.916 667 8.896 443 8.896 443 1.016 047
E+08 E⫺02 E+01 E+03 E+00 E+03
1.328 939 1.0 1.0
E+03 E+03 E+03
3.516 853 4.184
E+03 E+09
2.831 685 9.071 847 1.186 553 2.519 958 1.333 224
E+00 E+02 E+03 E⫺01 E+02
unit pole. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . weber (Wb) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1.256 637
E⫺07
watt hour (W ⭈ h) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule (J). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . watt per square centimeter (W/cm2 ). . . . . . . . . . . . . . . . watt per square meter (W/m2) . . . . . . . . . . . . . . . . . watt per square inch (W/in2 ). . . . . . . . . . . . . . . . . . . . . . . . watt per square meter (W/m2) . . . . . . . . . . . . . . . . . watt second (W ⭈ s) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . joule (J). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
3.6
E+03
1.0 1.550 003 1.0
E+04 E+03 E+00
yard (yd) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . meter (m) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . year (365 days). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . second (s). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . year (sidereal). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . second (s). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . year (tropical) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . second (s). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
9.144 3.1536 3.155 815 3.155 693
Eⴚ01 E+07 E+07 E+07
ton, assay (AT) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilogram (kg) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ton, assay (AT) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . gram (g) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ton-force (2000 lbf) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . newton (N) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ton-force (2000 lbf) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilonewton (kN) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ton, long (2240 lb) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilogram (kg) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ton, long, per cubic yard . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilogram per cubic meter (kg/m3) . . . . . . . . . . . . . ton , metric (t). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilogram (kg) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . tonne (called ‘‘metric ton’’ in U.S.) (t) . . . . . . . . . . . . . kilogram (kg) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ton of refrigeration (12 000 Btu IT /h) . . . . . . . . . . . . . . . . watt (W) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ton of TNT (energy equivalent) 26 . . . . . . . . . . . . . . . . . . . joule (J). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ton, register . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . cubic meter (m3) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ton, short (2000 lb) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilogram (kg) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ton, short, per cubic yard . . . . . . . . . . . . . . . . . . . . . . . . . . . kilogram per cubic meter (kg/m3) . . . . . . . . . . . . . ton, short, per hour. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . kilogram per second (kg/s) . . . . . . . . . . . . . . . . . . . . torr (Torr) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . pascal (Pa) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
25 The therm (EC) is legally defined in the Council Directive of 20 December 1979, Council of the European Communities (now the European Union, EU). The therm (U.S.) is legally defined in the Federal Register of July 27, 1968. Although the therm (EC), which is based on the International Table Btu, is frequently used by engineers in the United States, the therm (U.S.) is the legal unit used by the U.S. natural gas industry. 26 Defined (not measured) value.
© 2000 by CRC PRESS LLC
CONVERSION OF TEMPERATURES From
To
Celsius
Fahrenheit Kelvin Rankine
tF/˚F = (9/5) t/˚C + 32 T/K = t/˚C + 273.15 T/˚R = (9/5) (t/˚C + 273.15)
Fahrenheit
Celsius Kelvin Rankine
t/˚C = (5/9) [(tF/˚F) - 32] T/K = (5/9) [(tF/˚F) - 32] + 273.15 T/˚R = tF/˚F + 459.67
Kelvin
Celsius Rankine
t/˚C = T/K - 273.15 T/˚R = (9/5) T/K
Rankine
Fahrenheit Kelvin
tF/˚F = T/˚R - 459.67 T/K = (5/9) T/˚R
Definition of symbols: T = thermodynamic (absolute) temperature t = Celsius temperature (the symbol θ is also used for Celsius temperature) tF = Fahrenheit temperature
DESIGNATION OF LARGE NUMBERS 106 109 1012 1015 1018
© 2000 CRC Press LLC
U.S.A. million billion trillion quadrillion quintillion
Other Countries million milliard billion billiard trillion
CONVERSION FACTORS FOR ENERGY UNITS If greater accuracy is required, use the Energy Equivalents section of the Fundamental Physical Constants table.
v: 1 cm-1 v: 1 MHz
Wavenumber v cm-1 ⬟1 ⬟ 3.33564 × 10-5
Frequency v MHz 2.997925 × 104 1
Energy E aJ 1.986447 × 10-5 6.626076 × 10-10
Energy E eV 1.239842 × 10-4 4.135669 × 10-9
Energy E Eh 4.556335 × 10-6 1.519830 × 10-10
Molar energy Em kJ/mol 11.96266 × 10-3 3.990313 × 10-7
Molar energy Em kcal/mol 2.85914 × 10-3 9.53708 × 10-8
Temperature T K 1.438769 4.79922 × 10-5
1 aJ E: 1 eV Eh
⬟ 50341.1 ⬟ 8065.54 ⬟ 219474.63
1.509189 × 109 2.417988 × 108 6.579684 × 109
1 0.1602177 4.359748
6.241506 1 27.2114
0.2293710 3.674931 × 10-2 1
602.2137 96.4853 2625.500
143.9325 23.0605 627.510
7.24292 × 104 1.16045 × 104 3.15773 × 105
Em: 1 kJ/mol 1 kcal/mol
⬟ 83.5935 ⬟ 349.755
2.506069 × 106 1.048539 × 107
1.660540 × 10-3 6.947700 × 10-3
1.036427 × 10-2 4.336411 × 10-2
3.808798 × 10-4 1.593601 × 10-3
1 4.184
0.239006 1
120.272 503.217
T: 1 K
⬟ 0.695039
2.08367 × 104
1.380658 × 10-5
8.61738 × 10-5
3.16683 × 10-6
8.31451 × 10-3
1.98722 × 10-3
1
Examples of the use of this table:
1 aJ ⬟ 50341 cm-1 1 eV ⬟96.4853 kJ mol-1
The symbol ⬟ should be read as meaning “corresponds to” or “is equivalent to”. E = hv = hcv = kT; Em = NAE ; Eh is the Hartree energy
© 2000 by CRC PRESS LLC
CONVERSION FACTORS FOR PRESSURE UNITS Pa Pa kPa MPa bar atmos Torr µmHg psi
1 1000 1000000 100000 101325 133.322 0.133322 6894.757
kPa 0.001 1 1000 100 101.325 0.133322 0.000133322 6.894757
MPa 0.000001 0.001 1 0.1 0.101325 0.000133322 1.33322 × 10–7 0.006894757
bar 0.00001 0.01 10 1 1.01325 0.00133322 1.33322 × 10–6 0.06894757
atmos
Torr
µmHg
9.8692 × 10–6 0.0098692 9.8692 0.98692 1 0.00131579 1.31579 × 10–6 0.068046
0.0075006 7.5006 7500.6 750.06 760 1 0.001 51.7151
7.5006 7500.6 7500600 750060 760000 1000 1 51715.1
psi 0.0001450377 0.1450377 145.0377 14.50377 14.69594 0.01933672 1.933672 × 10–5 1
To convert a pressure value from a unit in the left hand column to a new unit, multiply the value by the factor appearing in the column for the new unit. For example: 1 kPa = 9.8692 × 10–3 atmos 1 Torr = 1.33322 × 10–4 MPa
1-34
Notes: µmHg is often referred to as “micron” Torr is essentially identical to mmHg psi is an abbreviation for the unit pound–force per square inch psia (as a term for a physical quantity) implies the true (absolute) pressure psig implies the true pressure minus the local atmospheric pressure
CONVERSION FACTORS FOR THERMAL CONDUCTIVITY UNITS MULTIPLY ↓ by appropriate factor to OBTAIN→
BtuIT h-1 ft-1 °F-1
BtuIT in. h-1 ft-2 °F-1
Btuth h-1 ft-1 °F-1
Btuth in. h-1 ft-2 °F-1
calIT s-1 cm-1 °C-1
calth s-1 cm-1 °C-1
kcalth h-1 m-1 °C-1
J s-1 cm-1 K-1
W cm-1 K-1
W m-1 K-1
mW cm-1 K-1
BtuIT h-1 ft-1 °F-1 BtuIT in. h-1 ft-2 °F-1 Btuth h-1 ft-1 °F-1 Btuth in. h-1 ft-2 °F-1 calIT s-1 cm-1 °C-1 calth s-1 cm-1 °C-1 kcalth h-1 m-1 °C-1 J s-1 cm-1 K-1 W cm-1 K-1 W m-1 K-1 mW cm-1 K-1
1 8.33333 × 10-2 0.999331 8.32776 × 10-2 2.41909 × 102 2.41747 × 102 0.671520 57.7789 57.7789 0.577789 5.77789 × 10-2
12 1 11.9920 0.999331 2.90291 × 103 2.90096 × 103 8.05824 6.93347 × 102 6.93347 × 102 6.93347 0.693347
1.00067 8.33891 × 10-2 1 8.33333 × 10-2 2.42071 × 102 2.41909 × 102 0.671969 57.8176 57.8176 0.578176 5.78176 × 10-2
12.0080 1.00067 12 1 2.90485 × 103 2.90291 × 103 8.06363 6.93811 × 102 6.93811 × 102 6.93811 0.693811
4.13379 × 10-3 3.44482 × 10-4 4.13102 × 10-3 3.44252 × 10-4 1 0.999331 2.77592 × 10-3 0.238846 0.238846 2.38846 × 10-3 2.38846 × 10-4
4.13656 × 10-3 3.44713 × 10-4 4.13379 × 10-3 3.44482 × 10-4 1.00067 1 2.77778 × 10-3 0.239006 0.239006 2.39006 × 10-3 2.39006 × 10-4
1.48916 0.124097 1.48816 0.124014 3.60241 × 102 3.6 × 102 1 86.0421 86.0421 0.860421 8.60421 × 10-2
1.73073 × 10-2 1.44228 × 10-3 1.72958 × 10-2 1.44131 × 10-3 4.1868 4.184 1.16222 × 10-2 1 1 1 × 10-2 1 × 10-3
1.73073 × 10-2 1.44228 × 10-3 1.72958 × 10-2 1.44131 × 10-3 4.1868 4.184 1.16222 × 10-2 1 1 1 × 10-2 1 × 10-3
1.73073 0.144228 1.72958 0.144131 4.1868 × 102 4.184 × 102 1.16222 1 × 102 1 × 102 1 0.1
17.3073 1.44228 17.2958 1.44131 4.1868 × 103 4.184 × 103 11.6222 1 × 103 1 × 103 10 1
© 2000 CRC Press LLC
CONVERSION FACTORS FOR ELECTRICAL RESISTIVITY UNITS To convert from multiply by appropriate factor to Obtain
↓
→
abohm centimeter microohm centimeter ohm centimeter statohm centimeter (esu) ohm meter ohm circular mil per foot ohm inch ohm foot
abΩ cm 1 103 108 8.987 × 1020 1011 1.662 × 102 2.54 × 109 3.048 × 1010
µΩ cm
Ω cm
1 × 10–3 1 106 8.987 × 1017 108 1.662 × 10–1 2.54 × 106 3.048 × 107
10–9 10–6 1 8.987 × 1011 102 1.662 × 10–7 2.54 3.048 × 10–1
StatΩ cm 1.113 × 10–21 1.113 × 10–18 1.113 × 10–12 1 1.113 × 10–10 1.850 × 10–19 2.827 × 10–12 3.3924 × 10–11
Ωm 10–11 10–6 1 × 10–2 8.987 × 109 1 1.662 × 10–9 2.54 × 10–2 3.048 × 10–1
Ω cir. mil ft–1 6.015 × 10–3 6.015 6.015 × 106 5.406 × 1018 6.015 × 108 1 1.528 × 107 1.833 × 108
Ω in. 3.937 × 10–10 3.937 × 10–7 3.937 × 10–1 3.538 × 1011 3.937 × 101 6.54 × 10–6 1 12
Ω ft 3.281 × 10–11 3.281 × 10–6 3.281 × 10–2 2.949 × 1010 3.281 5.45 × 10–9 8.3 × 10–2 1
1-36
CONVERSION FACTORS FOR IONIZING RADIATION CONVERSION BETWEEN SI AND OTHER UNITS
Expression in SI units
Special name for SI units
s–1 J kg–1 J kg–1 s–1
becquerel gray
1-39
Activity Absorbed dose Absorbed dose rate
A D D·
Average energy per ion pair Dose equivalent Dose equivalent rate
W
Electric current Electric potential difference Exposure Exposure rate
I U, V
Fluence Fluence rate
φ Φ
Kerma Kerma rate
K K·
Lineal energy
y
coulomb per kilogram coulomb per kilogram second 1 per meter squared 1 per meter squared second joule per kilogram joule per kilogram second joule per meter
Linear energy transfer
L
joule per meter
J m–1
Mass attenuation coefficient Mass energy transfer coefficient Mass energy absorption coefficient Mass stopping power
µ/ρ
m2 kg–1
S/ρ
Power Pressure
P p
Radiation chemical yield Specific energy
G
meter squared per kilogram meter squared per kilogram meter squared per kilogram joule meter squared per kilogram joule per second newton per meter squared mole per joule
mol J–1
z
joule per kilogram
J kg–1
H H·
X X·
µtr/ρ µen/ρ
1 per second joule per kilogram joule per kilogram second joule
Expression in symbols for SI units
joule per kilogram joule per kilogram second ampere watt per ampere
Symbols using special names Bq Gy Gy s–1
J J kg–1 J kg–1 s–1
Conventional units
Symbol for conventional unit
Value of conventional unit in SI units
curie rad rad
Ci rad rad s–1
3.7 × 1010 Bq 0.01 Gy 0.01 Gy s–1
electronvolt
eV
1.602 × 10–19 J
sievert
Sv Sv s–1
rem rem per second
rem rem s–1
0.01 Sv 0.01 Sv s–1
volt
V
ampere volt
A V
1.0 A 1.0 A
C kg–1 C kg–1 s–1
roentgen roentgen
R R s–1
2.58 × 10–4 C kg–1 2.58 × 10–4 C kg–1 s–1
m–2 m–2 s–1
cm–2 cm–2 s–1
1.0 × 104 m–2 1.0 × 104 m–2 s–1
Gy Gy s–1
1 per centimeter squared 1 per centimeter squared second rad rad per second
rad rad s–1
0.01 Gy 0.01 Gy s–1
keV µm–1
1.602 × 10–10 J m–1
keV µm–1
1.602 × 10–10 J m–1
cm2 g–1
0.1 m2 kg–1
cm2 g–1
0.1 m2 kg–1
cm2 g–1
0.1 m2 kg–1
MeV cm2 g–1
1.602 × 10–14 J m2 kg–1
W Pa
kiloelectron volt per micrometer kiloelectron volt per micrometer centimeter squared per gram centimeter squared per gram centimeter squared per gram MeV centimeter squared per gram watt torr
W torr
1.0 W (101325/760)Pa
molecules (100 eV)–1 rad
1.04 × 10–7 mol J–1
Gy
molecules per 100 electron volts rad
A W A–1
J kg–1 J kg–1 s–1
gray
J m–1
m2 kg–1 m2 kg–1 J m2 kg–1 J s–1 N m–2
watt pascal
gray
0.01 Gy
CONVERSION FACTORS FOR IONIZING RADIATION (continued)
Quantity
Symbol for quantity
CONVERSION FACTORS FOR IONIZING RADIATION (continued) CONVERSION OF RADIOACTIVITY UNITS FROM MBq TO mCi AND µCi MBq
mCi
MBq
7000 6000 5000 4000 3000 2000 1000 900 800 700 600
189. 162. 135. 108. 81. 54. 27. 24. 21.6 18.9 16.2
500 400 300 200 100 90 80 70 60 50 40
mCi 13.5 10.8 8.1 5.4 2.7 2.4 2.16 1.89 1.62 1.35 1.08
MBq
µCi
MBq
µCi
30 20 10 9 8 7 6 5 4 3 2
810 540 270 240 220 189 162 135 108 81 54
1 0.9 0.8 0.7 0.6 0.5 0.4 0.3 0.2 0.1
27 24 21.6 18.9 16.2 13.5 10.8 8.1 5.4 2.7
CONVERSION OF RADIOACTIVITY UNITS FROM mCi AND µCi TO MBq mCi
MBq
mCi
MBq
200 150 100 90 80 70 60 50 40 30 20
7400 5550 3700 3330 2960 2590 2220 1850 1480 1110 740
10 9 8 7 6 5 4 3 2 1
370 333 296 259 222 185 148 111 74.0 37.0
µCi
MBq
µCi
MBq
1000 900 800 700 600 500 400 300 200 100 90
37.0 33.3 29.6 25.9 22.2 18.5 14.8 11.1 7.4 3.7 3.33
80 70 60 50 40 30 20 10 5 2 1
2.96 2.59 2.22 1.85 1.48 1.11 0.74 0.37 0.185 0.074 0.037
CONVERSION OF RADIOACTIVITY UNITS 100 TBq (1014 Bq) 10 TBq (1013 Bq) 1 TBq (1012 Bq) 100 GBq (1011 Bq) 10 GBq (1010 Bq) 1 GBq (109 Bq) 100 MBq (108 Bq) 10 MBq (107 Bq) 1 MBq (106 Bq)
= = = = = = = = =
2.7 kCi (2.7 × 103 Ci) 270 Ci (2.7 × 102 Ci) 27 Ci (2.7 × 101 Ci) 2.7 Ci (2.7 × 100 Ci) 270 mCi (2.7 × 10–1 Ci) 27 mCi (2.7 × 10–2 Ci) 2.7 mCi (2.7 × 10–3 Ci) 270 µCi (2.7 × 10–4 Ci) 27 µCi (2.7 × 10–5 Ci)
100 kBq (105 Bq) 10 kBq (104 Bq) 1 kBq (103 Bq) 100 Bq (102 Bq) 10 Bq (101 Bq) 1 Bq (100 Bq) 100 mBq (10–1 Bq) 10 mBq (10–2 Bq) 1 mBq (10–3 Bq)
CONVERSION OF ABSORBED DOSE UNITS SI Units 100 Gy (102 Gy) 10 Gy (101 Gy) 1 Gy (100 Gy) 100 mGy (10–1 Gy) 10 mGy (10–2 Gy) 1 mGy (10–3 Gy) 100 µGy (10–4 Gy) 10 µGy (10–5 Gy) 1 µGy (10–6 Gy) 100 nGy (10–7 Gy) 10 nGy (10–8 Gy) 1 nGy (10–9 Gy)
CONVERSION OF DOSE EQUIVALENT UNITS 100 Sv (102 Sv) 10 Sv (101 Sv) 1 Sv (100 Sv) 100 mSv (10–1 Sv) 10 mSv (10–2 Sv) 1 mSv (10–3 Sv) 100 µSv (10–4 Sv) 10 µSv (10–5 Sv) 1 µSv (10–6 Sv) 100 nSv (10–7 Sv) 10 nSv (10–8 Sv) 1 nSv (10–9 Sv)
Conventional = = = = = = = = = = = =
10,000 rad (104 rad) 1,000 rad (103 rad) 100 rad (102 rad) 10 rad (101 rad) 1 rad (100 rad) 100 mrad (10–1 rad) 10 mrad (10–2 rad) 1 mrad (10–3 rad) 100 µrad (10–4 rad) 10 µrad (10–5 rad) 1 µrad (10–6 rad) 100 nrad (10–7 rad)
2.7 µCi (2.7 × 10–6Ci) 270 nCi (2.7 × 10–7 Ci) 27 nCi (2.7 × 10–8 Ci) 2.7 nCi (2.7 × 10–9 Ci) 270 pCi (2.7 × 10–10 Ci) 27 pCi (2.7 × 10–11 Ci) 2.7 pCi (2.7 × 10–12 Ci) 270 fCi (2.7 × 10–13 Ci) 27 fCi (2.7 × 10–14 Ci)
= = = = = = = = =
1-40
= = = = = = = = = = = =
10,000 rem (104 rem) 1,000 rem (103 rem) 100 rem (102 rem) 10 rem (101 rem) 1 rem (100 rem) 100 mrem (10–1 rem) 10 mrem (10–2 rem) 1 mrem (10–3 rem) 100 µrem (10–4 rem) 10 µrem (10–5 rem) 1 µrem (10–6 rem) 100 nrem (10–7 rem)
VALUES OF THE GAS CONSTANT IN DIFFERENT UNIT SYSTEMS In SI units the value of the gas constant, R, is: R =8.314510 Pa m3 K-1 mol-1 = 8314.510 Pa L K-1 mol-1 = 0.08314510 bar L K-1 mol-1 This table gives the appropriate value of R for use in the ideal gas equation, PV = nRT, when the variables are expressed in other units. The following conversion factors for pressure units were used in generating the table: 1 atm = 101325 Pa 1 psi = 6894.757 Pa 1 torr (mmHg) = 133.322 Pa [at 0°C] 1 in Hg = 3386.38 Pa [at 0°C] 1 in H2O = 249.082 Pa [at 4°C] 1 ft H2O = 2988.98 Pa [at 4°C] The advice of Prabir K. Chandra is appreciated.
V
Units of V, T, n T n
ft3
K °R
cm3
K °R
L
K °R
m3
K °R
mol lb⋅mol mol lb⋅mol mol lb⋅mol mol lb⋅mol mol lb⋅mol mol lb⋅mol mol lb⋅mol mol lb⋅mol
kPa 0.2936241 133.1857 0.1631245 73.99204 8314.510 3771398 4619.172 2095221 8.314510 3771.398 4.619172 2095.221 0.008314510 3.771398 0.004619172 2.095221
atm
psi
0.00289785 1.31444 0.00160991 0.730245 82.0578 37220.8 45.5877 20678.2 0.0820578 37.2208 0.0455877 20.6782 0.0000820578 0.0372208 0.0000455877 0.0206782
0.0425866 19.3169 0.0236592 10.7316 1205.92 546995 669.954 303886 1.20592 546.995 0.669954 303.886 0.00120592 0.546995 0.000669954 0.303886
1-40
Units of P mmHg 2.20237 998.978 1.22354 554.987 62364.1 28287900 34646.7 15715500 62.3641 28287.9 34.6467 15715.5 0.0623641 28.2879 0.0346467 15.7155
in Hg
in H2O
ft H2O
0.0867074 39.3298 0.0481708 21.8499 2455.28 1113700 1364.04 618720 2.45528 1113.70 1.36404 618.720 0.00245528 1.11370 0.00136404 0.618720
1.17882 534.706 0.654903 297.059 33380.6 15141200 18544.8 8411770 33.3806 15141.2 18.5448 8411.77 0.0333806 15.1412 0.0185448 8.41177
0.0982355 44.5589 0.0545753 24.7549 2781.72 1261770 1545.40 700982 2.78172 1261.77 1.54540 700.982 0.00278172 1.26177 0.00154540 0.700982
1-33
NOMENCLATURE OF CHEMICAL COMPOUNDS The International Union of Pure and Applied Chemistry (IUPAC) maintains several commissions that deal with the naming of chemical substances. In general, the approach of IUPAC is to present rules for arriving at names in a systematic manner, rather than recommending a unique name for each compound. Thus there are often several alternative “IUPAC names”, depending on which nomenclature system is used, each of which may have advantages in specific applications. However, each of these names will be unambiguous. Organizations such as the Chemical Abstacts Service and the Beilstein Institute that prepare indexes to the chemical literature must adopt a system for selecting unique names in order to avoid excessive cross referencing. Chemical Abstracts Service uses a system which groups together compounds derived from a single parent compound. Thus most index names are inverted (e.g., Benzene, bromo rather than bromobenzene; Acetic acid, sodium salt rather than sodium acetate). In this Handbook the CAS Index Names are used only in the table “Physical Constants of Organic Compounds”. Other tables use more familiar names which, with a few possible exceptions, conform to one of the IUPAC naming systems. Recommended names for the most common substituent groups, ligands, ions, and organic rings are given in the two following tables, “Nomenclature for Inorganic Ions and Ligands” and “Organic Substituent Groups and Ring Systems”. For the basics of macromolecular nomenclature, see “Naming Organic Polymers” in Section 13. Some of the most useful recent guides to chemical nomenclature, prepared by IUPAC and other organizations such as the International Union of Biochemistry and Molecular Biology (IUBMB) and the American Chemical Society are listed below . These books contain citations to the more detailed nomenclature documents in each area.
Inorganic Chemistry International Union of Pure and Applied Chemistry, Nomenclature of Inorganic Chemistry, Recommendations 1990, edited by Leigh, G.J., Blackwell Scientific Publications, Oxford, 1990. Block, B.P., Powell, W.H., and Fernelius, W.C., Inorganic Chemical Nomenclature, Principles and Practice, American Chemical Society, Washington, 1990.
Organic Chemistry International Union of Pure and Applied Chemistry, A Guide to IUPAC Nomenclature of Organic Compounds, Recommendations 1993, edited by Panico, R., Powell, W.H., and Richer, J.-C., Blackwell Scientific Publications, Oxford, 1993. International Union of Pure and Applied Chemistry, Glossary of Class Names of Organic Compounds and Reactive Intermediates Based on Structure, edited by Moss, G.P., Smith, P.A.S., and Tavernier, D., Pure & Appl. Chem, 67, 1307, 1995. Rhodes, P.H., The Organic Chemist’s Desk Reference, Chapman & Hall, London, 1995. International Union of Pure and Applied Chemistry, Basic Terminology of Stereochemistry, edited by Moss, G.P., Pure & Applied Chemistry, 68, 2193, 1966.
Macromolecular Chemistry International Union of Pure and Applied Chemistry, Compendium of Macromolecular Nomenclature, edited by, Metanomski, W.V., Blackwell Scientific Publications, Oxford, 1991. International Union of Pure and Applied Chemistry, Glossary of Basic Terms in Polymer Science, edited by Jenkins, A.D., Kratochvil, P., Stepto, R.F.T., and Suter, U.W., Pure & Appl. Chem, 68, in press.
Biochemistry International Union of Biochemistry and Molecular Biology, Biochemical Nomenclature and Related Documents, 2nd Edition, 1992, Portland Press, London, 1993; includes recommendations of the IUPAC-IUBMB Joint Commission on Biochemical Nomenclature. International Union of Biochemistry and Molecular Biology, Enzyme Nomenclature, 1992, Academic Press, Orlando, FL, 1992. IUPAC-IUBMB Joint Commission on Biochemical Nomenclature, Nomenclature of Carbohydrates, Recommendations 1996, edited by McNaught, A.D., Pure & Appl. Chem., 68, 1919, 1996.
General Chemical Abstracts Service, Naming and Indexing Chemical Substances for Chemical Abstracts, Appendix IV, Chemical Abstracts 1994 Index Guide.
2-22
NOMENCLATURE FOR INORGANIC IONS AND LIGANDS See the table Nomenclature of Chemical Compounds for references. The assistance of Warren H. Powell in preparing this list is gratefully acknowledged. Group H F Cl Br I ClO C1O2 ClO3 C1O4 IO IO2 O O2 HO HO2 S HS S2 SO SO2 SO3 HSO3 S2O3 SO4 Se SeO SeO2 SeO3 SeO4 Te CrO2 UO2 NpO2 PuO2 AmO2 N N3 NH NH2 NHOH N2H3 NO NO2 ONO NS NO3 N2O3 P PO PO2 PS PH2O3 PHO3
As prefix in organic compounds
As cation
As anion
As ligand
hydrogen fluorine chlorine bromine iodine chlorosyl chloryl perchloryl
hydride fluoride chloride bromide iodide hypochlorite chlorite chlorate perchlorate hypoiodite
hydrido fluoro chloro bromo iodo hypochlorito chlorito chlorato
fluoro chloro bromo iodo chlorosyl chloryl perchloryl
oxide peroxide (O22-) hyperoxide (O2-) hydroxide hydrogen peroxide sulfide hydrogen sulfide disulfide
oxo peroxo
iodoso iodyl; iodoxy oxo peroxy
iodosyl iodyl
sulfinyl; thionyl sulfonyl; sulfuryl
hydroxo hydrogen peroxo thio; sulfido thiolo disulfido
hydroxy hydroperoxy thio; thioxo mercapto sulfinyl sulfonyl
sulfoxylate sulfite hydrogen sulfite thiosulfate sulfate selenide
sulfito hydrogen sulfito thiosulfato sulfato seleno
selenite selenate telluride
selenito selenato telluro
nitride azide imide amide hydroxylamide hydrazide
nitrite
nitrido azido imido amido hydroxylamido hydrazido nitrosyl nitro nitrito
nitrate hyponitrite phosphide
nitrato hyponitrito phosphido
seleninyl selenonyl
seleno; selenoxo seleninyl selenonyl
telluro; telluroxo
chromyl uranyl neptunyl plutoryl americyl
nitrosyl nitryl
imino amino hydroxyamino hydrazino; diazanyl nitroso nitro
thionitrosyl
phosphoryl phospho thiophosphoryl
phosphinidyne phosphoroso; phosphinylidyne phosphinothioylidyne; thiophosphorozo
hypophosphite phosphite
2-23
hypophosphito phosphito
NOMENCLATURE FOR INORGANIC IONS AND LIGANDS (continued) Group PO4 AsO4 VO CO CS CH3O C2H5O CH3S C2H5S CN OCN SCN SeCN TeCN CO3 HCO3 C2O4
As cation
As anion phosphate arsenate
As prefix in organic compounds
phosphato arsenato
vanadyl carbonyl thiocarbonyl
cyanogen
As ligand
carbonyl methanolate ethanolate methanethiolate ethanethiolate cyanide cyanate thiocyanate selenocyanate tellurocyanate carbonate hydrogen carbonate oxalate
2-24
methoxo ethoxo methanethiolato ethanethiolato cyano cyanato thiocyanato selenocyanato tellurocyanato carbonato hydrogen carbonato oxalato
carbonyl thiocarbonyl methoxy ethoxy methylthio ethylthio cyano cyanato thiocyanato selenocyanato tellurocyanato carboxycarbonyl
ORGANIC SUBSTITUENT GROUPS AND RING SYSTEMS The first part of this table lists substituent groups and their line formulas. A substituent group is defined by IUPAC as a group that replaces one or more hydrogen atoms attached to a parent structure. Such groups are sometimes called radicals, but IUPAC now reserves the term radical for a free molecular species with unpaired electrons. IUPAC does not recommend some of these names, which are marked here with asterisks (e.g., amyl*), but they are included in this list because they are often encountered in the older literature. Substituent group names which are formed by systematic rules (e.g., methyl from methane, ethyl from ethane, etc.) are included here only for the first few members of a homologous series. In the second part of the table a number of common organic ring compounds are shown, with the conventional numbering of the ring positions indicated. The help of Warren H. Powell in preparing this table is greatly appreciated. Pertinent references may be found in the table Nomenclature of Chemical Compounds. SUBSTITUENT GROUPS acetamido (acetylamino) acetoacetyl acetonyl acetyl acryloyl* (1-oxo-2-propenyl) alanyl (from alanine) β-alanyl allyl (2-propenyl) allylidene (2-propenylidene) amidino (aminoiminomethyl) amino amyl* (pentyl) anilino (phenylamino) anisidino anthranoyl (2-aminobenzoyl) arsino azelaoyl (from azelaic acid) azido azino azo azoxy benzal* (benzylidene) benzamido (benzoylamino) benzhydryl (diphenylmethyl) benzoxy* (benzoyloxy) benzoyl benzyl benzylidene benzylidyne biphenylyl biphenylene butoxy sec-butoxy (1-methylpropoxy) tert-butoxy (1,1-dimethylethoxy) butyl sec-butyl (1-methylpropyl) tert-butyl (1,1-dimethylethyl) butyryl (1-oxobutyl) caproyl* (hexanoyl) capryl* (decanoyl) capryloyl* (octanoyl) carbamido (carbamoylamino) carbamoyl (aminocarbonyl) carbamyl (aminocarbonyl) carbazoyl (hydrazinocarbonyl) carbethoxy (ethoxycarbonyl) carbonyl carboxy cetyl* (hexadecyl) chloroformyl (chlorcarbonyl) cinnamoyl cinnamyl (3-phenyl-2-propenyl) cinnamylidene cresyl* (hydroxymethylphenyl) crotonoyl crotyl (2-butenyl)
© 2000 by CRC PRESS LLC
CH3CONHCH3COCH2COCH3COCH2CH3COCH2=CHCOCH3CH(NH2)COH2N(CH2)2COCH2=CHCH2CH2=CHCH= H2NC(=NH)H2NCH3(CH2)4C6H5NHCH3OC6H4NH2-H2NC6H4COAsH2-OC(CH2)7CON3=N-N= -N=N-N(O)=NC6H5CH= C6H5CONH(C6H5)2CHC6H5COOC6H5COC6H5CH2C6H5CH= C6H5C= C6H5C6H5-C6H4-C6H4C4H9OC2H5CH(CH3)O(CH3)3COCH3(CH2)3CH3CH2CH(CH3)(CH3)3CCH3(CH2)2COCH3(CH2)4COCH3(CH2)8COCH3(CH2)6COH2NCONHH2NCOH2NCOH2NNHCOC2H5OCO=C=O HOOCCH3(CH2)15ClCOC6H5CH=CHCOC6H5CH=CHCH2C6H5CH=CHCH= HO(CH3)C6H4CH3CH=CHCOCH3CH=CHCH2-
cyanamido (cyanoamino) cyanato cyano decanedioyl decanoyl diazo diazoamino disilanyl disiloxanyloxy disulfinyl dithio enanthoyl* (heptanoyl) epoxy ethenyl (vinyl) ethynyl ethoxy ethyl ethylene ethylidene ethylthio formamido (formylamino) formyl furmaroyl (from fumaric acid) furfuryl (2-furanylmethyl) furfurylidene (2-furanylmethylene) glutamoyl (from glutamic acid) glutaryl (from glutaric acid) glycylamino glycoloyl; glycolyl (hydroxyacetyl) glycyl (aminoacetyl) glyoxyloyl; glyoxylyl (oxoacetyl) guanidino guanyl (aminoiminomethyl) heptadecanoyl heptanamido heptanedioyl heptanoyl hexadecanoyl hexamethylene (1,6-hexanediyl) hexanedioyl hippuryl (N-benzoylglycyl) hydrazino hydrazo hydrocinnamoyl hydroperoxy hydroxyamino hydroxy imino iodoso* (iodosyl) iodyl isoamyl* (isopentyl; 3-methylbutyl) isobutenyl (2-methyl-1-propenyl) isobutoxy (2-methylpropoxy) isobutyl (2-methylpropyl) isobutylidene (3-methylpropylidene) isobutyryl (2-methyl-1-oxopropyl)
NCNHNCONC-OC(CH2)8COCH3(CH2)8CON2= -NHN=NH3SiSiH2H3SiOSiH2O-S(O)S(O)-SSCH3(CH2)5CO-OCH2=CHHC≡CC2H5OCH3CH2-CH2CH2CH3CH= C2H5SHCONHHCO-OCCH=CHCOOC4H3CH2OC4H3CH= -OC(CH2)2CH(NH2)CO-OC(CH2)3COH2NCH2CONHHOCH2COH2NCH2COHCOCOH2NC(=NH)NHH2NC(=NH)CH3(CH2)15COCH3(CH2)5CONH-OC(CH2)5COCH3(CH2)5COCH3(CH2)14CO-(CH2)6-OC(CH2)4COC6H5CONHCH2COH2NNH-HNNHC6H5(CH2)2COHOOHONHHOHN= OIO2I(CH3)2CH(CH2)2(CH3)2C=CH(CH3)2CHCH2O(CH3)2CHCH2(CH3)2CHCH= (CH3)2CHCO-
ORGANIC SUBSTITUENT GROUPS AND RING SYSTEMS (continued) isocyanato isocyano isohexyl (4-methylpentyl) isoleucyl (from isoleucine) isonitroso* (hydroxyamino) isopentyl (3-methylbutyl) isopentylidene (3-methylbutylidene) isopropenyl (1-methylethenyl) isopropoxy (1-methylethoxy) isopropyl (1-methylethyl) isopropylidene (1-methylethylidene) isothiocyanato (isothiocyano) isovaleryl* (3-methyl-1-oxobutyl) lactoyl (from lactic acid) lauroyl (from lauric acid) lauryl (dodecyl) leucyl (from leucine) levulinoyl (from levulinic acid) malonyl (from malonic acid) mandeloyl (from mandelic acid) mercapto mesityl methacryloyl (from methacrylic acid) methallyl (2-methyl-2-propenyl) methionyl (from methionine) methoxy methyl methylene methylthio myristoyl (from myristic acid) myristyl (tetradecyl) naphthyl naphthylene neopentyl (2,2-dimethylpropyl) nitramino (nitroamino) nitro nitrosamino (nitrosoamino) nitrosimino (nitrosoimino) nitroso nonanoyl (from nonanoic acid) oleoyl (from oleic acid) oxalyl (from oxalic acid) oxo palmitoyl (from palmitic acid) pentamethylene (1,5-pentanediyl) pentyl tert-pentyl phenacyl phenacylidene phenethyl (2-phenylethyl) phenoxy phenyl phenylene (benzenediyl) phosphino* (phosphanyl) phosphinyl* (phosphinoyl) phospho phosphono phthaloyl (from phthalic acid)
© 2000 by CRC PRESS LLC
OCNCN(CH3)2CH(CH2)3C2H5CH(CH3)CH(NH2)COHON= (CH3)2CH(CH2)2(CH3)2CHCH2CH= CH2=C(CH3)(CH3)2CHO(CH3)2CH(CH3)2C= SCN(CH3)2CHCH2COCH3CH(OH)COCH3(CH2)10COCH3(CH2)11(CH3)2CHCH2CH(NH2)COCH3CO(CH2)2CO-OCCH2COC6H5CH(OH)COHS2,4,6-(CH3)3C6H2CH2=C(CH3)COCH2=C(CH3)CH2CH3SCH2CH2CH(NH2)COCH3OH3CH2C= CH3SCH3(CH2)12COCH3(CH2)13(C10H7)-(C10H6)(CH3)3CCH2O2NNHO2NONNHONN= ONCH3(CH2)7COCH3(CH2)7CH=CH(CH2)7CO-OCCOO= CH3(CH2)14CO-(CH2)5CH3(CH2)4CH3CH2C(CH3)2C6H5COCH2C6H5COCH= C6H5CH2CH2C6H5OC6H5-C6H4H2PH2P(O)O2P(HO)2P(O)1,2-C6H4(CO-)2
picryl (2,4,6-trinitrophenyl) pimeloyl (from pimelic acid) piperidino (1-piperidinyl) pivaloyl (from pivalic acid) prenyl (3-methyl-2-butenyl) propargyl (2-propynyl) 1-propenyl 2-propenyl (allyl) propionyl* (propanyl) propoxy propyl propylidene pyrryl (pyrrolyl) salicyloyl (2-hydroxybenzoyl) selenyl* (selanyl; hydroseleno) seryl (from serine) siloxy silyl silylene sorboyl (from sorbic acid) stearoyl (from stearic acid) stearyl (octadecyl) styryl (2-phenylethenyl) suberoyl (from suberic acid) succinyl (from succinic acid) sulfamino (sulfoamino) sulfamoyl (sulfamyl) sulfanilyl [(4-aminophenyl)sulfonyl] sulfeno sulfhydryl (mercapto) sulfinyl sulfo sulfonyl (sulfuryl) terephthaloyl tetramethylene thienyl (from thiophene) thiocarbonyl (carbothionyl) thiocarboxy thiocyanato (thiocyano) thionyl* (sulfinyl) threonyl (from threonine) toluidino [(methylphenyl)amino] toluoyl (methylbenzoyl) tolyl (methylphenyl) α-tolyl (benzyl) tolylene (methylphenylene) tosyl [(4-methylphenyl) sulfonyl)] triazano trimethylene (1,3-propanediyl) trityl (triphenylmethyl) valeryl* (pentanoyl) valyl (from valine) vinyl (ethenyl) vinylidene (ethenylidene) xylidino [(dimethylphenyl)amino] xylyl (dimethylphenyl) xylylene [phenelenebis(methylene)]
2,4,6-(NO2)3C6H2-OC(CH2)5COC5H10N(CH3)3CCO(CH3)2C=CHCH2HC≡CCH2-CH=CHCH2 CH2=CHCH2CH3CH2COCH3CH2CH2OCH3CH2CH2CH3CH2CH= C3H4N2-HOC6H4COHSeHOCH2CH(NH2)COH3SiOH3SiH2Si= CH3CH=CHCH=CHCOCH3(CH2)14COCH3(CH2)17C6H5CH=CH-OC(CH2)6CO-OCCH2CH2COHOSO2NHH2NSO24-H2NC6H4SO2HOSHSOS= HO3S-SO21,4-C6H4(CO-)2 -(CH2)4(C4H3S)=CS HOSCNCS-SOCH3CH(OH)CH(NH2)COCH3C6H4NHCH3C6H4COCH3C6H4C6H5CH2-(CH3C6H3)4-CH3C6H4SO2H2NNHNH-(CH2)3(C6H5)3CCH3(CH2)3CO(CH3)2CHCH(NH2)COCH2=CHCH2=C= (CH3)2C6H3NH(CH3)2C6H3-CH2C6H4CH2-
ORGANIC SUBSTITUENT GROUPS AND RING SYSTEMS (continued) ORGANIC RING COMPOUNDS H 5
1 3
2
1
3
Spiropentane
2
4
2
4
Cyclopropane
1
1
5 4
3
Cyclobutane
N
N
1
5
2 3
4
1
3
4
4
1
H
N 5 4
2
5
3
4
5 4
5
3
4
N
2 3
5
1
Pyrazole (1,2-Diazole)
N 2H-Imidazole (1,3-Diazole)
N 1,2,3-Triazole
N 1,2,4-Triazole
1,2-Dithiole
O
O
S
S
O
O
1
1
1
5
2
N
3
4
3
4
5
3
4
5 4
N
Thiazole (1,3-Thiazole) O 1 5 2O 3
4
N
1,2,3,5-Oxatriazole
2 3
4
N
Oxazole (1,3-Oxazole) O N 5 1 2N
N
1,2,3,4-Oxatriazole
2 3
4
Isoxazole (1,2-Oxazole) O 1 5 2N N
5
N
3H-1,2,3-Dioxazole
1
6
2 3
5
1
6
2 3
5
5
3
Isothiazole (1,2-Thiazole) O 1 5 2O H
5
1
6
2 3
5
1
2N
5
4
3
4
3
4
3
4
3
O
N
1,3,2-Dioxazole
O
1
1
3
2 3
2H-Pyrrole (2H-Azole)
5
1
O 2
5
2S 3
4 S 1,3-Dithiole
3H-1,2-Oxathiole
O
O
N5
2N
1
1
4
1
N 2
5
4
3
4
3
4
3
4
3
2
N N N N 1,2,3-Oxadiazole 1,2,4-Oxadiazole 1,2,5-Oxadiazole 1,3,4-Oxadiazole (Furazan) O O O O 1 1 1 H N 5 1 2S 5 2N H 5 2 5 2
3
4
N
1,2,4-Dioxazole
O 6
2N
5 4
3
3H-Pyrrole (3H-Azole) 1
1
2
S 2S 3
4
N
Pyrrole (Azole)
S
1
N
2 3
2
Thiophene
N
1 2 3
1
H 1 5 4
3
N
1
Furan
N N
2
5
S
Cyclopentane
H
5
2
O
O 2
6
3
5
1
O
1,3,4-Dioxazole
5H-1,2,5-Oxathiazole
O 2
O
6
3
1
5
O 2
6
3
5
1
S
1,3-Oxathiole
O 2O
6
3
5
1
2 3
O
4
4
4
4
4
4
4
4
Benzene
Cyclohexane
2H-Pyran
4H-Pyran
2H-Pyran-2-one (2-Pyrone)
O 4H-Pyran-4-one (4-Pyrone)
1,2-Dioxin
1,3-Dioxin
H N
N
1
1
6 5
2
6 5
3 4
2N
N
N
1
1
6 5
3 4
2 3
4
6 5
N
N 6
2
1
5
3
N 3
4
4
N
N
N
Pyridazine
Pyrimidine
Pyrazine
H Piperazine
O
O
O
O
O
1
1
1
6
2N
5
3
6 5
4
2 3
4
6 5
N
2 3
4
6 5
N
2
1
N
6 5
3 4
6 5
N 1
2 3
4
6 5
N
1 6 5
2
2H-1,3-Oxazine 6H-1,3-Oxazine O O 1 1 N H 2 6 2 6 5
3 4
3
5
4
3
N
4
N
N
1,4-Oxazine
H 4H-1,4-Oxazine
2H-1,2-Oxazine
5
2
2
6 5
3
4
N
1,2,3-Triazine (v-Triazine) O 1 S
3
N
4
2H-1,2-Oxazine O 1 2N 6 5
3 4
1,2,5-Oxathiazine
3
2
6 5
3 4
N
6 5
2N
4
2
6 5
3 4
1,4-Oxazine O 1 N 2S
3
3
1,3,5-Triazine 1,2,4-Triazine (s-Triazine) (as-Triazine) O O 1 1 N H
4
6H-1,2-Oxazine O 1 6 2S
1 6 5
4
N 4H-1,2-Oxazine O
N 2N
N
Pyridine
1
1
2
H 4H-1,4-Oxazine 1,2,5-Oxathiazine O O 1
3
N
4
6 5
3 4
1
2
6 5
N
2 3
4
N
N
1,2,6-Oxathiazine 1,2,4-Oxadiazine 1,3,5-Oxadiazine
Morpholine
H N
O
1
7
2
6
3 5
S
1
7
2
6
4
Azepine
© 2000 by CRC PRESS LLC
3 5
4
Oxepin
N
1
7
2
6
3 5
4
Thiepin
1
7
2
6
N
3 5
4
4H-1,2-Diazepine
1
7 6 5
4
Indene
O 2 3
6 5
7
1
4
2H-Indene (Isoindene)
2 3
6 5
7
1
4
Benzofuran
2 3
6 5
7
1
2O 3
4
Isobenzofuran
ORGANIC SUBSTITUENT GROUPS AND RING SYSTEMS (continued) ORGANIC RING COMPOUNDS (continued) H S 6 5
7
N
1 2
6 5
3
4
Benzo[b]thiophene
1 2S 3
7 4
1
7
6 5
N 2 3
4
Benzo[c]thiophene
1
7
6 5
N 2 3
4
2N 3
3 2
4
3H-Indole
Indole
1
7
6 5
5
4
6 7
1
N Cyclopenta[b]pyridine
1H-Indole
H N 6 5
7
O
1 2N
6 5
3
4
Indazole
O
1 2N
7
3
4
Benzisoxazole (Indoxazine)
3
4
N
Benzoxazole
1 2O 3
7
6 5
7 6
4
2,1-Benzisoxazole
8
1
5
4
2 3
7 6
Naphthalene
O 8 5
O
1 2 3
7 6
4
5
2H-1-Benzopyran (2H-Chromene) 8 5
1
O
2 3
1
8
7 6
4
5
4
2
1
8
7 6
3
5
2O
4
1
8
7 6
3
5
2O 3
4
7 6
O
O
2H-1-Benzopyran-2-one 4H-1-Benzopyran-4-one 1H-2-Benzopyran-1-one 3H-2-Benzopyran-1-one (Coumarin) (Chromen-4-one) (Isocoumarin) (Isochromen-3-one)
N 7 6
O
1
8
N N
2 3
7 6
4
N
N
8
1
5
4
1
8
2 3
5
7 6
N
4
N N
2 3
7 6
8
1
5
4
8
1
7
1
2 3
4
Pyrano[3,4-b]pyrrole
5
4
8
1
5
4
7 6
8
1
5
4
7
3
6
2 3
8
1
5
4
7 6
8
1
5
4
7 6
N
8
1
5
4
3
2N 3
Isoquinoline
N 2 3
2
Octahydronaphthalene (Decalin)
Quinoline
N 2 3
2
1,2,3,4-Tetrahydronaphthalene (Tetralin) N
O 7 6
6 5
N
1 2
7
6 5
O
O 2 3
7 6
8
1
5
4
2 3
N
N Cinnoline
Quinazoline
1,8-Naphtyridine
1,7-Naphtyridine
1,5-Naphtyridine
O 7 6
8
1
5
4
1,6-Naphtyridine
O 2 3
7 6
8
1
5
4
O
2 3
6 7
N
5
4
8
1
O
3 2
N
7 6
8
1
5
4
1H-2,3-Benzoxazine
7 6
8
1
5
4 3
N
4H-3,1-Benzoxazine
3 2
4
N H
2 3
N
2H-1,4-Benzoxazine
O
N H
2H-1,2-Benzoxazine
1
2
4H-1,4-Benzoxazine
3
1 7 6
5
1
9
8
6 7
2 3
10
4
Anthracene
5 8
9
4
9 8
10
7
Phenanthrene
9
8
7 6
6 5
1 2 3
5
Phenalene
4
Fluorene
H N
N 7 6
9
8
1 2 3
5
7 6
4
1
9
8 5
5 2 3
10
4
6 7
10
8
9
O Carbazole
Xanthene
Acridine R´´
4 1
3 2
3 4
2 1 5
R
N N
1 2
6 3
5
7
4
N 7H-Purine
© 2000 by CRC PRESS LLC
H
N
14 8 H H 7
10
2 3 4
17
16 15
9
1 8 9
11
12 13
5
6
H
Steroid ring system
7 6
Norpinane (Bicyclo[3.1.1]heptane)
R´
H
2
R = Nearly always methyl R´ = Usually methyl R´´ = Various groups
2H-1,3-Benzoxazine
SCIENTIFIC ABBREVIATIONS AND SYMBOLS This table lists some symbols, abbreviations, and acronyms encountered in the physical sciences. Most entries in italic type are symbols for physical quantities; for more details on these, see the table “Symbols and Terminology for Physical and Chemical Quantities” in this section. Additional information on units may be found in the table “International System of Units” in Section 1. Many of the terms to which these abbreviations refer are included in the tables “Definitions of Scientific Terms” in Section 2 and “Techniques for Materials Characterization” in Section 12. Publication practices vary with regard to the use of capital or lower case letters for many abbreviations. An effort has been made to follow the most common practices in this table, but much variation is found in the literature. Likewise, policies on the use of periods in an abbreviation vary considerably. Periods are generally omitted in this table unless they are necessary for clarity. Periods should never appear in SI units. The SI prefixes (m, k ,M, etc.) are not listed here, since they should never be used alone, but selected combinations with SI units (e.g., mg, kV, MW) are included. Abbreviations are listed in alphabetical order without regard to case. Entries beginning with Greek letters fall at the end of the table. a a0 A Å A AH Ar AAS Abe abs ac Ac AcOH ACT ACTH Ade ADP ads ae AES AF AFM AI AIM Al Ala alc aliph. alk. All Alt am Am AM AMP amu anh, anhyd antilog AO AOM Api APS APW aq Ar Ara Ara-ol Arg
absorption coefficient, acceleration, activity Bohr radius ampere, adenine (in genetic code) ångstrom absorbance, area, Helmholtz energy, mass number Hall coefficient atomic weight (relative atomic mass) atomic absorption spectroscopy abequose absolute alternating current acetyl acetic acid activated complex theory adrenocorticotropic hormone adenine adenosine diphosphate adsorption eon (109 years) atomic emission spectroscopy, Auger electron spectroscopy audio frequency atomic force microscopy artificial intelligence atoms in molecules Alfen number alanine alcohol aliphatic alkaline allose altrose amorphous solid amyl amplitude modulation adenosine 5'-monophosphate atomic mass unit (recommended symbol is u) anhydrous antilogarithm atomic orbital angular overlap model apiose appearance potential spectroscopy augmented plane wave aqueous aryl arabinose arabinitol arginine
as, asym ASCII ASE Asn Asp at atm ATP ATR at.wt. AU av avdp b B bar bbl bcc BCS BDE Bé BET BeV Bhn Bi BN BNS BO BOD bp bpy Bq BRE BSSE Btu bu Bu Bz Bzl c c c0 C °C C ca. cal
2-29
asymmetrical (as chemical descriptor) American National Standard Code for Information Interchange aromatic stabilization energy asparagine aspartic acid atomization standard atmosphere adenosine 5'-triphosphate attenuated total internal reflection atomic weight astronomical unit average avoirdupois barn magnetic flux density, second virial coefficient, susceptance bar (pressure unit) barrel body centered cubic Bardeen-Cooper-Schrieffer (theory) bond dissociation energy Baumé Brunauer-Emmett-Teller (method) billion electronvolt Brinell hardness number biot bond number nuclear backscattering spectroscopy bond order, Born-Oppenheimer (approximation) biochemical oxygen demand boiling point 2,2'-bipyridine becquerel bond resonance energy basis set superposition error British thermal unit bushel butyl benzoyl benzyl combustion reaction amount concentration, specific heat, velocity speed of light in vacuum coulomb, cytosine (in genetic code) degree Celsius capacitance, heat capacity, number concentration approximately calorie
SCIENTIFIC ABBREVIATIONS AND SYMBOLS (continued) calc CARS CAS RN CAT CBS cc CCD cd c.d. CD CDP CEPA cf. cfm cgs CHF Ci CI CIDEP CIDNP cir CKFF CL cm c.m. c.m.c. CMO CMP CN CNDO Co COD conc const cos cosh COSY cot coth cp cP Cp CP CPA cpd cps CPT CPU cr, cryst CRU csc ct CT CTEM CTP CTR cu CV CVD cw
calculated coherent anti-Stokes Raman spectroscopy Chemical Abstracts Service Registry Number clear-air turbulence, computerized axial tomography complete basis set cubic centimeter charge-coupled device candela, condensed phase current density circular dichroism cytidine 5'-diphosphate couplet electron pair approximation compare cubic feet per minute centimeter-gram-second system coupled Hartree-Fock (method) curie configuration interaction, chemical ionization chemically induced dynamic electron polarization chemically induced dynamic nuclear polarization circular Cotton-Kraihanzel force field cathode luminescence centimeter center of mass critical micelle concentration canonical molecular orbital cytidine 5'-monophosphate coordination number complete neglect of differential overlap Cowling number chemical oxygen demand concentrated, concentration constant cosine hyperbolic cosine correlation spectroscopy (in NMR) cotangent hyperbolic cotangent candle power centipoise cyclopentadienyl chemically pure coherent potential approximation contact potential difference cycles per second charge conjugation-space inversion-time reversal (theorem) central processing unit crystalline (phase) constitutional repeating unit cosecant carat charge transfer conventional transmission electron microscopy cytidine 5'-triphosphate controlled thermonuclear reaction cubic cyclic voltammetry chemical vapor deposition continuous wave
cwt Cy cyl Cys d d D D
hundredweight (112 pounds) cyclohexyl cylinder cysteine day, deuteron distance, density, dextrorotatory debye unit diffusion coefficient, dissociation energy, electric displacement Da dalton DA donor-acceptor (complex) dB decibel dc direct current DE delocalization energy dec decomposes deg degree den density det determinant dev deviation DFT density functional theory diam diameter dil dilute, dilution DIM diatomics in molecules dm decimeter dmf, DMF N,N-dimethylformamide dmso, DMSO dimethylsulfoxide DNA deoxyribonucleic acid DNase deoxyribonuclease DNMR dynamic nuclear magnetic resonance DOS density of states doz dozen d.p. degree of polymerization dpl displacement dpm disintegrations per minute dps disintegrations per second dr dram dRib 2-deoxyribose DRIFT diffuse reflectance infrared Fourier transform DRS diffuse reflectance spectroscopy DSC differential scanning calorimetry DTA differential thermal analysis dyn dyne e electron, base of natural logarithms e elementary charge, linear strain E electric field strength, electromotive force, energy, modulus of elasticity, entgegen (trans configuration) Eh Hartree energy EA electron affinity EAN effective atomic number ECP effective core potential ECR electron cyclotron resonance ED electron diffraction, effective dose EDS energy dispersive X-ray spectroscopy EDTA ethylenediaminetetraacetic acid EELS electron energy loss spectroscopy EFFF energy factored force field EHMO extended Hückel molecular orbital EHT extended Hückel theory emf electromotive force emu electromagnetic unit system en ethylenediamine
2-30
SCIENTIFIC ABBREVIATIONS AND SYMBOLS (continued) ENDOR EOS EPMA EPR eq, eqn eqQ erf erg ESCA e.s.d. ESD ESR est esu Et ET Et2O e.u. Eu eV EWG EXAFS EXELFS exp expt ext f f F °F F FAD fcc FEL FEM FEMO FET fid FIM FIR fl FM Fo fp fpm fps Fr Fr Fru FSGO ft ft-lb FT FTIR Fuc Fuc-ol fus g g
electron-nuclear double resonance equation of state electron probe microanalysis electron paramagnetic (spin) resonance equation quadrupole coupling constant error function erg electron spectroscopy for chemical analysis estimated standard deviation electron stimulated desorption electron spin resonance estimate, estimated electrostatic unit system ethyl electron transfer, ephemeris time diethyl ether entropy unit Euler number electronvolt electron withdrawing group extended x-ray absorption fine structure extended energy loss fine structure exponential function experimental external formation reaction activity coefficient, aperture ratio, focal length, force constant, frequency, fugacity farad degree Fahrenheit Faraday constant, force, angular momentum flavin adenine dinucleotide face centered cubic free electron laser field emission microscopy free electron molecular orbital field effect transistor free induction decay field ion microscopy far infrared fluid (phase) frequency modulation Fourier number freezing point feet per minute feet per second, foot-pound-second system franklin Froude number fructose floating spherical Gaussian orbitaì foot foot pound Fourier transform Fourier transform infrared spectroscopy fucose fucitol fusion (melting) gram, gas acceleration due to gravity, degeneracy, statistical weight, Landé g-factor
G G gal Gal GalN GC GC-MS GDMS gem GeV GIAO gl GLC Glc GlcN Glc-ol Gln Glu Gly GMP GMT gpm gps gr Gr GTO Gua Gul GUT GVB GWS Gy h h H H H0 ha Ha Hacac HAM hav Hb hcp Hea HEIS HEP HF hfs Him His HMO HOMO hp HPLC Hpz hr HREELS HREM HSAB
2-31
gauss, guanine (in genetic code) electrical conductance, Gibbs energy, gravitational constant, sheer modulus gallon gal, galileo, galactose galactosamine gas chromatography gas chromatography-mass spectrometry glow discharge mass spectroscopy geminal (on the same carbon atom) gigaelectronvolt gauge invariant atomic orbital glacial gas-liquid chromatography glucose glucosamine glucitol glutamine glutamic acid glycine guanosine 5'-triphosphate Greenwich mean time gallons per minute gallons per second grain Grashof number gaussian type atomic orbital guanine gulose grand unified theory generalized valence bond Glashow-Weinberg-Salam (theory) gray, gigayear helion, hour Planck constant henry enthalpy, Hamiltonian function, magnetic field Hubble constant hectare Hartmann number acetylacetone hydrogenic atoms in molecules haversine hemoglobin hexagonal closed packed ethanolamine high energy ion scattering high energy physics high frequency hyperfine structure imidazole histidine Hückel molecular orbital highest occupied molecular orbital horsepower high-performance liquid chromatography pyrazole hour high resolution electron energy loss spectroscopy high resolution electron microscopy hard-soft acid-base (theory)
SCIENTIFIC ABBREVIATIONS AND SYMBOLS (continued) HSE Hz i I IAT i-Bu IC ICP ICR id ID Ido IDP IE i.e.p. IEPA IF IGLO Ile Im imm IMPATT in. INDO INS int I/O IP IPN i-Pr IPR IPTS IR IRAS IRC isc ISE ISS ITP ITS IU j J J k K K kb kcal KE keV kg kgf kJ km Kn
homodesmotic stabilization energy hertz square root of minus one electric current, ionic strength, moment of inertia, nuclear spin angular momentum, radiant intensity international atomic time isobutyl integrated circuit inductively coupled plasma ion cyclotron resonance ideal (solution) inside diameter idose inosine 5'-diphosphate ionization energy isoelectric point independent electron pair approximation intermediate frequency individual gauge for localized orbitals isoleucine imaginary part immersion impact ionization avalanche transit time inch intermediate neglect of differential overlap inelastic neutron scattering, ion neutralization spectroscopy internal input/output ionization potential interpenetrating polymer network isopropyl isotopic perturbation of resonance International Practical Temperature Scale infrared reflection-absorption infrared spectroscopy intrinsic reaction coordinate intersystem crossing isodesmic stabilization energy ion scattering spectroscopy inosine 5'-triphosphate International Temperature Scale (1990) international unit angular momentum, electric current density joule angular momentum, electric current density, flux, Massieu function absorption index, Boltzmann constant, rate constant, thermal conductivity, wave vector kelvin absorption coefficient, bulk modulus, equilibrium constant, kinetic energy kilobar, kilobase (DNA or RNA) kilocalorie kinetic energy kiloelectronvolt kilogram kilogram force kilojoule kilometer Knudsen number
kPa kt kV kva kW kwh l l L L lat. lb lbf lc LC LCAO LD Le LED LEED LEIS Leu LFER lim LIMS liq lm ln LNDO log long. LST LT LTE LUMO lut lx ly l.y. Lys Lyx m m M M Mr Ma Man MASNMR max MBE MBPT MC MCD MCPF MCSCF
2-32
kilopascal karat kilovolt kilovolt ampere kilowatt kilowatt hour liquid, liter angular momentum, length, levorotatory liter, lambert Avogadro constant, inductance, Lagrange function latitude pound pound force liquid crystal liquid chromatography linear combination of atomic orbitals lethal dose Lewis function light emitting diode low-energy electron diffraction low energy ion scattering leucine linear free energy relationship limit laser ionization mass spectroscopy, laboratory information management system liquid lumen logarithm (natural) local neglect of differential overlap logarithm (common) longitude local sidereal time local time local thermodynamic equilibrium lowest unoccupied molecular orbital lutidine lux langley light year lysine lyxose meter, molal (as in 0.1 m solution), metastable (isotope) magnetic dipole moment, mass, molality, angular momentum component, meta (as chemical descriptor) molar (as in 0.1 M solution), metal (in chemical formulas) magnetization, molar mass, mutual inductance, torque, angular momentum component molecular weight (relative molar mass) Mach number mannose magic angle spinning nuclear magnetic resonance maximum molecular beam epitaxy many body perturbation theory Monte Carlo (method) magnetic circular dichroism modified couple pair functional multi-configurational self-consistent field
SCIENTIFIC ABBREVIATIONS AND SYMBOLS (continued) MD Me MEP MERP Mes MESFET Met meV MeV MF mg MHD mi MIM min MINDO MIR misc MKS MKSA mL, ml mm MM mmf mmHg MO mol mol.wt. mon MOS MOSFET mp MPa MPA Mpc MRI mRNA ms MS MSL Mur mV mW MW Mx n n
N N NA NE NAA NAD NADH NADP NAO NBO nbp Neu
molecular dynamics methyl molecular electrostatic potential minimum energy reaction path mesityl metal-semiconductor field-effect transistor methionine millielectronvolt megaelectronvolt molecular formula milligram magnetohydrodynamics mile molecules-in-molecules minimum, minute modified intermediate neglect of differential overlap mid-infrared miscible meter-kilogram-second system meter-kilogram-second-ampere system milliliter millimeter molecular mechanics magnetomotive force millimeter of mercury molecular orbital mole molecular weight monomeric form metal-oxide semiconductor metal-oxide semiconductor field-effect transistor melting point megapascal Mulliken population analysis megaparsec magnetic resonance imaging messenger RNA millisecond mass spectroscopy mean sea level muramic acid millivolt milliwatt megawatt, microwave, molecular weight maxwell neutron amount of substance, number density, principal quantum number, refractive index, normal (in chemical formulas) newton angular momentum, neutron number Avogadro constant density of states neutron activation analysis nicotinamide adenine dinucleotide reduced NAD nicotinamide adenine dinucleotide phosphate natural atomic orbital natural bond order normal boiling point neuraminic acid
NEXAFS ng NIR nm NMR NNDO NO NOE NPA NQR NRA ns NTP Nu Nu o obs, obsd OD Oe ORD oz p p P P Pa PA PAS pc PCR PD pdl pe Pe PES PET peth pf pg pH Ph Phe pI pip pK pm PMO PNDO PNRA pol ppb ppm PPP ppt Pr Pr PRDDO Pro ps PS
2-33
near-edge x-ray absorption fine structure nanogram near infrared nanometer nuclear magnetic resonance neglect of nonbonded differential overlap natural orbital nuclear Overhauser effect natural population analysis nuclear quadrupole resonance prompt nuclear reaction analysis nanosecond normal temperature and pressure nucleophile Nusselt number ortho (as chemical descriptor) observed optical density, outside diameter oersted optical rotatory dispersion ounce proton dielectric polarization, electric dipole moment, momentum, pressure, para (as chemical descriptor) poise power, pressure, probability, sound energy flux pascal proton affinity photoacoustic spectroscopy parsec polymerase chain reaction potential difference poundal probable error Péclet number photoelectron spectroscopy positron emission tomography petroleum ether power factor picogram negative log of hydrogen ion concentration phenyl phenylalanine isoelectric point piperidine negative log of ionization constant picometer perturbational molecular orbital partial neglect of differential overlap prompt nuclear reaction analysis polymeric form parts per billion parts per million Pariser-Parr-Pople (method) parts per thousand, precipitate propyl Prandtl number partial retention of diatomic differential overlap proline picosecond photoelectron spectroscopy
SCIENTIFIC ABBREVIATIONS AND SYMBOLS (continued) PSD Psi psi psia psig pt PVT py q Q QCD QED Q.E.D. QSAR QSO qt quad Qui q.v. r r R °R R RA rad RAIRS RAM RBS RE Re RED REM rem RF Rha RHEED RHF RIA Rib Ribulo rms RNA RNase rRNA ROHF ROM RPA rpm rps RRK RRKM RRS RS Ry s s
photon stimulated desorption psicose pounds per square inch pounds per square inch absolute pounds per square inch gage pint pressure-volume-temperature pyridine electric field gradient, flow rate, heat, wave vector (phonons) electric charge, heat, partition function, quadrupole moment, radiant energy, vibrational normal coordinate quantum chromodynamics quantum electrodynamics quod erat demonstrandum (which was to be proved) quantitative structure-activity relationship quasi-stellar object (quasar) quart quadrillion Btu (= 1.0551018 J) quinovose quod vide (which you should see) reaction position vector, radius roentgen, alkyl radical (in chemical formulas) degree Rankine electrical resistance, gas constant, molar refraction, Rydberg constant right ascension radian reflection-absorption infrared spectroscopy random access memory Rutherford backscattering spectroscopy resonance energy real part radial electron distribution reflection electron microscopy roentgen equivalent man radiofrequency rhamnose reflection high-energy electron diffraction restricted Hartree-Fock (theory) radioimmunoassay ribose ribulose root mean square ribonucleic acid ribonuclease ribosomal RNA restricted open shell Hartree-Fock read only memory random phase approximation revolutions per minute revolutions per second Rice-Ramsperger-Kassel (theory) Rice-Ramsperger-Kassel-Marcus (theory) resonance Raman spectroscopy Raman spectroscopy rydberg second, solid path length, solubility, spin angular momentum, symmetry number, symmetrical (as stereochemical descriptor)
S S SALC SALI SAM SANS Sar sat, satd SAXS s-Bu Sc SCE SCF SCR sd sec sec SEELFS SEM sepn Ser SERS SET SEXAFS Sh SI SIMS sin SINDO sinh SIPN SLAM sln SMO SMOW SNMS SNU SO sol soln SOMO Sor sp gr SPM sq sr Sr SSMS St St std, stnd STEM STM STO STP sub Sv t t T
2-34
siemens area, entropy, probability current density, Poynting vector, symmetry coordinate, spin angular momentum symmetry adapted linear combinations surface analysis by laser ionization scanning Auger microscopy small angle neutron scattering sarcosine saturated small angle x-ray scattering sec-butyl Schmidt number saturated calomel electrode self-consistent field silicon-controlled rectifier standard deviation secant, second secondary (in chemical name) surface sensitive energy loss fine structure scanning electron microscope separation serine surface-enhanced Raman spectroscopy single electron transfer surface extended x-ray absorption fine structure Sherwood number International System of Units secondary ion mass spectroscopy sine symmetrically orthogonalized INDO method hyperbolic sine semi-interpenetrating polymer network scanning laser acoustic microscopy solution semiempirical molecular orbital Standard Mean Ocean Water sputtered neutral mass spectroscopy solar neutrino unit spin orbital soluble, solution solution singly occupied molecular orbital sorbose specific gravity scanned probe microscopy square steradian Strouhal number spark source mass spectroscopy stoke Stanton number standard (state) scanning transmission electron microscope scanning tunneling microscopy Slater type orbital standard temperature and pressure sublimation, sublimes sievert metric tonne, triton Celsius temperature, thickness, time, transport number tesla
SCIENTIFIC ABBREVIATIONS AND SYMBOLS (continued) T Tag Tal tan tanh t-Bu TCA TCE tcne TCSCF TE TED TEM temp tert TFD TGA theor thf, THF Thr Thy TL TLC TM Tol Torr tRNA Trp trs TS tsp Tyr u u U U UDP UHF UMP uns, unsym UPES UPS ur Ura USP UT UTP UV v V V Val vap VB VCD VHF
kinetic energy, period, term value, temperature (thermodynamic), torque, transmittance tagatose talose tangent hyperbolic tangent tert-butyl trichloroacetic acid trichloroethylene tetracyanoethylene two configuration self-consistent field transverse electric transmission electron diffraction, transferred electron device transmission electron microscopy, transverse electromagnetic temperature tertiary (in chemical name) Thomas-Fermi-Dirac (method) thermo-gravimetric analysis theoretical tetrahydrofuran threonine thymine thermoluminescence thin-layer chromatography transverse magnetic tolyl torr transfer RNA tryptophan transition transition state teaspoon tyrosine unified atomic mass unit Bloch function, electric mobility, velocity uracil (in genetic code) electric potential difference, internal energy uridine 5'-diphosphate ultrahigh frequency, unrestricted Hartree-Fock (theory) uridine 5'-monophosphate unsymmetrical (as chemical descriptor) ultraviolet photoelectron spectroscopy ultraviolet photoelectron spectroscopy urea uracil United States Pharmacopeia universal time uridine 5'-triphosphate ultraviolet reaction rate, specific volume, velocity, vibrational quantum number, vicinal (as chemical descriptor) volt electric potential, potential energy, volume valine vaporization valence band, valence bond vibrational circular dichroism very high frequency
vic VIS vit VSEPR VSLI VUV v/v w W W WAXS Wb We WKB wt w/v w/w x X X XAFS XANES XPES XPS XRD XRF XRS Xyl y, yr Y yd z Z
ZDO ZPE, ZPVE ZULU α α β γ γ Γ δ ∆ ε η θ Θ
2-35
vicinal (on adjacent carbon atoms) visible region of the spectrum vitreous valence shell electron pair repulsion very large scale integrated (circuit) vacuum ultraviolet volume per volume (volume of solute divided by volume of solution, expressed as percent) energy density, mass fraction, velocity, work watt radiant energy, statistical weight, work wide angle x-ray scattering weber Weber number Wentzel-Kramers-Brillouin (method) weight weight per volume (mass of solute divided by volume of solution, generally expressed as g/100 mL) weight per weight (mass of solute divided by mass of solution, expressed as percent) mole fraction X unit, halogen (in chemical formula) reactance x-ray absorption fine structure x-ray absorption near-edge structure x-ray photoelectron spectroscopy x-ray photoelectron spectroscopy x-ray diffraction x-ray fluorescence x-ray spectroscopy xylose year admittance, Planck function, Young’s modulus yard charge number (of an ion), collision frequency factor atomic number, compression factor, collision number, impedance, partition function, zusammen (cis configuration) zero differential overlap zero point vibrational energy Greenwich mean time alpha particle absorption coefficient, degree of dissociation, electric polarizability, expansion coefficient, fine structure constant beta particle photon activity coefficient, conductivity, magnetogyric ratio, mass concentration, ratio of heat capacities, surface tension Gruneisin parameter, level width, surface concentration chemical shift, Dirac delta function, Kronecker delta, loss angle inertia defect, mass defect emittance, Levi-Civita symbol, linear strain, molar absorption coefficient, permittivity overpotential, viscosity Bragg angle, temperature, scattering angle, surface coverage quadrupole moment
SCIENTIFIC ABBREVIATIONS AND SYMBOLS (continued) κ λ Λ µ µ
µF µg µm µs ν νe π Π
compressibility, conductivity, magnetic susceptibility, molar absorption coefficient, transmission coefficient absolute activity, radioactive decay constant, thermal conductivity, wavelength angular momentum, ionic conductivity muon chemical potential, electric dipole moment, electric mobility, friction coefficient, Joule-Thompson coefficient, magnetic dipole moment, mobility, permeability microfarad microgram micrometer microsecond frequency, kinematic velocity, stoichiometric number, wavenumber neutrino pion osmotic pressure, Peltier coefficient
ρ σ τ φ Φ χ χe ψ ω Ω Ω
2-36
density, reflectance, resistivity electrical conductivity, cross section, normal stress, shielding constant (NMR), Stefan-Boltzmann constant, surface tension transmittance, chemical shift, shear stress, relaxation time electrical potential, fugacity coefficient, osmotic coefficient, quantum yield, volume fraction, wavefunction magnetic flux, potential energy, radiant power, work function magnetic susceptibility, electronegativity electric susceptibility wavefunction circular frequency, angular velocity, harmonic vibration wavenumber, statistical weight ohm axial angular momentum, solid angle
DEFINITIONS OF SCIENTIFIC TERMS Brief definitions of selected terms of importance in chemistry, physics, and related fields of science are given in this section. The selection process emphasizes the following types of terms: • Physical quantities • Units of measure • Classes of chemical compounds and materials • Important theories, laws, and basic concepts. Individual chemical compounds are not included. Definitions have taken wherever possible from the recommendations of international or national bodies, especially the International Union of Pure and Applied Chemistry (IUPAC) and International Organization for Standardization (ISO). For physical quantities and units, the recommended symbol is also given. The source of such definitions is indicated by the reference number in brackets following the definition. In many cases these official definitions have been edited in the interest of stylistic consistency and economy of space. The user is referred to the original source for further details. * An asterisk following a term indicates that further information can be found by consulting the index of this handbook under the entry for that term. REFERENCES 1. ISO Standards Handbook 2, Units of Measurement, International Organization for Standardization, Geneva, 1992. 2. Quantities, Units, and Symbols in Physical Chemistry, Second Edition, International Union of Pure and Applied Chemistry, Blackwell Scientific Publications, Oxford, 1993. 3. Compendium of Chemical Terminology, International Union of Pure and Applied Chemistry, Blackwell Scientific Publications, Oxford, 1987. 4. A Guide to IUPAC Nomenclature of Organic Compounds, International Union of Pure and Applied Chemistry, Blackwell Scientific Publications, Oxford, 1993. 5. Glossary of Class Names of Organic Compounds and Reactive Intermediates Based on Structure, Pure and Applied Chemistry, 67, 1307, 1995. 6. Compendium of Analytical Nomenclature, International Union of Pure and Applied Chemistry, Blackwell Scientific Publications, Oxford, 1987. 7. Nomenclature of Inorganic Chemistry, International Union of Pure and Applied Chemistry, Blackwell Scientific Publications, Oxford, 1990. 8. Glossary of Basic Terms in Polymer Science, Pure and Applied Chemistry, 68, 2287, 1996. 9. The International Temperature Scale of 1990, Metrologia, 27, 107, 1990. 10. Compilation of ASTM Standard Definitions, American Society of Testing and Materials, Philadelphia, 1990. 11. ASM Metals Reference Book, American Society for Metals, Metals Park, OH, 1983.
Ab initio method - An approach to quantum-mechanical calculations on molecules which starts with the Schrödinger equation and carries out a complete integration, without introducing empirical factors derived from experimental measurement. Absorbance (A) - Defined as -log(1-α) = log(1/τ), where α is the absorptance and τ the transmittance of a medium through which a light beam passes. [2] Absorbed dose (D) - For any ionizing radiation, the mean energy imparted to an element of irradiated matter divided by the mass of that element. [1] Absorptance (α) - Ratio of the radiant or luminous flux in a given spectral interval absorbed in a medium to that of the incident radiation. Also called absorption factor. [1] Absorption coefficient (a) - The relative decrease in the intensity of a collimated beam of electromagnetic radiation, as a result of absorption by a medium, during traversal of an infinitesimal layer of the medium, divided by the length traversed. [1] Absorption coefficient, molar (ε) - Absorption coefficient divided by amount-of-substance concentration of the absorbing material in the sample solution (ε = a/c). The SI unit is m2/mol. Also called extinction coefficient, but usually in units of mol-1dm3cm-1. [2] Acceleration - Rate of change of velocity with respect to time. Acceleration due to gravity (g)* - The standard value (9.80665 m/s2) of the acceleration experienced by a body in the earth’s gravitational field. [1] Acenes - Polycyclic aromatic hydrocarbons consisting of fused benzene rings in a rectilinear arrangement. [5]
Acid - Historically, a substance that yields an H+ ion when it dissociates in solution, resulting in a pH1) and their intramolecular hemiacetals. [5] Aldoximes - Oximes of aldehydes: RCH=NOH. [5] Alfvén number (Al) - A dimensionless quantity used in plasma physics, defined by Al = v(ρµ)1/2/B, where ρ is density, v is velocity, µ is permeability, and B is magnetic flux density. [2] Alfven waves - Very low frequency waves which can exist in a plasma in the presence of a uniform magnetic field. Also called magnetohydrodynamic waves. Alicyclic compounds - Aliphatic compounds having a carbocyclic ring structure which may be saturated or unsaturated, but may not be a benzenoid or other aromatic system. [5] Aliphatic compounds - Acyclic or cyclic, saturated or unsaturated carbon compounds, excluding aromatic compounds. [5] Alkali metals - The elements lithium, sodium, potassium, rubidium, cesium, and francium. Alkaline earth metals - The elements calcium, strontium, barium, and radium. [7] Alkaloids - Basic nitrogen compounds (mostly heterocyclic) occurring mostly in the plant kingdom (but not excluding those of animal origin). Amino acids, peptides, proteins, nucleotides, nucleic acids, and amino sugars are not normally regarded as alkaloids. [5] Alkanes - Acyclic branched or unbranched hydrocarbons having the general formula CnH2n+2, and therefore consisting entirely of hydrogen atoms and saturated carbon atoms. [5] Alkenes - Acyclic branched or unbranched hydrocarbons having one carbon-carbon double bond and the general formula CnH2n. Acyclic branched or unbranched hydrocarbons having more than one double bond are alkadienes, alkatrienes, etc. [5] Alkoxides - Compounds, ROM, derivatives of alcohols, ROH, in which R is saturated at the site of its attachment to oxygen and M is a metal or other cationic species. [5] Alkyl groups - Univalent groups derived from alkanes by removal of a hydrogen atom from any carbon atom: CnH2n+1-. The groups derived by removal of a hydrogen atom from a terminal carbon atom of unbranched alkanes form a subclass of normal alkyl (n-alkyl) groups. The groups RCH2-, R2CH-, and R3C- (R not equal to H) are primary, secondary, and tertiary alkyl groups, respectively. [5] Alkynes - Acyclic branched or unbranched hydrocarbons having a carbon-carbon triple bond and the general formula CnH2n-2, RC≡CR′.
Acyclic branched or unbranched hydrocarbons having more than one triple bond are known as alkadiynes, alkatriynes, etc. [5] Allotropy - The occurrence of an element in two or more crystalline forms. Allylic groups - The group CH2=CHCH2- (allyl) and derivatives formed by substitution. The term ‘allylic position’ or ‘allylic site’ refers to the saturated carbon atom. A group, such as -OH, attached at an allylic site is sometimes described as “allylic”. [5] Amagat volume unit - A non-SI unit previously used in high pressure science. It is defined as the molar volume of a real gas at one atmosphere pressure and 273.15 K. The approximate value is 22.4 L/ mol. Amides - Derivatives of oxoacids R(C=O)(OH) in which the hydroxy group has been replaced by an amino or substituted amino group. [5] Amine oxides - Compounds derived from tertiary amines by the attachment of one oxygen atom to the nitrogen atom: R3N+-O-. By extension the term includes the analogous derivatives of primary and secondary amines. [5] Amines - Compounds formally derived from ammonia by replacing one, two, or three hydrogen atoms by hydrocarbyl groups, and having the general structures RNH2 (primary amines), R2NH (secondary amines), R3N (tertiary amines). [5] Amino acids* - Compounds containing both a carboxylic acid group (-COOH) and an amino group (-NH2). The most important are the αamino acids, in which the -NH2 group in attached to the C atom adjacent to the -COOH group. In the ß-amino acids, there is an intervening carbon atom. [4] Ampere (A)* - The SI base unit of electric current. [1] Ampere’s law - The defining equation for the magnetic induction B, viz., dF = Idl × B, where dF is the force produced by a current I flowing in an element of the conductor dl pointing in the direction of the current. Ångström (Å) - A unit of length used in spectroscopy, crystallography, and molecular structure, equal to 10-10 m. Angular momentum (L) - The angular momentum of a particle about a point is the vector product of the radius vector from this point to the particle and the momentum of the particle; i.e., L = r × p. [1] Angular velocity (ω) - The angle through which a body rotates per unit time. Anilides - Compounds derived from oxoacids R(C=O)(OH) by replacing the -OH group by the -NHPh group or derivative formed by ring substitution. Also used for salts formed by replacement of a nitrogenbound hydrogen of aniline by a metal. [5] Anion - A negatively charged atomic or molecular particle. Antiferroelectricity* - An effect analogous to antiferromagnetism in which electric dipoles in a crystal are ordered in two sublattices that are polarized in opposite directions, leading to zero net polarization. The effect vanishes above a critical temperature. Antiferromagnetism* - A type of magnetism in which the magnetic moments of atoms in a solid are ordered into two antiparallel aligned sublattices. Antiferromagnets are characterized by a zero or small positive magnetic susceptibility. The susceptibility increases with temperature up to a critical value, the Néel temperature, above which the material becomes paramagnetic. Antiparticle - A particle having the same mass as a given elementary particle and a charge equal in magnitude but opposite in sign. Appearance potential* - The lowest energy which must be imparted to the parent molecule to cause it to produce a particular specified parent ion. This energy, usually stated in eV, may be imparted by electron impact, photon impact, or in other ways. More properly called appearance energy. [3] Appearance potential spectroscopy (APS) - See Techniques for Materials Characterization, page 12-1. Are (a) - A unit of area equal to 100 m2. [1]
2-39
DEFINITIONS OF SCIENTIFIC TERMS (continued) Arenes - Monocyclic and polycyclic aromatic hydrocarbons. See aromatic compounds. [5] Aromatic compounds - Compounds whose structure includes a cyclic delocalized π-electron system. Historical use of the term implies a ring containing only carbon (e.g., benzene, naphthalene), but it is often generalized to include heterocyclic structures such as pyridine and thiophene. [5] Arrhenius equation - A key equation in chemical kinetics which expresses the rate constant k as k = Aexp(-Ea/RT), where Ea is the activation energy, R the molar gas constant, and T the temperature. A is called the preexponential factor and, for simple gas phase reactions, may be identified with the collision frequency. Arsines - AsH3 and compounds derived from it by substituting one, two or three hydrogen atoms by hydrocarbyl groups. RAsH2, R2AsH, R3As (R not equal to H) are called primary, secondary and tertiary arsines, respectively. [5] Aryl groups - Groups derived from arenes by removal of a hydrogen atom from a ring carbon atom. Groups similarly derived from heteroarenes are sometimes subsumed in this definition. [5] Astronomical unit (AU)* - The mean distance of the earth from the sun, equal to 1.49597870 × 1011 m. Atomic absorption spectroscopy (AAS) - See Techniques for Materials Characterization, page 12-1. Atomic emission spectroscopy (AES) - See Techniques for Materials Characterization, page 12-1. Atomic force microscopy (AFM) - See Techniques for Materials Characterization, page 12-1. Atomic mass* - The mass of a nuclide, normally expressed in unified atomic mass units (u). Atomic mass unit (u)* - A unit of mass used in atomic, molecular, and nuclear science, defined as the mass of one atom of 12C divided by 12. Its approximate value is 1.66054 × 10-27 kg. Also called the unified atomic mass unit. [1] Atomic number (Z) - A characteristic property of an element, equal to the number of protons in the nucleus. Atomic weight (Ar)* - The ratio of the average mass per atom of an element to 1/12 of the mass of nuclide 12C. An atomic weight can be defined for a sample of any given isotopic composition. The standard atomic weight refers to a sample of normal terrestrial isotopic composition. The term relative atomic mass is synonymous with atomic weight. [2] Attenuated total reflection (ATR) - See Techniques for Materials Characterization, page 12-1. Auger effect - An atomic process in which an electron from a higher energy level fills a vacancy in an inner shell, transferring the released energy to another electron which is ejected. Aurora - An atmospheric phenomenon in which streamers of light are produced when electrons from the sun are guided into the thermosphere by the earth’s magnetic field. It occurs in the polar regions at altitudes of 95—300 km. Avogadro constant (NA)* - The number of elementary entities in one mole of a substance. Azeotrope - A liquid mixture in a state where the variation of vapor pressure with composition at constant temperature (or, alternatively, the variation of normal boiling point with composition) shows either a maximum or a minimum. Thus when an azeotrope boils the vapor has the same composition as the liquid. Azides - Compounds bearing the group -N3, viz. -N=N+=N-; usually attached to carbon, e.g. PhN3, phenyl azide or azidobenzene. Also used for salts of hydrazoic acid, HN3, e.g. NaN3, sodium azide. [5] Azines - Condensation products, R2C=NN=CR2 , of two moles of a carbonyl compound with one mole of hydrazine. [5] Azo compounds - Derivatives of diazene (diimide), HN=NH, wherein
both hydrogens are substituted by hydrocarbyl groups, e.g., PhN=NPh, azobenzene or diphenyldiazene. [5] Balmer series - The series of lines in the spectrum of the hydrogen atom which corresponds to transitions between the state with principal quantum number n = 2 and successive higher states. The wavelengths are given by 1/λ = RH(1/4 - 1/n2), where n = 3,4,... and RH is the Rydberg constant for hydrogen. The first member of the series (n = 2 1 3), which is often called the Hα line, falls at a wavelength of 6563 Å. Bar (bar) - A unit of pressure equal to 105 Pa.´ Bardeen-Cooper-Schrieffer (BCS) theory - A theory of superconductivity which is based upon the formation of electron pairs as a result of an electron-lattice interaction. The theory relates the superconducting transition temperature to the density of states and the Debye temperature. Barn (b) - A unit used for expressing cross sections of nuclear processes, equal to 10-28 m2. Barrel - A unit of volume equal to 158.9873 L. Baryon - Any elementary particle built up from three quarks. Examples are the proton, neutron, and various short-lived hyperons. Baryons have odd half-integer spins. Base - Historically, a substance that yields an OH- ion when it dissociates in solution, resulting in a pH>7. In the Brönsted definition, a base is a substance capable of accepting a proton in any type of reaction. The more general definition, due to G.N. Lewis, classifies any chemical species capable of donating an electron pair as a base. Becquerel (Bq)* - The SI unit of radioactivity (disintegrations per unit time), equal to s-1. [1] Beer’s law - An approximate expression for the change in intensity of a light beam that passes through an absorbing medium, viz., log(I/I0) = -εcl, where I0 is the incident intensity, I is the final intensity, ε is the molar (decadic) absorption coefficient, c is the molar concentration of the absorbing substance, and l is the path length. Also called the BeerLambert law Binding energy* - A generic term for the energy required to decompose a system into two or more of its constituent parts. In nuclear physics, the binding energy is the energy difference between a nucleus and the separated nucleons of which it is composed (the energy equivalent of the mass defect). In atomic physics, it is the energy required to remove an electron from an atom. Biot (Bi) - A name sometimes used for the unit of current in the emu system. Birefringence - A property of certain crystals in which two refracted rays result from a single incident light ray. One, the ordinary ray, follows the normal laws of refraction, while the other, the extraordinary ray, exhibits a variable refractive index which depends on the direction in the crystal. Black body radiation* - The radiation emitted by a perfect black body, i.e., a body which absorbs all radiation incident on it and reflects none. The wavelength dependence of the radiated energy density ρ (energy per unit volume per unit wavelength range) is given by the Planck formula 8πhc ρ= λ5 e hc / λkT – 1
(
)
where λ is the wavelength, h is Planck’s constant, c is the speed of light, k is the Boltzmann constant, and T is the temperature. Black hole - A very dense object, formed in a supernova explosion, whose gravitational field is so large that no matter or radiation can escape from the object. Bloch wave function - A solution of the Schrödinger equation for an electron moving in a spatially periodic potential; used in the band theory of solids. Bohr magneton (µB)* - The atomic unit of magnetic moment, defined as
2-40
DEFINITIONS OF SCIENTIFIC TERMS (continued) eh/4πme, where h is Planck’s constant, me the electron mass, and e the elementary charge. It is the moment associated with a single electron spin. Bohr, bohr radius (a0)* - The radius of the lowest orbit in the Bohr model of the hydrogen atom, defined as εoh2/πmee2, where εo is the permittivity of a vacuum, h is Planck’s constant, me the electron mass, and e the elementary charge. It is customarily taken as the unit of length when using atomic units. Boiling point - The temperature at which the liquid and gas phases of a substance are in equilibrium at a specified pressure. The normal boiling point is the boiling point at normal atmospheric pressure (101.325 kPa). Boltzmann constant (k)* - The molar gas constant R divided by Avogadro’s constant. Boltzmann distribution - An expression for the equilibrium distribution of molecules as a function of their energy, in which the number of molecules in a state of energy E is proportional to exp(-E/kT), where k is the Boltzmann constant and T is the temperature. Bond strength - See Dissociation energy. Born-Haber cycle* - A thermodynamic cycle in which a crystalline solid is converted to gaseous ions and then reconverted to the solid. The cycle permits calculation of the lattice energy of the crystal. Bose-Einstein distribution - A modification of the Boltzmann distribution which applies to a system of particles that are bosons. The number of particles of energy E is proportional to [e(E-µ)/kT-1]-1 , where µ is a normalization constant, k is the Boltzmann constant, and T is the temperature. Boson - A particle that obeys Bose-Einstein Statistics; specifically, any particle with spin equal to zero or an integer. This includes the photon, pion, deuteron, and all nuclei of even mass number. Boyle’s law - The empirical law, exact only for an ideal gas, which states that the volume of a gas is inversely proportional to its pressure at constant temperature. Bragg angle (θ) - Defined by the equation nλ = 2dsinθ, which relates the angle θ between a crystal plane and the diffracted x-ray beam, the wavelength λ of the x-rays, the crystal plane spacing d, and the diffraction order n (any integer). Bravais lattices* - The 14 distinct crystal lattices that can exist in three dimensions. They include three in the cubic crystal system, two in the tetragonal, four in the orthorhombic, two in the monoclinic, and one each in the triclinic, hexagonal, and trigonal systems. Breakdown voltage - The potential difference at which an insulating substance undergoes a physical or chemical change that causes it to become a conductor, thus allowing current to flow through the sample. Bremsstrahlung - Electromagnetic radiation generated when the velocity of a charged particle is reduced (literally, “braking radiation”). An example is the x-ray continuum resulting from collisions of electrons with the target in an x-ray tube. Brewster angle - The angle of incidence for which the maximum degree of plane polarization occurs when a beam of unpolarized light is incident on the surface of a medium of refractive index n. At this angle, the angle between the reflected and refracted beams is 90°. The value of the Brewster angle is tan-1n. Brillouin scattering - The scattering of light by acoustic phonons in a solid or liquid. Brillouin zone - A region of allowed wave vectors and energy levels in a crystalline solid, which plays a part in the propagation of waves through the lattice. British thermal unit (Btu) - A non-SI unit of energy, equal to approximately 1055 J. Several values of the Btu, defined in slightly different ways, have been used. Brownian motion - The random movements of small particles suspended in a fluid, which arise from collisions with the fluid molecules.
Brunauer-Emmett-Teller method (BET) - See Techniques for Materials Characterization, page 12-1. Buffer* - A solution designed to maintain a constant pH when small amounts of a strong acid or base are added. Buffers usually consist of a fairly weak acid and its salt with a strong base. Suitable concentrations are chosen so that the pH of the solution remains close to the pKa of the weak acid. Calorie (cal) - A non-SI unit of energy, originally defined as the heat required to raise the temperature of 1 g of water by 1°C. Several calories of slightly different values have been used. The thermochemical calorie is now defined as 4.184 J. Candela (cd)* - The SI base unit of luminous intensity. [1] Capacitance (C) - Ratio of the charge acquired by a body to the change in potential. [1] Carbamates - Salts or esters of carbamic acid, H2NC(=O)OH, or of Nsubstituted carbamic acids: R2NC(=O)OR′, (R′ = hydrocarbyl or a cation). The esters are often called urethanes or urethans, a usage that is strictly correct only for the ethyl esters. [5] Carbenes - The electrically neutral species H2C: and its derivatives, in which the carbon is covalently bonded to two univalent groups of any kind or a divalent group and bears two nonbonding electrons, which may be spin-paired (singlet state) or spin-non-paired (triplet state). [5] Carbinols - An obsolete term for substituted methanols, in which the name carbinol is synonymous with methanol. [5] Carbohydrates - Originally, compounds such as aldoses and ketoses, having the stoichiometric formula Cn(H2O)n (hence “hydrates of carbon”). The generic term carbohydrate now includes mono-, oligo-, and polysaccharides, as well as their reaction products and derivatives. [5] Carboranes - A contraction of carbaboranes. Compounds in which a boron atom in a polyboron hydride is replaced by a carbon atom with maintenance of the skeletal structure. [5] Carboxylic acids - Oxoacids having the structure RC(=O)OH. The term is used as a suffix in systematic name formation to denote the -C(=O)OH group including its carbon atom. [5] Carnot cycle - A sequence of reversible changes in a heat engine using a perfect gas as the working substance, which is used to demonstrate that entropy is a state function. The Carnot cycle also provides a means to calculate the efficiency of a heat engine. Catalyst - A substance that participates in a particular chemical reaction and thereby increases its rate but without a net change in the amount of that substance in the system. [3] Catenanes, catena compounds - Hydrocarbons having two or more rings connected in the manner of links of a chain, without a covalent bond. More generally, the class catena compounds embraces functional derivatives and hetero analogues. [5] Cation - A positively charged atomic or molecular particle. Centipoise (cP) - A common non-SI unit of viscosity, equal to mPa s. Centrifugal distortion - An effect in molecular spectroscopy in which rotational levels are lowered in energy, relative to the values of a rigid rotor, as the rotational angular momentum increases. The effect may be understood classically as a stretching of the bonds in the molecule as it rotates faster, thus increasing the moment of inertia. Ceramic - A nonmetallic material of very high melting point. Cerenkov radiation - Light emitted when a beam of charged particles travels through a medium at a speed greater than the speed of light in the medium. It is typically blue in color. Cgs system of units - A system of units based upon the centimeter, gram, and second. The cgs system has been supplanted by the International System (SI). Chalcogens - The Group VIA elements (oxygen, sulfur, selenium, tellurium, and polonium). Compounds of these elements are called chalcogenides. [7]
2-41
DEFINITIONS OF SCIENTIFIC TERMS (continued) Chaotic system - A complex system whose behavior is governed by deterministic laws but whose evolution can vary drastically when small changes are made in the initial conditions. Charge - See Electric charge. Charles’ law - The empirical law, exact only for an ideal gas, which states that the volume of a gas is directly proportional to its temperature at constant pressure. Charm - A quantum number introduced in particle physics to account for certain properties of elementary particles and their reactions. Chelate - A compound characterized by the presence of bonds from two or more bonding sites within the same ligand to a central metal atom. [3] Chemical potential - For a mixture of substances, the chemical potential of constituent B is defined as the partial derivative of the Gibbs energy G with respect to the amount (number of moles) of B, with temperature, pressure, and amounts of all other constituents held constant. Also called partial molar Gibbs energy. [2] Chemical shift* - A small change in the energy levels (and hence in the spectra associated with these levels) resulting from the effects of chemical binding in a molecule. The term is used in fields such as NMR, Mössbauer, and photoelectron spectroscopy, where the energy levels are determined primarily by nuclear or atomic effects. Chiral molecule - A molecule which cannot be superimposed on its mirror image. A common example is an organic molecule containing a carbon atom to which four different atoms or groups are attached. Such molecules exhibit optical activity, i.e., they rotate the plane of a polarized light beam. Chlorocarbons - Compounds consisting solely of chlorine and carbon. [5] Chromatography* - A method for separation of the components of a sample in which the components are distributed between two phases, one of which is stationary while the other moves. In gas chromatography the gas moves over a liquid or solid stationary phase. In liquid chromatography the liquid mixture moves through another liquid, a solid, or a gel. The mechanism of separation of components may be adsorption, differential solubility, ion-exchange, permeation, or other mechanisms. [6] Clapeyron equation - A relation between pressure and temperature of two phases of a pure substance that are in equilibrium, viz., dp/dT = ∆trsS/∆trs V, where ∆trs S is the difference in entropy between the phases and ∆trsV the corresponding difference in volume. Clathrates - Inclusion compounds in which the guest molecule is in a cage formed by the host molecule or by a lattice of host molecules. [5] Clausius (Cl) - A non-SI unit of entropy or heat capacity defined as cal/K = 4.184 J/K. [2] Clausius-Clapeyron equation - An approximation to the Clapeyron equation applicable to liquid-gas and solid-gas equilibrium, in which one assumes an ideal gas with volume much greater than the condensed phase volume. For the liquid-gas case, it takes the form d(lnp)/ dT = ∆vap H/RT2, where R is the molar gas constant and ∆vap H is the molar enthalpy of vaporization. For the solid-gas case, ∆vap H is replaced by the molar enthalpy of sublimation, ∆sub H. Clausius-Mosotti equation - A relation between the dielectric constant εr at optical frequencies and the polarizability α: ε r – 1 ρN A α = ε r + 2 3Mε 0
where ρ is density, NA is Avogadro’s number, M is molar mass, and ε0 is the permittivity of a vacuum. Clebsch-Gordon coefficients - A set of coefficients used to describe the vector coupling of angular momenta in atomic and nuclear physics. Codon - A set of three bases, chosen from the four primary bases found
in the DNA molecule (uracil, cytosine, adenine, and guanine), which specifies the production of a particular amino acid or carries some other genetic instruction. For example, the codon UCA specifies the amino acid serine, CAG specifies glutamine, etc. There are a total of 64 codons. Coercive force - The magnetizing force at which the magnetic flux density is equal to zero. [10] Coercivity* - The maximum value of coercive force that can be attained when a magnetic material is symmetrically magnetized to saturation induction. [10] Coherent anti-Stokes Raman spectroscopy (CARS) - See Techniques for Materials Characterization, page 12-1. Colloid - Molecules or polymolecular particles dispersed in a medium that have, at least in one direction, a dimension roughly between 1 nm and 1 µm. [3] Color center - A defect in a crystal that gives rise to optical absorption, thus changing the color of the material. A common type is the F-center, which results when an electron occupies the site of a negative ion. Compressibility (κ)* - The fractional change of volume as pressure is increased, viz., κ = -(1/V)(dV/dp). [1] Compton wavelength (λC)* - In the scattering of electromagnetic radiation by a free particle (e.g., electron, proton), λC = h/mc is the increase in wavelength, at a 90° scattering angle, corresponding to the transfer of energy from radiation to particle. Here h is Planck’s constant, c the speed of light, and m the mass of the particle. Conductance (G)* - For direct current, the reciprocal of resistance. More generally, the real part of admittance. [1] Conductivity, electrical (σ)* - The reciprocal of the resistivity. [1] Conductivity, thermal - See Thermal conductivity. Congruent transformation - A phase transition (melting, vaporization, etc.) in which the substance preserves its exact chemical composition. Constitutional repeating unit (CRU) - In polymer science, the smallest constitutional unit, the repetition of which constitutes a regular macromolecule, i.e., a macromolecule with all units connected identically with respect to directional sense. [8] Copolymer - A polymer derived from more than one species of monomer. [8] Coriolis effect - The deviation from simple trajectories when a mechanical system is described in a rotating coordinate system. It affects the motion of projectiles on the earth and in molecular spectroscopy leads to an important interaction between the rotational and vibrational motions. The effect may be described by an additional term in the equations of motion, called the Coriolis force. Cosmic rays* - High energy nuclear particles, electrons, and photons, originating mostly outside the solar system, which continually bombard the earth’s atmosphere. Coulomb (C)* - The SI unit of electric charge, equal to A s. [1] Coulomb’s law - The statement that the force F between two electrical charges q1 and q2 separated by a distance r is F = (4πε0)-1q1q2/r2, where ε0 is the permittivity of a vacuum. Covalent bond - A chemical bond between two atoms whose stability results from the sharing of two electrons, one from each atom. Cowling number (Co) - A dimensionless quantity used in plasma physics, defined by Co = B2/µρv2, where ρ is density, v is velocity, µ is permeability, and B is magnetic flux density. [2] CPT theorem - A theorem in particle physics which states that any local Lagrangian theory that is invariant under proper Lorentz transformations is also invariant under the combined operations of charge conjugation, C, space inversion, P, and time reversal, T, taken in any order. Critical point* - In general, the point on the phase diagram of a two-phase system at which the two coexisting phases have identical properties
2-42
DEFINITIONS OF SCIENTIFIC TERMS (continued) and therefore represent a single phase. At the liquid-gas critical point of a pure substance, the distinction between liquid and gas vanishes, and the vapor pressure curve ends. The coordinates of this point are called the critical temperature and critical pressure. Above the critical temperature, it is not possible to liquefy the substance. Cross section (σ)* - A measure of the probability of collision (or other interaction) between a beam of particles and a target which it encounters. In rough terms it is the effective area the target particles present to the incident ones; however, the precise definition depends on the nature of the interaction. A general definition of σ is the number of encounters per unit time divided by nv, where n is the concentration of incident particles and v their velocity. Crosslink - In polymer science, a small region in a macromolecule from which at least four chains emanate, and formed by reactions involving sites or groups on existing macromolecules or by interactions between existing macromolecules. [8] Crown compounds - Macrocyclic polydentate compounds, usually uncharged, in which three or more coordinating ring atoms (usually oxygen or nitrogen) are or may become suitably close for easy formation of chelate complexes with metal ions or other cationic species. [5] Crust* - The outer layer of the solid earth, above the Mohorovicic discontinuity. Its thickness averages about 35 km on the continents and about 7 km below the ocean floor. Cryoscopic constant (Ef)* - The constant that expresses the amount by which the freezing point Tf of a solvent is lowered by a non-dissociating solute, through the relation ∆Tf = Ef m, where m is the molality of the solute. Curie (Ci) - A non-SI unit of radioactivity (disintegrations per unit time), equal to 3.7 × 1010 s-1. Curie temperature (TC)* - For a ferromagnetic material, the critical temperature above which the material becomes paramagnetic. Also applied to the temperature at which the spontaneous polarization disappears in a ferroelectric solid. [1] Cyanohydrins - Alcohols substituted by a cyano group, most commonly, but not limited to, examples having a CN and an OH group attached to the same carbon atom. They are formally derived from aldehydes or ketones by the addition of hydrogen cyanide. [5] Cycloalkanes - Saturated monocyclic hydrocarbons (with or without side chains). See alicyclic compounds. Unsaturated monocyclic hydrocarbons having one endocyclic double or one triple bond are called cycloalkenes and cycloalkynes, respectively. [5] Cyclotron resonance - The resonant absorption of energy from a system in which electrons or ions that are orbiting in a uniform magnetic field are subjected to radiofrequency or microwave radiation. The resonance frequency is given by ν = eH/2πm*c, where e is the elementary charge, H is the magnetic field strength, m* is the effective mass of the charged particle, and c is the speed of light. The effect occurs in both solids (involving electrons or holes) and in low pressure gasses (involving ions) Dalton (Da) - A name sometimes used in biochemistry for the unified atomic mass unit (u). De Broglie wavelength - The wavelength associated with the wave representation of a moving particle, given by h/mv, where h is Planck’s constant, m the particle mass, and v the velocity. De Haas-Van Alphen effect - An effect observed in certain metals and semiconductors at low temperatures and high magnetic fields, characterized by a periodic variation of magnetic susceptibility with field strength. Debye equation* - The relation between the relative permittivity (dielectric constant) εr, polarizability α, and permanent dipole moment µ in a dielectric material whose molecules are free to rotate. It takes the
form
εr –1 ρN A = ε r + 2 3Mε 0
µ2 α + 3kT
where ρ is density, NA is Avogadro’s number, M is molar mass, and ε0 is the permittivity of a vacuum. Debye length - In the Debye-Hückel theory of ionic solutions, the effective thickness of the cloud of ions of opposite charge which surrounds each given ion and shields the Coulomb potential produced by that ion. Debye temperature (θD)* - In the Debye model of the heat capacity of a crystalline solid, θD = hνD/k, where h is Planck’s constant, k is the Boltzmann constant, and νD is the maximum vibrational frequency the crystal can support. For T . Table 1. Rate Constants for Second Order Reactions
Reaction
A cm3 molecule-1 s-1
E/R K
k (298 K) cm3 molecule-1 s-1
f(298)
8.0x10-12
2060±250
8.0x10-15
1.15
3.2x10-11 1.2x10-10 1.2x10-10 1.1x10-10 2.2x10-10 1.8x10-11 4.9x10-11 6.7x10-11 2.5x10-10 7.4x10-11 1.5x10-10 1.5x10-10 1.4x10-10 1.5x10-10 2.8x10-10 3.6x10-10 1.9x10-10 7.4x10-11
-(70±100) 0±100 0±100 0±100 0±100 -(110±100) 0±100 0±100 0±100 -(120±100) 0±100 0±100 0±100 0±100 0±100 0±100 0±100 0±100
4.0x10-11 1.2x10-10 1.2x10-10 1.1x10-10 2.2x10-10 2.6x10-11 4.9x10-11 6.7x10-11 2.5x10-10 1.1x10-10 1.5x10-10 1.5x10-10 1.4x10-10 1.5x10-10 2.8x10-10 3.6x10-10 1.9x10-10 7.4x10-11
1.2 1.3 1.3 1.1 1.2 1.2 1.3 1.3 1.3 1.2 1.2 1.2 2.0 2.0 2.0 2.0 2.0 2.0
3.3x10-10 1.8x10-10 2.7x10-10 6.6x10-10
0±100 0±100 0±100 0±100
3.3x10-10 1.8x10-10 2.7x10-10 6.6x10-10
1.2 1.3 1.3 1.5
1.5x10-10
0±100
1.5x10-10
1.2
Ox Reactions O + O3 → O2 + O2 O(1D) Reactions O(1D) + O2 → O + O2 O(1D) + O3 → O2 + O2 → O2 + O + O O(1D) + H2 → OH + H O(1D) + H2O → OH + OH O(1D) + N2 → O + N2 O(1D) + N2O → N2 + O2 → NO + NO O(1D) + NH3 → OH + NH2 O(1D) + CO2 → O + CO2 O(1D) + CH4 → products O(1D) + HCl → products O(1D) + HF → OH + F O(1D) + HBr → products O(1D) + Cl2 → products O(1D) + CCl2O → products O(1D) + CClFO → products O(1D) + CF2O → products O(1D) + CCl4 → products (CFC-10) O(1D) + CH3Br → products O(1D) + CH2Br2 → products O(1D) + CHBr3 → products O(1D) + CH3F → products (HFC-41)
© 2000 CRC Press LLC
CHEMICAL KINETIC DATA FOR STRATOSPHERIC MODELING (continued) Table 1. Rate Constants for Second Order Reactions (continued)
Reaction O(1D) + CH2F2 → products (HFC-32) O(1D) + CHF3 → products (HFC-23) O(1D) + CHCl2F → products (HCFC-21) O(1D) + CHClF2 → products (HCFC-22) O(1D) + CCl3F → products (CFC-11) O(1D) + CCl2F2 → products (CFC-12) O(1D) + CClF3 → products (CFC-13) O(1D) + CClBrF2 → products (Halon-1211) O(1D) + CBr2F2 → products (Halon-1202) O(1D) + CBrF3 → products (Halon-1301) O(1D) + CF4 → CF4 + O (CFC-14) O(1D) + CH3CH2F → products (HFC-161) O(1D) + CH3CHF2 → products (HFC-152a) O(1D) + CH3CCl2F → products (HCFC-141b) O(1D) + CH3CClF2 → products (HCFC-142b) O(1D) + CH3CF3 → products (HFC-143a) O(1D) + CH2ClCClF2 → products (HCFC-132b) O(1D) + CH2ClCF3 → products (HCFC-133a) O(1D) + CH2FCF3 → products (HFC-134a) O(1D) + CHCl2CF3 → products (HCFC-123) O(1D) + CHClFCF3 → products (HCFC-124) O(1D) + CHF2CF3 → products (HFC-125) O(1D) + CCl3CF3 → products (CFC-113a) O(1D) + CCl2FCClF2 → products (CFC-113) O(1D) + CCl2FCF3 → products (CFC-114a) O(1D) + CClF2CClF2 → products (CFC-114) O(1D) + CClF2CF3 → products (CFC-115) O(1D) + CBrF2CBrF2 → products (Halon-2402)
© 2000 CRC Press LLC
A cm3 molecule-1 s-1
E/R K
k (298 K) cm3 molecule-1 s-1
f(298)
5.1x10-11
0±100
5.1x10-11
1.3
9.1x10-12
0±100
9.1x10-12
1.2
1.9x10-10
0±100
1.9x10-10
1.3
1.0x10-10
0±100
1.0x10-10
1.2
2.3x10-10
0±100
2.3x10-10
1.2
1.4x10-10
0±100
1.4x10-10
1.3
8.7x10-11
0±100
8.7x10-11
1.3
1.5x10-10
0±100
1.5x10-10
1.3
2.2x10-10
0±100
2.2x10-10
1.3
1.0x10-10
0±100
1.0x10-10
1.3
-
-
2.0x10-14
1.5
2.6x10-10
0±100
2.6x10-10
1.3
2.0x10-10
0±100
2.0x10-10
1.3
2.6x10-10
0±100
2.6x10-10
1.3
2.2x10-10
0±100
2.2x10-10
1.3
1.0x10-10
0±100
1.0x10-10
3.0
1.6x10-10
0±100
1.6x10-10
2.0
1.2x10-10
0±100
1.2x10-10
1.3
4.9x10-11
0±100
4.9x10-11
1.3
2.0x10-10
0±100
2.0x10-10
1.3
8.6x10-11
0±100
8.6x10-11
1.3
1.2x10-10
0±100
1.2x10-10
2.0
2x10-10
0±100
2x10-10
2.0
2x10-10
0±100
2x10-10
2.0
1x10-10
0±100
1x10-10
2.0
1.3x10-10
0±100
1.3x10-10
1.3
5x10-11
0±100
5x10-11
1.3
1.6x10-10
0±100
1.6x10-10
1.3
CHEMICAL KINETIC DATA FOR STRATOSPHERIC MODELING (continued) Table 1. Rate Constants for Second Order Reactions (continued)
Reaction O(1D) + CF3CF3 → O + CF3CF3 (CFC-116) O(1D) + CHF2CF2CF2CHF2 → products (HFC-338pcc) O(1D) + c-C4F8 → products O(1D) + CF3CHFCHFCF2CF3 → products (HFC-43-10mee) O(1D) + C5F12 → products (CFC-41-12) O(1D) + C6F14 → products (CFC-51-14) O(1D) + 1,2-(CF3)2c-C4F6 → products O(1D) + SF6 → products
A cm3 molecule-1 s-1
E/R K
k (298 K) cm3 molecule-1 s-1
f(298)
-
-
1.5x10-13
1.5
1.8x10-11 -
0±100 -
1.8x10-11 8x10-13
1.5 1.3
2.1x10-10
0±100
2.1x10-10
4
-
-
3.9x10-13
2
-
-
1x10-12
2
-
-
2.8x10-13 1.8x10-14
2 1.5
3.6x10-18 5.2x10-11 2.2x10-11 2.1x10-15 4.2x10-13
220±100 2840±500 0±200 0±200 0±200
100 132 150 120 154 163 191 218 220 180 140 157 189 178 196 89 >100 >100 124 153 >100 224 177 >100
Fl. Limits
IT/°C 310
502 485
0.6-?
540 480 440
0.5-?
235 200
0.5-?
407
0.5-?
430 402 202 205
0.4-?
368 363 365 395 227 450
230
232
FLAMMABILITY OF CHEMICAL SUBSTANCES (continued) Mol. Form. C21H21O4P C21H26O3 C21H32O2 C22H42O2 C22H42O4 C22H44O2 C23H46O2 C24H20Sn C24H38O4 C25H48O4
Name Tri-o-cresyl phosphate 4-Octylphenyl salicylate Methyl abietate Butyl oleate Bis(2-ethylhexyl) adipate Butyl stearate Pentyl stearate Tetraphenylstannane Bis(2-ethylhexyl) phthalate Bis(2-ethylhexyl) azelate
© 2000 CRC Press LLC
tB/°C 410
343 420 384
FP/°C 225 216 180 180 206 160 185 232 218 227
Fl. Limits
IT/°C 385 416
0.4-?
377 355
0.3-?
374
THRESHOLD LIMITS FOR AIRBORNE CONTAMINANTS Several organizations recommend limits of exposure to airborne contaminants in the workplace. These include the Occupational Safety and Health Administration (OSHA), the National Institute for Occupational Safety and Health (NIOSH), and the non-governmental organization, American Conference of Governmental Industrial Hygienists (ACGIH). The threshold limit value (TLV) for a substance is defined as the concentration level under which the majority of workers may be repeatedly exposed, day after day, without adverse effects. The TLV recommendations are given in two forms: • Time-weighted average (TWA) concentration for a normal 8-h workday and 40-h workweek. • Short-term exposure limit (STEL), which should not be exceeded for more than 15 min. Both kinds of limits are specified for some substances. The following table gives threshold limit values for a number of substances that may be encountered in the atmosphere of a chemical laboratory or industrial facility. All values refer to the concentration in air at 25°C and normal atmospheric pressure. Data for gases are given both in parts per million by volume (ppm) and in mass concentration (mg/m3). Values for liquids refer to mists or aerosols, and those for solids to dusts or fumes; both are stated in mg/m3. A “C” following a value indicates a ceiling limit which should not be exceeded even for very brief periods because of acute toxic effects of the substance. Substances are listed by systematic name, which is followed by molecular formula in the Hill format and Chemical Abstracts Service Registry Number. Common synonyms are given in brackets [ ] for some compounds.
REFERENCES 1. 2000 TLV’s and BEI’s, American Conference of Governmental Industrial Hygienists, 1330 Kemper Meadow Drive, Cincinnati, OH 452401634, 2000. 2. NIOSH Pocket Guide to Chemical Hazards, U.S. Department of Health and Human Services, National Institute for Occupational Health and Safety, U.S. Government Printing Office, Washington, DC, 1994. 3. Chemical Information Manual, U.S. Department of Labor, Occupational Safety and Health Administration, Washington, DC, 1991.
Substance Abate [Temephos] Acetaldehyde Acetic acid Acetic anhydride Acetone Acetone cyanohydrin Acetonitrile Acetophenone 2-(Acetyloxy)benzoic acid [Aspirin] Acrolein [2-Propenal] Acrylamide Acrylic acid [2-Propenoic acid] Acrylonitrile [Propenenitrile] Adipic acid Adiponitrile Aldrin Allyl alcohol [2-Propen-1-ol] Allyl glycidyl ether Allyl propyl disulfide Aluminum (metal dust) Aluminum oxide 4-Amino-3,5,6-trichloropyridinecarboxlic acid [Picloram] Ammonia Ammonium chloride Ammonium perfluorooctanoate Ammonium sulfamate Aniline Antimony Arsenic Arsine
Molecular Formula
CAS Reg. No.
C16H20O6P2S3 C2H4O C2H4O2 C4H6O3 C3H6O C4H7NO C2H3N C8H8O C9H8O4 C3H4O C3H5NO C3H4O2 C3H3N C6H10O4 C6H8N2 C12H8Cl6 C3H6O C6H10O2 C6H12S2 Al Al2O3
3383-96-8 75-07-0 64-19-7 108-24-7 67-64-1 75-86-5 75-05-8 98-86-2 50-78-2 107-02-8 79-06-1 79-10-7 107-13-1 124-04-9 111-69-3 309-00-2 107-18-6 106-92-3 2179-59-1 7429-90-5 1344-28-1
C6H3Cl3N2O2 H3N ClH4N C8H4F15NO2 H6N2O3S C6H7N Sb As AsH3
1918-02-1 7664-41-7 12125-02-9 3825-26-1 7773-06-0 62-53-3 7440-36-0 7440-38-2 7784-42-1
16-32
Time-Weighted Average ppm mg/m3
Short-Term Exposure Limit ppm mg/m3
10 10 5 500
25 21 1188
40 10
67 49 5
2 2 2 0.5 1 2
25
2
0.05
0.03 5.9 4.3 5 9 0.25 1.2 5 12 10 10 10 17 10 0.01 10 7.6 0.5 0.01 0.16
25 C 15
45 C 37
750 4.7 C 60
1780 5C 101
0.1 C
0.23 C
3
18
35
24 20
THRESHOLD LIMITS FOR AIRBORNE CONTAMINANTS (continued)
Substance Atrazine Azinphos-methyl Barium Barium sulfate Benomyl Benzene 1,3-Benzenedimethanamine [m-Xylene diamine] Benzenethiol [Phenyl mercaptan] p-Benzoquinone [Quinone] Benzoyl chloride Benzoyl peroxide Benzyl acetate Beryllium Biphenyl Bis(4-amino-3-chlorophenyl)methane [4,4-Methylene bis(2-chloroaniline)] Bis(2-chloroethyl) ether [2,2'-Dichlorethyl ether] Bis(chloromethyl) ether Bis(2-dimethylaminoethyl) ether [DMAEE] Bis(2-ethylhexyl) phthalate [Di-sec-octyl phthalate] Bismuth telluride Boron oxide Boron tribromide Boron trifluoride Bromacil Bromine Bromine pentafluoride Bromochloromethane [Halon 1011] 2-Bromo-2-chloro-1,1,1-trifluoroethane [Halothane] Bromoethane [Ethyl bromide] Bromoethene [Vinyl bromide] Bromomethane [Methyl bromide] Bromotrifluoromethane 1,3-Butadiene Butane 1-Butanethiol [Butyl mercaptan] 1-Butanol 2-Butanol [sec-Butyl alcohol] 2-Butanone [Methyl ethyl ketone] trans-2-Butenal [Crotonaldehyde] 3-Buten-2-one Butyl acetate sec-Butyl acetate tert-Butyl acetate Butyl acrylate Butylamine tert-Butyl chromate Butyl glycidyl ether Butyl lactate o-sec-Butylphenol p-tert-Butyltoluene Cadmium Calcium carbonate
Time-Weighted Average ppm mg/m3
Molecular Formula
CAS Reg. No.
C8H14ClN5 C10H12N3O3PS2 Ba BaO4S C14H18N4O3 C6H6
1912-24-9 86-50-0 7440-39-3 7727-43-7 17804-35-2 71-43-2
C8H12N2 C6H6S C6H4O2 C7H5ClO C14H10O4 C9H10O2 Be C12H10
1477-55-0 108-98-5 106-51-4 98-88-4 94-36-0 140-11-4 7440-41-7 92-52-4
0.2
5 61 0.002 1.3
C13H12Cl2N2
101-14-4
0.01
0.11
C4H8Cl2O C2H4Cl2O C8H20N20
111-44-4 542-88-1 3033-62-3
5 0.001 0.05
29 0.0047 0.33
C24H38O4 Bi2Te3 B2O3 BBr3 BF3 C9H13BrN2O2 Br2 BrF5 CH2BrCl
117-81-7 1304-82-1 1303-86-2 10294-33-4 7637-07-2 314-40-9 7726-95-6 7789-30-2 74-97-5
C2HBrClF3 C2H5Br C2H3Br CH3Br CBrF3 C4H6 C4H10 C4H10S C4H10O C4H10O C4H8O C4H6O C4H6O C6H12O2 C6H12O2 C6H12O2 C7H12O2 C4H11N C8H18CrO4 C7H14O2 C7H14O3 C10H14O C11H16 Cd CCaO3
151-67-7 74-96-4 593-60-2 74-83-9 75-63-8 106-99-0 106-97-8 109-79-5 71-36-3 78-92-2 78-93-3 4170-30-3 78-94-4 123-86-4 105-46-4 540-88-5 141-32-2 109-73-9 1189-85-1 2426-08-6 138-22-7 89-72-5 98-51-1 7440-43-9 1317-65-3
16-33
0.84 0.5
5 0.2 0.5 10 10 1.6
0.5 0.1
2.3 0.44
Short-Term Exposure Limit ppm mg/m3
2.5
8 0.1 C
0.5 C 10
0.01
10
58
0.15
1.0
5 10 10
0.1 0.1 200
10 0.66 0.72 1060
50 5 0.5 1 1000 2 800 0.5
404 22 2.2 3.9 6090 4.4 1900 1.8
100 200
303 590
150 200 200 2
713 950 950 10
25 5 5 1
133 30 31 6.1 0.01 10
2.8 C
10
1C 1C
10 C 2.8 C
0.2
1.3
50 C
152 C
300 0.3 C 0.2 C 200
885 0.9 C 0.6 C 950
5C
15 C 0.1 C
THRESHOLD LIMITS FOR AIRBORNE CONTAMINANTS (continued)
Substance
Molecular Formula
CAS Reg. No.
Calcium chromate Calcium cyanamide Calcium hydroxide Calcium metasilicate Calcium oxide Calcium sulfate Camphor Caprolactam Captafol Captan Carbaryl Carbofuran Carbon black Carbon dioxide Carbon disulfide Carbon monoxide Carbonyl chloride [Phosgene] Carbonyl fluoride Cesium hydroxide Chlordane Chlorine Chlorine dioxide Chlorine trifluoride Chloroacetaldehyde Chloroacetone α-Chloroacetophenone Chloroacetyl chloride Chlorobenzene o-Chlorobenzylidene malononitrile 2-Chloro-1,3-butadiene [Chloroprene] Chlorodifluoromethane Chloroethane [Ethyl chloride] 2-Chloroethanol [Ethylene chlorohydrin] Chloroethene [Vinyl chloride] Chloromethane [Methyl chloride] (Chloromethyl)benzene [Benzyl chloride] 1-Chloro-4-nitrobenzene 1-Chloro-1-nitropropane Chloropentafluoroethane 2-Chloropropanoic acid 3-Chloropropene [Allyl chloride] 2-Chlorostyrene o-Chlorotoluene Chlorpyrifos Chromium Chromyl chloride Clopidol Cobalt Cobalt carbonyl Cobalt hydrocarbonyl Copper Cresol (all isomers) Crufomate Cyanamide Cyanogen Cyanogen chloride Cyclohexane
CaCrO4 CCaN2 CaH2O2 CaO3Si CaO CaO4S C10H16O C6H11NO C10H9Cl4NO2S C9H8Cl3NO2S C12H11NO2 C12H15NO3 C CO2 CS2 CO CCl2O CF2O CsHO C10H6Cl8 Cl2 ClO2 ClF3 C2H3ClO C3H5ClO C8H7ClO C2H2Cl2O C6H5Cl C10H5ClN2 C4H5Cl CHClF2 C2H5Cl C2H5ClO C2H3Cl CH3Cl C7H7Cl C6H4ClNO2 C3H6ClNO2 C2ClF5 C3H5ClO2 C3H5Cl C8H7Cl C7H7Cl C9H11Cl3NO3PS Cr Cl2CrO2 C7H7Cl2NO Co C8Co2O8 C4HCoO4 Cu C7H8O C12H19ClNO3P CH2N2 C2N2 CClN C6H12
13765-19-0 156-62-7 1305-62-0 1344-95-2 1305-78-8 7778-18-9 76-22-2 105-60-2 2425-06-1 133-06-2 63-25-2 1563-66-2 1333-86-4 124-38-9 75-15-0 630-08-0 75-44-5 353-50-4 21351-79-1 57-74-9 7782-50-5 10049-04-4 7790-91-2 107-20-0 78-95-5 532-27-4 79-04-9 108-90-7 2698-41-1 126-99-8 75-45-6 75-00-3 107-07-3 75-01-4 74-87-3 100-44-7 100-00-5 600-25-9 76-15-3 598-78-7 107-05-1 2039-87-4 95-49-8 2921-88-2 7440-47-3 14977-61-8 2971-90-6 7440-48-4 10210-68-1 16842-03-8 7440-50-8 1319-77-3 299-86-5 420-04-2 460-19-5 506-77-4 110-82-7
16-34
Time-Weighted Average ppm mg/m3
0.5 0.1
0.003 0.5 5 10 2 10 12 1 (solid) 0.1 5 5 0.1 3.5 9000 31 29 0.40 5.4 2 0.5 1.5 0.28
0.05 0.05 10
0.32 0.23 46
10 1000 100
36 3540 264
1 50 1 0.1 2 1000 0.1 1 50 50
10
2.5 103 5.2 0.64 10 6320 0.44 3 283 259 0.2 0.5 0.16 10 0.02 0.1 0.1 0.2 22 5 2 21
300
1030
2 5 (gas)
5000 10 25 0.1 2
0.025
5
Short-Term Exposure Limit ppm mg/m3
4 10 (gas)
24 3 (solid)
30,000
54,000
5
13
1 0.3 0.1 C 1C 1C
2.9 0.83 0.38 C 3.2 C 3.8 C
0.15
0.69
0.05 C
0.39 C
1C
3.3 C
100
207
2 75
6 425
0.3 C
0.75 C
THRESHOLD LIMITS FOR AIRBORNE CONTAMINANTS (continued)
Substance Cyclohexanol Cyclohexanone Cyclohexene Cyclohexylamine Cyclonite [Hexahydro-1,3,5-trinitro1,3,5-triazine] 1,3-Cyclopentadiene Cyclopentane Cyhexatin Decaborane(14) Diacetone alcohol 4,4'-Diaminodiphenylmethane [4,4-Methylene dianiline] Diazinon Diazomethane Diborane Dibromodifluoromethane 2-Dibutylaminoethanol 2,6-Di-tert-butyl-4-methylphenol Dibutylphenyl phosphate Dibutyl phosphate Dibutyl phthalate Dichloroacetylene o-Dichlorobenzene p-Dichlorobenzene 1,4-Dichloro-2-butene (unspecified isomer) Dichlorodifluoromethane 1,3-Dichloro-5,5-dimethyl hydantoin Dichlorodiphenyltrichloroethane [DDT] 1,1-Dichloroethane [Ethylidene dichloride] 1,2-Dichloroethane [Ethylene dichloride] 1,1-Dichloroethene [Vinylidene chloride] 1,2-Dichloroethylene (both isomers) Dichlorofluoromethane Dichloromethane [Methylene chloride] 1,1-Dichloro-1-nitroethane (2,4-Dichlorophenoxy)acetic acid 1,2-Dichloropropane 2,2-Dichloropropanoic acid 1,3-Dichloropropene (both isomers) 1,2-Dichloro-1,1,2,2-tetrafluoroethane Dichlorvos Dicrotophos m-Dicyanobenzene [m-Phthalodinitrile] Dicyclopentadiene Dieldrin Diethanolamine Diethylamine 2-Diethylaminoethanol Diethylenetriamine [Bis(2-amimoethyl)amine] Diethyl ether Diethyl phthalate 1,1-Difluoroethene Diglycidyl ether Diisopropylamine Diisopropyl ether Dimethoxymethane [Methylal]
Molecular Formula
CAS Reg. No.
Time-Weighted Average ppm mg/m3
C6H12O C6H10O C6H10 C6H13N
108-93-0 108-94-1 110-83-8 108-91-8
50 25 300 10
C3H6N6O6 C5H6 C5H10 C18H34OSn B10H14 C6H12O2
121-82-4 542-92-7 287-92-3 13121-70-5 17702-41-9 123-42-2
C13H14N2 C12H21N2O3PS CH2N2 B2H6 CBr2F2 C10H23NO C15H24O C14H23O4P C8H19O4P C16H22O4 C2Cl2 C6H4Cl2 C6H4Cl2 C4H6Cl2 CCl2F2 C5H6Cl2N2O2 C14H9Cl5 C2H4Cl2 C2H4Cl2 C2H2Cl2 C2H2Cl2 CHCl2F CH2Cl2 C2H3Cl2NO2 C8H6Cl2O3 C3H6Cl2 C3H4Cl2O2 C3H4Cl2 C2Cl2F4 C4H7Cl2O4P C8H16NO5P C8H4N2 C10H12 C12H8Cl6O C4H11NO2 C4H11N C6H15NO C4H13N3 C4H10O C12H14O4 C2H2F2 C6H10O3 C6H15N C6H14O C3H8O2
101-77-9 333-41-5 334-88-3 19287-45-7 75-61-6 102-81-8 128-37-0 2528-36-1 107-66-4 84-74-2 7572-29-4 95-50-1 106-46-7 764-41-0 75-71-8 118-52-5 50-29-3 75-34-3 107-06-2 75-35-4 540-59-0 75-43-4 75-09-2 594-72-9 94-75-7 78-87-5 75-99-0 542-75-6 76-14-2 62-73-7 141-66-2 626-17-5 77-73-6 60-57-1 111-42-2 109-89-7 100-37-8 111-40-0 60-29-7 84-66-2 75-38-7 2238-07-5 108-18-9 108-20-3 109-87-5
16-35
75 600 0.05 50 0.1 0.2 0.1 100 0.5 0.3 1
25 10 0.005 1000
100 10 5 200 10 50 2 75 1 1000 0.1
5 0.46 5 2 1 400 500 0.1 5 250 1000
Short-Term Exposure Limit ppm mg/m3
206 100 1010 41 0.5 203 1720 5 0.25 238 0.81 0.1 0.34 0.11 858 3.5 10 3.5 8.6 5 150 60 0.026 4950 0.2 1 405 40 20 793 42 174 12 10 347 5 4.5 7000 0.90 0.25 5 27 0.25 2 15 9.6 4.2 1210 5 1310 0.53 21 1040 3110
0.15
0.75
2
17
0.1 C 50
0.39 C 301
0.4
110
508
15
45
500
1520
310
1300
THRESHOLD LIMITS FOR AIRBORNE CONTAMINANTS (continued)
Substance Dimethyl mercury N,N-Dimethylacetamide Dimethylamine N,N-Dimethylaniline 2,2-Dimethylbutane 2,3-Dimethylbutane N,N-Dimethylformamide 2,6-Dimethyl-4-heptanone [Diisobutyl ketone] 1,1-Dimethylhydrazine Dimethyl phthalate Dimethyl sulfate Dinitrobenzene (all isomers) Dinitrotoluene (all isomers) 1,4-Dioxane Dioxathion Diphenylamine Diphenyl ether 4,4'-Diphenylmethane diisocyanate Dipropylene glycol monomethyl ether Diquat Disulfiram Disulfoton Diuron Divinyl benzene (all isomers) Endosulfan Endrin Enflurane Epichlorohydrin [(Chloromethyl)oxirane] 1,2-Epoxy-4-(epoxyethyl)cyclohexane [Vinylcyclohexene dioxide] 1,2-Ethanediamine [Ethylenediamine] Ethanethiol [Ethyl mercaptan] Ethanol Ethanolamine Ethion Ethoxydimethylsilane Ethyl acetate Ethyl acrylate Ethylamine Ethylbenzene Ethyl tert-butyl ether [ETBE] Ethylene glycol Ethylene glycol dinitrate Ethylene glycol monobutyl ether [2-Butoxyethanol] Ethylene glycol monoethyl ether [2-Ethoxyethanol] Ethylene glycol monoethyl ether acetate [2-Ethoxyethyl acetate] Ethylene glycol monomethyl ether [2-Methoxyethanol] Ethylene glycol monomethyl ether acetate [2-Methoxyethyl acetate] Ethyleneimine Ethylene oxide [Oxirane] Ethyl formate Ethylidene norbornene
Molecular Formula
CAS Reg. No.
C2H6Hg C4H9NO C2H7N C8H11N C6H14 C6H14 C3H7NO C9H18O C2H8N2 C10H10O4 C2H6O4S C6H4N2O4 C7H6N2O4 C4H8O2 C12H26O6P2S4 C12H11N C12H10O C15H10N2O2 C7H16O3 C12H12N2 C10H20N2S4 C8H19O2PS3 C9H10Cl2N2O C10H10 C9H6Cl6O3S C12H8Cl6O C3H2ClF5O C3H5ClO
593-74-8 127-19-5 124-40-3 121-69-7 75-83-2 79-29-8 68-12-2 108-83-8 57-14-7 131-11-3 77-78-1 25154-54-5 25321-14-6 123-91-1 78-34-2 122-39-4 101-84-8 101-68-8 34590-94-8 231-36-7 97-77-8 298-04-4 330-54-1 1321-74-0 115-29-7 72-20-8 13838-16-9 106-89-8
C8H12O2 C2H8N2 C2H6S C2H6O C2H7NO C9H22O4P2S4 C4H12OSi C4H8O2 C5H8O2 C2H7N C8H10 C6H14O C2H6O2 C2H4N2O6
106-87-6 107-15-3 75-08-1 64-17-5 141-43-5 563-12-2 14857-34-2 141-78-6 140-88-5 75-04-7 100-41-4 637-92-3 107-21-1 628-96-6
C6H14O2
Time-Weighted Average ppm mg/m3
10 5 5 500 500 10 25 0.01 0.1 0.15 20
1 0.005 100
10
75 0.5
0.5 400 5 5 100 5
0.57 25 1.3 1880 7.5 0.4 2.1 1440 20 9.2 434 20
0.05
0.31
111-76-2
20
97
C4H10O2
110-80-5
5
18
C6H12O3
111-15-9
5
27
C3H8O2
109-86-4
5
16
C5H10O3 C2H5N C2H4O C3H6O2 C9H12
110-49-6 151-56-4 75-21-8 109-94-4 16219-75-3
5 0.5 1 100
24 0.88 1.8 303
16-36
0.1 10 0.5 1000 3
0.01 36 9.2 25 1760 1760 30 145 0.025 5 0.52 1.0 0.2 72 0.2 10 7 0.051 600 0.5 2 0.1 10 53 0.1 0.1 566 1.9
Short-Term Exposure Limit ppm mg/m3 0.03 15 10 1000 1000
27.6 50 3500 3500
2
14
150
900
6
15
1.5
6.4
15 15 125
61 27.6 543 100 C
5C
25 C
THRESHOLD LIMITS FOR AIRBORNE CONTAMINANTS (continued)
Substance N-Ethylmorpholine Ethyl p-nitrophenyl benzenethiophosphate [EPN] Ethyl silicate Fenamiphos Fensulfothion Fenthion Ferbam Ferrocene [Dicyclopentadienyl iron] Fluorine Fluorine monoxide [Oxygen difluoride] Fonofos Formaldehyde Formamide Formic acid Furfural [2-Furaldehyde] Furfuryl alcohol [2-Furanmethanol] Germane [Germanium tetrahydride] Glycerol Graphite Hafnium Heptachlor Heptane 2-Heptanone [Methyl pentyl ketone] 3-Heptanone [Ethyl butyl ketone] 4-Heptanone [Dipropyl ketone] Hexachlorobenzene Hexachloro-1,3-butadiene 1,2,3,4,5,6-Hexachlorocyclohexane [Lindane] Hexachloro-1,3-cyclopentadiene Hexachloroethane [Perchloroethane] Hexachloronaphthalene (all isomers) Hexamethylene diisocyanate Hexane 1,6-Hexanediamine [Hexamethylenediamine] 2-Hexanone [Butyl methyl ketone] 1-Hexene sec-Hexyl acetate Hydrazine Hydrazoic acid Hydrogen bromide Hydrogen chloride Hydrogen cyanide Hydrogen fluoride Hydrogen peroxide Hydrogen selenide Hydrogen sulfide p-Hydroquinone [1,4-Benzenediol] 2-Hydroxypropyl acrylate Indene Indium Iodine Iodomethane [Methyl iodide] Iron(III) oxide Iron pentacarbonyl Isobutyl acetate Isopentane
Molecular Formula
CAS Reg. No.
Time-Weighted Average ppm mg/m3
C6H13NO
100-74-3
5
C14H14NO4PS C8H20O4Si C13H22NO3PS C11H17O4PS2 C10H15O3PS2 C9H18FeN3S6 C10H10Fe F2 F2O C10H15OPS2 CH2O CH3NO CH2O2 C5H4O2 C5H6O2 GeH4 C3H8O3 C Hf C10H5Cl7 C7H16 C7H14O C7H14O C7H14O C6Cl6 C4Cl6 C6H6Cl6 C5Cl6 C2Cl6 C10H2Cl6 C8H12N2O2 C6H14 C6H16N2 C6H12O C6H12 C8H16O2 H4N2 HN3 BrH ClH CHN FH H2O2 H2Se H2S C6H6O2 C6H10O3 C9H8 In I2 CH3I Fe2O3 C5FeO5 C6H12O2 C5H12
2104-64-5 78-10-4 22224-92-6 115-90-2 55-38-9 14484-64-1 102-54-5 7782-41-4 7783-41-7 944-22-9 50-00-0 75-12-7 64-18-6 98-01-1 98-00-0 7782-65-2 56-81-5 7440-44-0 7440-58-6 76-44-8 142-82-5 110-43-0 106-35-4 123-19-3 118-74-1 87-68-3 58-89-9 77-47-4 67-72-1 1335-87-1 822-06-0 110-54-3 124-09-4 591-78-6 592-41-6 108-84-9 302-01-2 7782-79-8 10035-10-6 7647-01-0 74-90-8 7664-39-3 7722-84-1 7783-07-5 7783-06-4 123-31-9 999-61-1 95-13-6 7440-74-6 7553-56-2 74-88-4 1309-37-1 13463-40-6 110-19-0 78-78-4
16-37
10
1
Short-Term Exposure Limit ppm mg/m3
24 0.1 85 0.1 0.1 0.2 10 10 1.6
2 0.05 C
3.1 0.11 C
0.3 C
0.37 C
10
19
15
60
500
2050
75
350
10
40
0.11 C 3C 5C 4.7 C 3C
0.19 C 9.9 C 7.5 C 5C 2.3 C
15
21
0.1 C
1.0 C
0.2
0.45
0.1 10 5 2 10 0.2
400 50 50 50 0.02 0.01 1 0.005 50 0.5 5 30 50 0.01
1 0.05 10 0.5 10
2 0.1 150 600
18 9.4 7.9 40 0.63 10 2 0.5 0.05 1640 233 233 233 0.002 0.21 0.5 0.11 9.7 0.2 0.034 176 2.3 20 103 295 0.013
1.4 0.16 14 2 2.8 48 0.1 12 5 0.23 713 1770
THRESHOLD LIMITS FOR AIRBORNE CONTAMINANTS (continued)
Substance Isopentyl acetate [Isoamyl acetate] Isophorone Isophorone diisocyanate Isopropenylbenzene [α-Methyl styrene] 2-Isopropoxyethanol Isopropyl acetate Isopropylamine N-Isopropylaniline Isopropylbenzene [Cumene] Isopropyl glycidyl ether Kaolin Ketene Lead Lead(II) arsenate Lead(II) chromate Lithium hydride Magnesium carbonate [Magnesite] Magnesium oxide Malathion Maleic anhydride Manganese Manganese cyclopentadienyl tricarbonyl Mercury Mesityl oxide Methacrylic acid [2-Methylpropenoic acid] Methanethiol [Methyl mercaptan] Methanol Methomyl o-Methoxyaniline [o-Anisidine] p-Methoxyaniline [p-Anisidine] Methoxychlor 4-Methoxyphenol Methyl acetate Methyl acrylate 2-Methylacrylonitrile Methylamine o-Methylaniline [o-Toluidine] m-Methylaniline [m-Toluidine] p-Methylaniline [p-Toluidine] N-Methylaniline 3-Methyl-1-butanol [Isoamyl alcohol] 3-Methyl-2-butanone [Methyl isopropyl ketone] Methyl tert-butyl ether [MTBE] Methyl 2-cyanoacrylate Methylcyclohexane Methylcyclohexanol (all isomers) 2-Methylcyclohexanone 2-Methylcyclopentadienyl manganese tricarbonyl Methyl demeton 2-Methyl-3,5-dinitrobenzamide [Dinitolmide] 2-Methyl-4,6-dinitrophenol [Dinitro-o-cresol] Methylene bis(4-cyclohexylisocyanate) Methyl ethyl ketone peroxide Methyl formate 6-Methyl-1-heptanol [Isooctyl alcohol] 5-Methyl-3-heptanone
Molecular Formula
CAS Reg. No.
C7H14O2 C9H14O C12H18N2O2 C9H10 C5H12O2 C5H10O2 C3H9N C9H13N C9H12 C6H12O2 C2H2O Pb As2O8Pb3 CrO4Pb HLi CMgO3 MgO C10H19O6PS2 C4H2O3 Mn C8H5MnO3 Hg C6H10O C4H6O2 CH4S CH4O C5H10N2O2S C7H9NO C7H9NO C16H15Cl3O2 C7H8O2 C3H6O2 C4H6O2 C4H5N CH5N C7H9N C7H9N C7H9N C7H9N C5H12O C5H10O C5H12O C5H5NO2 C7H14 C7H14O C7H12O
123-92-2 78-59-1 4098-71-9 98-83-9 109-59-1 108-21-4 75-31-0 768-52-5 98-82-8 4016-14-2 1332-58-7 463-51-4 7439-92-1 7784-40-9 7758-97-6 7580-67-8 546-93-0 1309-48-4 121-75-5 108-31-6 7439-96-5 12079-65-1 7439-97-6 141-79-7 79-41-4 74-93-1 67-56-1 16752-77-5 90-04-0 104-94-9 72-43-5 150-76-5 79-20-9 96-33-3 126-98-7 74-89-5 95-53-4 108-44-1 106-49-0 100-61-8 123-51-3 563-80-4 1634-04-4 137-05-3 108-87-2 25639-42-3 583-60-8
C9H7MnO3 C6H15O3PS2 C8H7N3O5 C7H6N2O5 C15H22N2O2 C8H18O2 C2H4O2 C8H18O C8H16O
12108-13-3 8022-00-2 148-01-6 534-52-1 5124-30-1 1338-23-4 107-31-3 26952-21-6 541-85-5
16-38
Time-Weighted Average ppm mg/m3 100
532
0.005 50 25 250 5 2 50 50
200 2 1 5 2 2 2 0.5 100 200 40 0.2 400 50 50
0.045 242 106 1040 12 11 246 238 2 0.86 0.05 0.15 0.075 0.025 10 10 10 4 0.2 0.4 0.025 60 70 0.98 262 2.5 0.5 0.5 10 5 606 7 2.7 6.4 8.8 8.8 8.8 2.2 361 705 144 0.9 1610 234 229
0.005
0.8 0.5 5 0.2 0.054
100 50 25
246 266 131
0.5
0.1
15 20 0.5 200 0.1 0.1
Short-Term Exposure Limit ppm mg/m3
5C
28 C
100
483
310 10
1290 24
75
356
1.5
2.6
25
100
250
328
250
757
15
19
125
452
75
344
0.2 C 150
1.5 C 368
THRESHOLD LIMITS FOR AIRBORNE CONTAMINANTS (continued)
Substance 5-Methyl-2-hexanone [Methyl isopentyl ketone] Methylhydrazine Methyl isocyanate Methyl methacrylate Methyloxirane [1,2-Propylene oxide] Methyl parathion 2-Methylpentane 3-Methylpentane 2-Methyl-2,4-pentanediol [Hexylene glycol] 4-Methyl-2-pentanol [Methyl isobutyl carbinol] 4-Methyl-2-pentanone [Isobutyl methyl ketone] 2-Methyl-1-propanol [Isobutyl alcohol] 2-Methyl-2-propanol [tert-Butyl alcohol] Methylstyrene (all isomers) N-Methyl-N,2,4,6-tetranitroaniline [Tetryl] Metribuzin Mevinphos Mica Molybdenum Monocrotophos Morpholine Naled Naphthalene 1-Naphthalenylthiourea [ANTU] Neopentane Nickel Nickel carbonyl Nickel(III) sulfide Nicotine Nitrapyrin Nitric acid Nitric oxide p-Nitroaniline Nitrobenzene Nitroethane Nitrogen dioxide Nitrogen trifluoride Nitromethane 1-Nitropropane 2-Nitropropane Nitrotoluene (all isomers) Nitrous oxide Nonane (all isomers) Octachloronaphthalene Octane (all isomers) Osmium(VIII) oxide [Osmium tetroxide] Oxalic acid 2-Oxetanone [β-Propiolactone] Oxiranemethanol [Glycidol] Ozone Paraquat Parathion Pentaborane(9) Pentachloronaphthalene (unspecified isomer) Pentachloronitrobenzene Pentachlorophenol Pentaerythritol
Molecular Formula
CAS Reg. No.
C7H14O CH6N2 C2H3NO C5H8O2 C3H6O C8H10NO5PS C6H14 C6H14 C6H14O2 C6H14O C6H12O C4H10O C4H10O C9H10 C7H5N5O8 C8H14N4OS C7H13O6P
110-12-3 60-34-4 624-83-9 80-62-6 75-56-9 298-00-0 107-83-5 96-14-0 107-41-5 108-11-2 108-10-1 78-83-1 75-65-0 25013-15-4 479-45-8 21087-64-9 7786-34-7 12001-26-2 7439-98-7 6923-22-4 110-91-8 300-76-5 91-20-3 86-88-4 463-82-1 7440-02-0 13463-39-3 12035-72-2 54-11-5 1929-82-4 7697-37-2 10102-43-9 100-01-6 98-95-3 79-24-3 10102-44-0 7783-54-2 75-52-5 108-03-2 79-46-9 1321-12-6 10024-97-2 111-84-2 2234-13-1 111-65-9 20816-12-0 144-62-7 57-57-8 556-52-5 10028-15-6 4685-14-7 56-38-2 19624-22-7 1321-64-8 82-68-8 87-86-5 115-77-5
Mo C7H14NO5P C4H9NO C4H7Br2Cl2O4P C10H8 C11H10N2S C5H12 Ni C4NiO4 Ni3S2 C10H14N2 C6H3Cl4N HNO3 NO C6H6N2O2 C6H5NO2 C2H5NO2 NO2 F3N CH3NO2 C3H7NO2 C3H7NO2 C7H7NO2 N2O C9H20 C10Cl8 C8H18 O4Os C2H2O4 C3H4O2 C3H6O2 O3 C12H14N2 C10H14NO5PS B5H9 C10H3Cl5 C6Cl5NO2 C6HCl5O C5H12O4
16-39
Time-Weighted Average ppm mg/m3 50 0.01 0.02 50 20 500 500 25 50 50 100 50
0.01
20 10 600 0.05
2 25 1 100 3 10 20 25 10 2 50 200 300 0.0002 0.5 2 0.1
0.005
234 0.019 0.047 205 48 0.2 1760 1760 104 205 152 303 242 1.5 5 0.092 3 10 0.25 71 3 52 0.3 1770 1.5 0.12 0.14 0.5 10 5.2 31 3 5 307 5.6 29 50 91 36 11 90 1050 0.1 1400 0.0016 1 1.5 6.1 0.2 0.5 0.1 0.013 0.5 0.5 0.5 10
Short-Term Exposure Limit ppm mg/m3
100
410
1000 1000 25 C 40 75
3500 3500 121 C 167 307
100
483
0.03
0.27
15
79
4
20 10
5
9.4
375 0.0006
0.3 1750 0.0047 2
0.015
0.039
THRESHOLD LIMITS FOR AIRBORNE CONTAMINANTS (continued)
Substance Pentanal [Valeraldehyde] Pentane Pentanedial [Glutaraldehyde] 2-Pentanone [Methyl propyl ketone] 3-Pentanone [Diethyl ketone] Pentyl acetate (all isomers) Perchloromethyl mercaptan Perchloryl fluoride Perfluoroacetone [Hexafluoroacetone] Perfluoroisobutene Phenol 10H-Phenothiazine Phenylenediamine (all isomers) Phenyl glycidyl ether Phenylhydrazine Phenylphosphine Phorate Phosphine Phosphoric acid Phosphorus (white) Phosphorus(III) chloride [Phosphorus trichloride] Phosphorus(V) chloride [Phosphorus pentachloride] Phosphorus(V) oxychloride [Phosphoryl chloride] Phosphorus(V) sulfide Phthalic anhydride Piperazine dihydrochloride 2-Pivaloyl-1,3-indandione [Pindone] Platinum Potassium hydroxide Propane Propanoic acid 1-Propanol 2-Propanol [Isopropyl alcohol] Propargyl alcohol [2-Propyn-1-ol] Propoxur Propyl acetate 1,2-Propylene glycol dinitrate Propylene glycol monomethyl ether Propyleneimine Propyl nitrate Propyne [Methylacetylene] 2-Pyridinamine [2-Aminopyridine] Pyridine Pyrocatechol [Catechol] Resorcinol Rhodium Ronnel Rotenone Selenium Selenium hexafluoride Sesone Silane Silicon Silicon carbide
Molecular Formula
CAS Reg. No.
C5H10O C5H12 C5H8O2 C5H10O C5H10O C7H14O2 CCl4S ClFO3 C3F6O C4F8 C6H6O C12H9NS C6H8N2 C9H10O2 C6H8N2 C6H7P C7H17O2PS3 H3P H3O4P P
110-62-3 109-66-0 111-30-8 107-87-9 96-22-0 628-63-7 594-42-3 7616-94-6 684-16-2 382-21-8 108-95-2 92-84-2 25265-76-3 122-60-1 100-63-0 638-21-1 298-02-2 7803-51-2 7664-38-2 7723-14-0
Cl3P
Time-Weighted Average ppm mg/m3 50 600
176 1770
200 200 50 0.1 3 0.1
705 700 265 0.76 13 0.68
5
19 5 0.1 0.6 0.44
0.1 0.1
0.02
0.05 0.42 1 0.1
7719-12-2
0.2
1.1
Cl5P
10026-13-8
0.1
0.85
Cl3OP P2S5 C8H4O3 C4H12Cl2N2 C14H14O3 Pt HKO C3H8 C3H6O2 C3H8O C3H8O C3H4O C11H15NO3 C5H10O2 C3H6N2O6 C4H10O2 C3H7N C3H7NO3 C3H4 C5H6N2 C5H5N C6H6O2 C6H6O2 Rh C8H8Cl3O3PS C23H22O6 Se F6Se C8H7Cl2NaO5S H4Si Si CSi
10025-87-3 1314-80-3 85-44-9 142-64-3 83-26-1 7440-06-4 1310-58-3 74-98-6 79-09-4 71-23-8 67-63-0 107-19-7 114-26-1 109-60-4 6423-43-4 107-98-2 75-55-8 627-13-4 74-99-7 504-29-0 110-86-1 120-80-9 108-46-3 7440-16-6 299-84-3 83-79-4 7782-49-2 7783-79-1 136-78-7 7803-62-5 7440-21-3 409-21-2
0.1
0.63 1 6.1 5 0.1 1 2C 4500 30 492 983 2.3 0.5 835 0.34 369 4.7 107 1640 1.9 16 23 45 1 10 5 0.2 0.95 10 6.6 10 10
16-40
0.3
1
2500 10 200 400 1 200 0.05 100 2 25 1000 0.5 5 5 10
0.12 5
Short-Term Exposure Limit ppm mg/m3
750 0.05 C 250 300 100
2210 0.2 C 881 1050 530
6
25
0.01 C
0.082 C
0.05 C
0.23 C 0.2 1.4 3
1
0.5
2.8
3
250 500
614 1230
250
1040
150
553
40
172
20
90
THRESHOLD LIMITS FOR AIRBORNE CONTAMINANTS (continued)
Substance Silicon dioxide (α-quartz) Silicon dioxide (tridymite) Silicon dioxide (cristobalite) Silicon dioxide (vitreous) Silver Sodium azide Sodium fluoroacetate Sodium hydrogen sulfite Sodium hydroxide Sodium metabisulfite Sodium pyrophosphate Sodium tetraborate decahydrate Stibine Strontium chromate Strychnine Styrene Sucrose Sulfotep Sulfur chloride Sulfur decafluoride Sulfur dioxide Sulfur hexafluoride Sulfur tetrafluoride Sulfuric acid Sulfuryl fluoride Sulprofos Talc Tantalum Tantalum(V) oxide Tellurium Tellurium hexafluoride Terephthalic acid Terphenyl (all isomers) 1,1,2,2-Tetrabromoethane [Acetylene tetrabromide] Tetrabromomethane [Carbon tetrabromide] 1,1,1,2-Tetrachloro-2,2-difluoroethane 1,1,2,2-Tetrachloro-1,2-difluoroethane 1,1,2,2-Tetrachloroethane Tetrachloroethene [Perchloroethylene] Tetrachloromethane [Carbon tetrachloride] Tetrachloronaphthalene (all isomers) Tetraethyl lead Tetraethyl pyrophosphate [TEPP] Tetrahydrofuran [Oxolane] Tetramethyl lead Tetramethyl silicate Tetramethyl succinonitrile Tetranitromethane Thallium 4,4'-Thiobis(6-tert-butyl-m-cresol) Thioglycolic acid Thionyl chloride Thiram Tin Titanium(IV) oxide [Titanium dioxide] Toluene
Molecular Formula
CAS Reg. No.
O2Si O2Si O2Si O2Si Ag N3Na C2H2FNaO2 HNaO3S HNaO Na2O5S2 Na4O7P2 B4H20Na2O17 H3Sb CrO4Sr C21H22N2O2 C8H8 C12H22O11 C8H20O5P2S2 Cl2S2 F10S2 O2S F6S F4S H2O4S F2O2S C12H19O2PS3 Ta O5Ta2 Te F6Te C8H6O4 C18H14
14808-60-7 15468-32-3 14464-46-1 60676-86-0 7440-22-4 26628-22-8 62-74-8 7631-90-5 1310-73-2 7681-57-4 7722-88-5 1303-96-4 7803-52-3 7789-06-2 57-24-9 100-42-5 57-50-1 3689-24-5 10025-67-9 5714-22-7 7446-09-5 2551-62-4 7783-60-0 7664-93-9 2699-79-8 35400-43-2 14807-96-6 7440-25-7 1314-61-0 13494-80-9 7783-80-4 100-21-0 26140-60-3
C2H2Br4 CBr4 C2Cl4F2 C2Cl4F2 C2H2Cl4 C2Cl4 CCl4 C10H4Cl4 C8H20Pb C8H20O7P2 C4H8O C4H12Pb C4H12O4Si C8H12N2 CN4O8 Tl C22H30O2S C2H4O2S Cl2OS C6H12N2S4 Sn O2Ti C7H8
79-27-6 558-13-4 76-11-9 76-12-0 79-34-5 127-18-4 56-23-5 1335-88-2 78-00-2 107-49-3 109-99-9 75-74-1 681-84-5 3333-52-6 509-14-8 7440-28-0 96-69-5 68-11-1 7719-09-7 137-26-8 7440-31-5 13463-67-7 108-88-3
16-41
Time-Weighted Average ppm mg/m3
Short-Term Exposure Limit ppm mg/m3
0.05 0.05 0.05 0.1 0.1 0.29 C 0.05 5 2C
0.1
20
2 1000
5
0.02
1 0.1 500 500 1 25 5
5 5 5 0.51 0.002 0.15 85 10 0.2
5.2 6000 1 21 1 2 5 5 0.1 0.10 10
1
14 1.4 4170 4170 6.9 170 31 2 0.1 0.05 590 0.15 6 2.8 0.04 0.1 10 3.8
50
1 2 10 188
200 1 0.5 0.005
40
170
1C 0.01 C 5
5.5 C 0.10 C 13
0.1 C 10
0.44 C 3 42
0.53 C
5C
0.3
4.1
100 10
685 63
250
737
1C
4.9 C
THRESHOLD LIMITS FOR AIRBORNE CONTAMINANTS (continued)
Substance Toluene-2,4-diisocyanate 1H-1,2,4-Triazol-3-amine Tribromomethane [Bromoform] Tributyl phosphate Trichloroacetic acid 1,2,4-Trichlorobenzene 1,1,1-Trichloroethane [Methyl chloroform] 1,1,2-Trichloroethane Trichloroethene Trichlorofluoromethane Trichloromethane [Chloroform] (Trichloromethyl)benzene [Benzotrichloride] Trichloronaphthalene (all isomers) Trichloronitromethane [Chloropicrin] 2,4,5-Trichlorophenoxyacetic acid 1,2,3-Trichloropropane 1,1,2-Trichloro-1,2,2-trifluoroethane Tri-o-cresyl phosphate Triethanolamine Triethylamine Triiodomethane [Iodoform] Trimellitic anhydride [1,2,4-Benzenetricarboxylic anhydride] Trimethylamine Trimethylbenzene (all isomers) Trimethyl phosphite Trinitroglycerol [Nitroglycerin] 2,4,6-Trinitrophenol [Picric acid] 2,4,6-Trinitrotoluene [TNT] Triphenylamine Triphenyl phosphate Tungsten Uranium Vanadium(V) oxide Vinyl acetate 4-Vinylcyclohexene Warfarin Xylene (all isomers) Xylidine (all isomers) Yttrium Zinc chloride Zinc chromate, basic Zinc oxide Zirconium
Molecular Formula
CAS Reg. No.
C9H6N2O2 C2H4N4 CHBr3 C12H27O4P C2HCl3O2 C6H3Cl3 C2H3Cl3 C2H3Cl3 C2HCl3 CCl3F CHCl3 C7H5Cl3 C10H5Cl3 CCl3NO2 C8H5Cl3O3 C3H5Cl3 C2Cl3F3 C21H21O4P C6H15NO3 C6H15N CHI3
584-84-9 61-82-5 75-25-2 126-73-8 76-03-9 120-82-1 71-55-6 79-00-5 79-01-6 75-69-4 67-66-3 98-07-7 1321-65-9 76-06-2 93-76-5 96-18-4 76-13-1 78-30-8 102-71-6 121-44-8 75-47-8
C9H4O5 C3H9N C9H12 C3H9O3P C3H5N3O9 C6H3N3O7 C7H5N3O6 C18H15N C18H15O4P W U O5V2 C4H6O2 C8H12 C19H16O4 C8H10 C8H11N Y Cl2Zn CrH2O4Zn OZn Zr
552-30-7 75-50-3 25551-13-7 121-45-9 55-63-0 88-89-1 118-96-7 603-34-9 115-86-6 7440-33-7 7440-61-1 1314-62-1 108-05-4 100-40-3 81-81-2 1330-20-7 1300-73-8 7440-65-5 7646-85-7 13530-65-9 1314-13-2 7440-67-7
16-42
Time-Weighted Average ppm mg/m3
Short-Term Exposure Limit ppm mg/m3
0.005
0.02
0.14
5C 450
37 C 2460
100 1000 C
537 5620 C
0.01 C
0.08 C
1250
9590
3
12
15
0.04 C 36
0.5 0.2 1
0.036 0.2 5.2 2.2 6.7
350 10 50
1910 55 269
10
49
0.1 10 1000
1 0.6
5 25 2 0.05
10 0.1 100 0.5
5 0.67 10 60 7670 0.1 5 4.1 10
12 123 10 0.46 0.1 0.1 5 3 5 0.2 0.05 35 0.44 0.1 434 2.5 1 1 0.045 5 5
10 0.6 15
53
150
651
2 10 10
OCTANOL-WATER PARTITION COEFFICIENTS The octanol-water partition coefficient, P, is a widely used parameter for correlating biological effects of organic substances. It is a property of the two-phase system in which water and 1-octanol are in equilibrium at a fixed temperature and the substance is distributed between the water-rich and octanol-rich phases. P is defined as the ratio of the equilibrium concentration of the substance in the octanol-rich phase to that in the water-rich phase, in the limit of zero concentration. In general, P tends to be large for compounds with extended non-polar structures (such as long chain or multiring hydrocarbons) and small for compounds with highly polar groups. Thus P (or, in its more common form of expression, log P) provides a measure of the lipophilic vs. hydrophilic nature of a compound, which is an important consideration in assessing the potential toxicity. A discussion of methods of measurement and accuracy considerations for log P may be found in Reference 1. This table gives selected values of log P for about 450 organic compounds, including many of environmental importance. All values refer to a nominal temperature of 25°C. The source of each value is indicated in the last column. These references contain data on many more compounds than are included here. Compounds are listed by molecular formula following the Hill convention. To locate a compound by name or CAS Registry Number when the molecular formula is not known, use the table “Physical Constants of Organic Compounds” in Section 3 and its indexes to determine the molecular formula. REFERENCES 1. Sangster, J., J. Phys. Chem. Ref. Data, 18, 1111, 1989. 2. Mackay, D., Shiu, W.Y., and Ma, K.C., Illustrated Handbook of Physical-Chemical Properties and Environmental Fate for Organic Chemicals, Lewis Publishers/CRC Press, Boca Raton, FL, 1992. 3. Shiu, W.Y., and Mackay, D., J. Phys. Chem. Ref. Data, 15, 911, 1986. 4. Pinsuwan, S., Li, L., and Yalkowsky, S.H., J. Chem. Eng. Data, 40, 623, 1995. 5. Solubility Data Series, International Union of Pure and Applied Chemistry, Vol. 20, Pergamon Press, Oxford, 1985. 6. Solubility Data Series, International Union of Pure and Applied Chemistry, Vol. 38, Pergamon Press, Oxford, 1985. 7. Miller, M.M., Ghodbane, S., Wasik, S.P., Tewari, Y.B., and Martire, D.E., J. Chem. Eng. Data, 29, 184, 1984. Mol. Form. CCl2F2 CCl3F CCl4 CHBr3 CHCl3 CH2BrCl CH2Br2 CH2Cl2 CH2F2 CH2I2 CH2O CH2O2 CH3Br CH3Cl CH3F CH3I CH3NO CH3NO2 CH4O CH5N C2Cl3F3 C2Cl4 C2Cl6 C2HCl3 C2HCl5 C2H2Cl2 C2H2Cl2 C2H2Cl2 C2H2Cl4 C2H3Cl C2H3Cl3 C2H3Cl3 C2H3N C2H4Cl2 C2H4Cl2
Name Dichlorodifluoromethane Trichlorofluoromethane Tetrachloromethane Tribromomethane Trichloromethane Bromochloromethane Dibromomethane Dichloromethane Difluoromethane Diiodomethane Formaldehyde Formic acid Bromomethane Chloromethane Fluoromethane Iodomethane Formamide Nitromethane Methanol Methylamine 1,1,2-Trichlorotrifluoroethane Tetrachloroethylene Hexachloroethane Trichloroethylene Pentachloroethane 1,1-Dichloroethylene cis-1,2-Dichloroethylene trans-1,2-Dichloroethylene 1,1,2,2-Tetrachloroethane Chloroethylene 1,1,1-Trichloroethane 1,1,2-Trichloroethane Acetonitrile 1,1-Dichloroethane 1,2-Dichloroethane
© 2000 CRC Press LLC
log P
Ref.
Mol. Form.
Name
log P
Ref.
2.16 2.53 2.64 2.38 1.97 1.41 2.3 1.25 0.20 2.5 0.35 -0.54 1.19 0.91 0.51 1.5 -1.51 -0.33 -0.74 -0.57 3.16 2.88 4.00 2.53 2.89 2.13 1.86 1.93 2.39 1.38 2.49 2.38 -0.34 1.79 1.48
2 2 2 2 2 2 2 2 1 2 1 1 2 2 1 2 1 1 1 1 2 2 4 2 2 2 2 2 2 2 2 2 1 2 2
C2H4O C2H4O C2H4O2 C2H5Br C2H5Cl C2H5I C2H5NO C2H5NO2 C2H6O C2H6O C2H6OS C2H6O2S C2H7N C2H7N C3H3N C3H4Cl2 C3H4O C3H4O C3H5Br C3H5ClO C3H5Cl3 C3H5N C3H5NO C3H6Cl2 C3H6O C3H6O C3H6O C3H6O C3H6O2 C3H6O2 C3H7Br C3H7Br C3H7Cl C3H7Cl C3H7I
Acetaldehyde Ethylene oxide Acetic acid Bromoethane Chloroethane Iodoethane Acetamide Nitroethane Ethanol Dimethyl ether Dimethyl sulfoxide Dimethyl sulfone Ethylamine Dimethylamine 2-Propenenitrile cis-1,3-Dichloropropene Propargyl alcohol Acrolein 3-Bromopropene Epichlorohydrin 1,2,3-Trichloropropane Propanenitrile Acrylamide 1,2-Dichloropropane Allyl alcohol Propanal Acetone Methyloxirane Propanoic acid Methyl acetate 1-Bromopropane 2-Bromopropane 1-Chloropropane 2-Chloropropane 1-Iodopropane
0.45 -0.30 -0.17 1.6 1.43 2 -1.26 0.18 -0.30 0.10 -1.35 -1.41 -0.13 -0.38 0.25 2.03 -0.38 -0.01 1.79 0.30 2.63 0.16 -0.78 2.0 0.17 0.59 -0.24 0.03 0.33 0.18 2.1 1.9 2.04 1.90 2.5
1 1 1 2 2 2 1 1 1 1 1 1 1 1 1 2 1 1 1 2 2 1 1 2 1 1 1 1 1 1 2 2 1 1 2
OCTANOL-WATER PARTITION COEFFICIENTS (continued) Mol. Form. C3H7N C3H7NO C3H7NO C3H7NO2 C3H8O C3H8O C3H8S C3H9N C3H9N C3H9N C3H9N C4H4O C4H4S C4H5N C4H6 C4H6 C4H6O C4H6O2 C4H6O2 C4H6O2 C4H7N C4H8 C4H8 C4H8 C4H8Cl2O C4H8O C4H8O C4H8O C4H8O C4H8O2 C4H8O2 C4H8O2 C4H9Br C4H9Cl C4H9F C4H9I C4H9N C4H9NO C4H9NO C4H9NO2 C4H10 C4H10O C4H10O C4H10O C4H10O C4H10O C4H10S C4H10S C4H11N C4H11N C4H11N C5H5N C5H6O C5H7N C5H8 C5H8 C5H8O2 C5H8O2 C5H9N C5H10
Name Allylamine N,N-Dimethylformamide N-Methylacetamide 1-Nitropropane 1-Propanol 2-Propanol 1-Propanethiol Propylamine Isopropylamine Ethylmethylamine Trimethylamine Furan Thiophene Pyrrole 1,3-Butadiene 2-Butyne 2,5-Dihydrofuran Methacrylic acid Vinyl acetate Methyl acrylate Butanenitrile cis-2-Butene trans-2-Butene Isobutene Bis(2-chloroethyl) ether Ethyl vinyl ether Butanal 2-Butanone Tetrahydrofuran Butanoic acid Propyl formate Ethyl acetate 1-Bromobutane 1-Chlorobutane 1-Fluorobutane 1-Iodobutane Pyrrolidine Butanamide N,N-Dimethylacetamide 1-Nitrobutane Isobutane 1-Butanol 2-Butanol 2-Methyl-1-propanol 2-Methyl-2-propanol Diethyl ether 1-Butanethiol Diethyl sulfide Butylamine tert-Butylamine Diethylamine Pyridine 2-Methylfuran 1-Methylpyrrole 1,4-Pentadiene 1-Pentyne Methyl methacrylate Ethyl acrylate Pentanenitrile 1-Pentene
© 2000 CRC Press LLC
log P
Ref.
Mol. Form.
0.03 -1.01 -1.05 0.87 0.25 0.05 1.81 0.48 0.26 0.15 0.16 1.34 1.81 0.75 1.99 1.46 0.46 0.93 0.73 0.80 0.60 2.33 2.31 2.35 1.12 1.04 0.88 0.29 0.46 0.79 0.83 0.73 2.75 2.64 2.58 3 0.46 -0.21 -0.77 1.47 2.8 0.84 0.65 0.76 0.35 0.89 2.28 1.95 0.86 0.40 0.58 0.65 1.85 1.21 2.48 1.98 1.38 1.32 0.94 2.2
1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 2 1 1 1 1 1 1 1 1 2 1 2 1 1 1 1 2 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 2
C5H10 C5H10O C5H10O C5H10O C5H10O C5H10O C5H10O2 C5H10O2 C5H10O2 C5H10O3 C5H11Br C5H11F C5H11N C5H11NO2 C5H12 C5H12 C5H12O C5H12O C5H12O C5H12O C5H12O C5H12O C5H12O C5H12O C5H13N C6Cl6 C6HCl5 C6HCl5O C6H2Cl4 C6H2Cl4 C6H2Cl4 C6H3Cl3 C6H3Cl3 C6H3Cl3 C6H4Cl2 C6H4Cl2 C6H4Cl2 C6H4Cl2O C6H5Br C6H5Cl C6H5F C6H5I C6H5NO2 C6H6 C6H6O C6H6S C6H7N C6H7N C6H7N C6H7N C6H8 C6H8O C6H8O C6H8O C6H10 C6H10 C6H10 C6H10O C6H10O C6H10O2
Name Cyclopentane 2-Pentanone 3-Pentanone 3-Methyl-2-butanone Tetrahydropyran 2-Methyltetrahydrofuran Pentanoic acid Propyl acetate Ethyl propanoate Diethyl carbonate 1-Bromopentane 1-Fluoropentane Piperidine 1-Nitropentane Pentane Neopentane 1-Pentanol 2-Pentanol 3-Pentanol 3-Methyl-1-butanol 2-Methyl-2-butanol 3-Methyl-2-butanol 2,2-Dimethyl-1-propanol Methyl tert-butyl ether Pentylamine Hexachlorobenzene Pentachlorobenzene Pentachlorophenol 1,2,3,4-Tetrachlorobenzene 1,2,3,5-Tetrachlorobenzene 1,2,4,5-Tetrachlorobenzene 1,2,3-Trichlorobenzene 1,2,4-Trichlorobenzene 1,3,5-Trichlorobenzene o-Dichlorobenzene m-Dichlorobenzene p-Dichlorobenzene 2,4-Dichlorophenol Bromobenzene Chlorobenzene Fluorobenzene Iodobenzene Nitrobenzene Benzene Phenol Benzenethiol Aniline 2-Methylpyridine 3-Methylpyridine 4-Methylpyridine 1,4-Cyclohexadiene 5-Hexyn-2-one 2-Cyclohexen-1-one 2-Ethylfuran 1,5-Hexadiene 1-Hexyne Cyclohexene 5-Hexen-2-one Cyclohexanone Ethyl methacrylate
log P
Ref.
3.00 0.84 0.82 0.56 0.82 1.85 1.39 1.24 1.21 1.21 3.37 2.33 0.84 2.01 3.45 3.11 1.51 1.25 1.21 1.28 0.89 1.28 1.31 0.94 1.49 5.47 5.03 5.07 4.55 4.65 4.51 4.04 3.98 4.02 3.38 3.48 3.38 3.23 2.99 2.84 2.27 3.28 1.85 2.13 1.48 2.52 0.90 1.11 1.20 1.22 2.3 0.58 0.61 2.40 2.8 2.73 2.86 1.02 0.81 1.94
1 1 1 1 1 2 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 5 5 4 5 5 5 5 5 5 5 5 5 4 2 1 2 2 1 1 4 1 1 1 1 1 2 1 1 1 2 2 1 1 1 1
OCTANOL-WATER PARTITION COEFFICIENTS (continued) Mol. Form.
Name
log P
Ref.
Mol. Form.
C6H11Br C6H11N C6H12 C6H12 C6H12 C6H12 C6H12O C6H12O C6H12O C6H12O C6H12O2 C6H12O2 C6H13Br C6H13N C6H14 C6H14 C6H14 C6H14 C6H14O C6H14O C6H14O C6H14O C6H14O C6H14O C6H15N C6H15N C6H15N C7H5BrO2 C7H5BrO2 C7H5BrO2 C7H5N C7H6O C7H6O2 C7H6O2 C7H6O3 C7H7Br C7H7Cl C7H7Cl C7H7Cl C7H7Cl C7H7NO2 C7H8 C7H8 C7H8O C7H8O C7H8O C7H8O C7H8O C7H9N C7H9N C7H9N C7H9N C7H9N C7H14 C7H14 C7H14O C7H14O C7H15Br C7H15Cl C7H15I
Bromocyclohexane Hexanenitrile 1-Hexene 4-Methyl-1-pentene Cyclohexane Methylcyclopentane Cyclohexanol Hexanal 2-Hexanone 4-Methyl-2-pentanone Hexanoic acid Butyl acetate 1-Bromohexane Cyclohexylamine Hexane 3-Methylpentane 2,2-Dimethylbutane 2,3-Dimethylbutane 1-Hexanol 2-Hexanol 3-Hexanol 3,3-Dimethyl-2-butanol Dipropyl ether Diisopropyl ether Hexylamine Dipropylamine Triethylamine 2-Bromobenzoic acid 3-Bromobenzoic acid 4-Bromobenzoic acid Benzonitrile Benzaldehyde Benzoic acid Phenyl formate Salicylic acid (Bromomethyl)benzene o-Chlorotoluene m-Chlorotoluene p-Chlorotoluene (Chloromethyl)benzene p-Nitrotoluene Toluene 1,3,5-Cycloheptatriene o-Cresol m-Cresol p-Cresol Benzyl alcohol Anisole Benzylamine o-Methylaniline m-Methylaniline p-Methylaniline N-Methylaniline 1-Heptene Methylcyclohexane 2-Heptanone 5-Methyl-2-hexanone 1-Bromoheptane 1-Chloroheptane 1-Iodoheptane
3.20 1.66 3.40 2.5 3.44 3.37 1.23 1.78 1.38 1.31 1.92 1.82 3.80 1.49 4.00 3.60 3.82 3.85 2.03 1.76 1.65 1.48 2.03 1.52 2.06 1.67 1.45 2.20 2.87 2.86 1.56 1.48 1.88 1.26 2.20 2.92 3.42 3.28 3.33 2.30 2.42 2.73 2.63 1.98 1.98 1.97 1.05 2.11 1.09 1.32 1.40 1.39 1.66 3.99 3.88 1.98 1.88 4.36 4.15 4.70
1 1 1 2 1 2 1 1 1 1 1 1 1 1 1 2 1 2 1 1 1 1 1 1 1 1 1 4 4 4 1 1 4 1 4 1 1 1 1 1 1 1 2 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1
C7H16 C7H16O C7H16O C7H16O C7H16O C7H17N C8H6 C8H6O C8H6S C8H7N C8H7N C8H8 C8H8O C8H8O C8H8O C8H8O C8H8O C8H8O2 C8H8O2 C8H8O2 C8H8O2 C8H8O2 C8H8O2 C8H10 C8H10 C8H10 C8H10 C8H10O C8H10O C8H10O C8H10O C8H10O C8H10O C8H10O C8H10O C8H10O C8H10O C8H10O C8H10O C8H10O C8H10O C8H10O C8H10O C8H10O C8H11N C8H11N C8H11N C8H14O2 C8H15N C8H16 C8H16 C8H16O C8H16O2 C8H17Br C8H18 C8H18O C8H18O C8H18O C8H18O C9H7N
© 2000 CRC Press LLC
Name Heptane 1-Heptanol 2-Heptanol 3-Heptanol 4-Heptanol Heptylamine Phenylacetylene Benzofuran Benzo[b]thiophene Benzeneacetonitrile Indole Styrene Acetophenone 2-Methylbenzaldehyde Benzeneacetaldehyde 2,3-Dihydrobenzofuran Phenyloxirane o-Toluic acid m-Toluic acid p-Toluic acid Benzeneacetic acid Phenyl acetate Methyl benzoate Ethylbenzene o-Xylene m-Xylene p-Xylene o-Ethylphenol m-Ethylphenol p-Ethylphenol 2,4-Xylenol 2,5-Xylenol 2,6-Xylenol 3,4-Xylenol 3,5-Xylenol Benzeneethanol α-Methylbenzyl alcohol 3-Methylbenzenemethanol 4-Methylbenzenemethanol Phenetole Benzyl methyl ether 2-Methylanisole 3-Methylanisole 4-Methylanisole p-Ethylaniline N,N-Dimethylaniline Benzeneethanamine Butyl methacrylate Octanenitrile 1-Octene Cyclooctane 2-Octanone Octanoic acid 1-Bromooctane Octane 1-Octanol 2-Octanol 4-Octanol Dibutyl ether Quinoline
log P
Ref.
4.50 2.62 2.31 2.24 2.22 2.57 2.40 2.67 3.12 1.56 2.14 3.05 1.63 2.26 1.78 2.14 1.61 2.32 2.37 2.34 1.41 1.49 2.20 3.15 3.12 3.20 3.15 2.47 2.50 2.50 2.35 2.34 2.36 3.23 2.35 1.36 1.42 1.60 1.58 2.51 1.35 2.74 2.66 2.81 1.96 2.31 1.41 2.88 2.75 4.57 4.45 2.37 3.05 4.89 5.15 3.07 2.90 2.68 3.21 2.03
1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 4 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 2 1 1 1 1 1 1 1 1 1
OCTANOL-WATER PARTITION COEFFICIENTS (continued) Mol. Form. C9H7N C9H8 C9H8O2 C9H9N C9H10 C9H10O C9H10O C9H10O C9H10O2 C9H10O2 C9H10O2 C9H10O2 C9H12 C9H12 C9H12 C9H12 C9H12 C9H12 C9H12 C9H12O C9H12O C9H12O C9H12O C9H12O C9H13N C9H13N C9H18 C9H18O C9H18O C9H20 C9H20O C9H21N C10H7Cl C10H7Cl C10H8 C10H8 C10H8O C10H8O C10H12O2 C10H14 C10H14 C10H14 C10H14 C10H14 C10H14 C10H14 C10H14O C10H20O C10H20O2 C10H22 C10H22O C11H9N C11H10 C11H10 C11H16 C11H16 C11H22O C11H22O2 C12Cl10 C12HCl9
Name Isoquinoline Indene trans-Cinnamic acid Benzenepropanenitrile Indan 1-Phenyl-1-propanone 1-Phenyl-2-propanone 4-Methylacetophenone 2-Phenylpropanoic acid Benzyl acetate 4-Methylphenyl acetate Ethyl benzoate Propylbenzene Isopropylbenzene o-Ethyltoluene p-Ethyltoluene 1,2,3-Trimethylbenzene 1,2,4-Trimethylbenzene 1,3,5-Trimethylbenzene 2-Propylphenol 4-Propylphenol 2,3,6-Trimethylphenol 2,4,6-Trimethylphenol Benzenepropanol N,N-Dimethylbenzylamine Amphetamine 1-Nonene 2-Nonanone 5-Methyl-2-octanone Nonane 1-Nonanol Tripropylamine 1-Chloronaphthalene 2-Chloronaphthalene Naphthalene Azulene 1-Naphthol 2-Naphthol Isopropyl benzoate Butylbenzene tert-Butylbenzene Isobutylbenzene p-Cymene 1,2,4,5-Tetramethylbenzene 1,2,3,4-Tetramethylbenzene 1,2,3,5-Tetramethylbenzene 4-Butylphenol 2-Decanone Decanoic acid Decane 1-Decanol 4-Phenylpyridine 1-Methylnaphthalene 2-Methylnaphthalene Pentylbenzene Pentamethylbenzene 2-Undecanone Methyl decanoate Decachlorobiphenyl 2,2′,3,3′,4,5,5′,6,6′Nonachlorobiphenyl
© 2000 CRC Press LLC
log P
Ref.
Mol. Form.
2.08 2.92 2.13 1.72 3.33 2.19 1.44 2.19 1.80 1.96 2.11 2.64 3.69 3.66 3.53 3.63 3.60 3.63 3.42 2.93 3.20 2.67 2.46 1.88 1.98 1.76 5.15 3.16 2.92 5.65 4.02 2.79 3.90 3.98 3.34 3.22 2.84 2.70 3.18 4.26 4.11 4.01 4.10 4.10 4.00 4.10 3.65 3.77 4.09 6.25 4.57 2.59 3.87 4.00 4.90 4.56 4.09 4.41 8.26
1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 2 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 1 4 1 1 1 1 1 1 2 1 2 1 1 1 1 1 1 1 1 1 1 1 1 1 1 3
C12H2Cl8
8.16
3
C12H3Cl7 C12H4Cl6 C12H4Cl6 C12H4Cl6 C12H5Cl5 C12H5Cl5 C12H6Cl4 C12H6Cl4 C12H7Cl3 C12H7Cl3 C12H8Cl2 C12H8Cl2 C12H8O C12H9Cl C12H9Cl C12H9Cl C12H9N C12H10 C12H10 C12H10N2 C12H10O C12H10S C12H11N C12H12 C12H12 C12H12 C12H14O C12H18 C12H18 C12H22O C12H24O2 C12H26O C13H8O C13H9N C13H10 C13H10O C13H10O2 C13H11NO C13H12 C13H12 C13H12O C13H12O C14H10 C14H10 C14H12 C14H12 C14H12O C14H12O2 C14H14 C14H14 C14H22 C14H28O2 C15H12 C15H12 C15H12 C16H10 C16H10 C16H14 C16H32O2
Name 2,2′,3,3′,5,5′,6,6′Octachlorobiphenyl 2,2′,3,3′,4,4′,6-Heptachlorobiphenyl 2,2′,3,3′,4,4′-Hexachlorobiphenyl 2,2′,4,4′,6,6′-Hexachlorobiphenyl 2,2′,3,3′,6,6′-Hexachlorobiphenyl 2,3,4,5,6-Pentachlorobiphenyl 2,2′,4,5,5′-Pentachlorobiphenyl 2,3,4,5-Tetrachlorobiphenyl 2,2′,4′,5-Tetrachlorobiphenyl 2,4,5-Trichlorobiphenyl 2,4,6-Trichlorobiphenyl 2,5-Dichlorobiphenyl 2,6-Dichlorobiphenyl Dibenzofuran 2-Chlorobiphenyl 3-Chlorobiphenyl 4-Chlorobiphenyl Carbazole Acenaphthene Biphenyl Azobenzene Diphenyl ether Diphenyl sulfide Diphenylamine 1-Ethylnaphthalene 1,2-Dimethylnaphthalene 1,4-Dimethylnaphthalene 4-Phenylcyclohexanone Hexylbenzene Hexamethylbenzene Cyclododecanone Dodecanoic acid 1-Dodecanol 9H-Fluoren-9-one Acridine 9H-Fluorene Benzophenone Phenyl benzoate N-Phenylbenzamide Diphenylmethane 4-Methylbiphenyl Diphenylmethanol Benzyl phenyl ether Anthracene Phenanthrene trans-Stilbene 1-Methylfluorene 2-Phenylacetophenone Benzyl benzoate 1,2-Diphenylethane 4,4′-Dimethylbiphenyl Octylbenzene Tetradecanoic acid 2-Methylanthracene 9-Methylanthracene 1-Methylphenanthrene Fluoranthene Pyrene 9,10-Dimethylanthracene Hexadecanoic acid
log P
Ref.
7.10 6.70 7.00 7.00 6.70 6.30 6.40 5.72 5.73 5.60 5.47 5.10 5.00 4.12 4.52 4.58 4.61 3.72 3.96 3.76 3.82 4.21 4.45 3.44 4.40 4.31 4.37 2.45 5.52 4.69 4.10 4.6 5.13 3.58 3.40 4.20 3.18 3.59 2.62 4.14 4.63 2.67 3.79 4.56 4.52 4.81 4.97 3.18 3.97 4.70 5.09 6.30 6.1 5.15 5.07 5.14 5.07 5.08 5.69 7.17
3 3 3 3 3 3 3 3 7 3 3 3 3 1 1 1 1 1 4 6 1 1 1 4 1 1 1 1 1 4 1 1 1 1 1 4 1 1 1 1 1 1 1 4 4 1 1 1 1 1 1 1 1 2 1 2 4 4 1 1
OCTANOL-WATER PARTITION COEFFICIENTS (continued) Mol. Form.
Name
log P
Ref.
Mol. Form.
C17H12 C17H12 C18H12 C18H12 C18H12 C18H12 C18H15N C18H30O2 C18H32O2 C18H34O2
11H-Benzo[a]fluorene 11H-Benzo[b]fluorene Benz[a]anthracene Chrysene Naphthacene Triphenylene Triphenylamine Linolenic acid Linoleic acid Oleic acid
5.40 5.75 5.91 5.73 5.76 5.49 5.74 6.46 7.05 7.64
1 1 1 4 1 4 1 1 1 1
C18H36O2 C19H16O C20H12 C20H12 C20H32O2 C20H40O2 C21H16
© 2000 CRC Press LLC
C22H12 C24H12
Name Stearic acid Triphenylmethanol Perylene Benzo[a]pyrene Arachidonic acid Arachidic acid 1,2-Dihydro-3-methylbenz[j] aceanthrylene Benzo[ghi]perylene Coronene
log P
Ref.
8.23 3.68 6.25 6.20 6.98 9.29
1 1 1 4 1 1
6.75 6.90 6.05
1 1 4
PROTECTION AGAINST IONIZING RADIATION The following data and rules of thumb are helpful in estimating the penetrating capability of and danger of exposure to various types of ionizing radiation. More precise data should be used for critical applications.
Alpha Particles Alpha particles of at least 7.5 MeV are required to penetrate the epidermis, the protective layer of skin, 0.07 mm thick.
Electrons Electrons of at least 70 keV are required to penetrate the epidermis, the protective layer of skin, 0.07 mm thick. The range of electrons in g/cm2 is approximately equal to the maximum energy (E) in MeV divided by 2. The range of electrons in air is about 3.65 m per MeV; for example, a 3 MeV electron has a range of about 11 m in air. A chamber wall thickness of 30 mg/cm2 will transmit 70% of the initial fluence of 1 MeV electrons and 20% of that of 0.4 MeV electrons. When electrons of 1 to 2 MeV pass through light materials such as water, aluminum, or glass, less than 1% of their energy is dissipated as bremsstrahlung. The bremsstrahlung from 1 Ci of 32P aqueous solution in a glass bottle is about 1 mR/h at 1 meter distance. When electrons from a 1 Ci source of 90Sr - 90Y are absorbed, the bremsstrahlung hazard is approximately equal to that presented by the gamma radiation from 12 mg of radium. The average energy of the bremsstrahlung is about 300 keV.
Gamma Rays The air-scattered radiation (sky-shine) from a 100 Ci 60Co source placed 1 ft behind a 4 ft high shield is about 100 mrad/h at 6 ft from the outside of the shield. Within ±20% for point source gamma emitters with energies between 0.07 and 4 MeV, the exposure rate (R/h) at 1 ft is 6C⋅E⋅n where C is the activity in curies, E is the energy in MeV, and n is the number of gammas per disintegration.
Neutrons An approximate HVL (thickness of absorber for which the neutron flux falls to half its initial value) for 1 MeV neutrons is 3.2 cm of paraffin; that for 5 MeV neutrons is 6.9 cm of paraffin).
Miscellaneous The activity of any radionuclide is reduced to less than 1% after 7 half-lives (i.e., 2-7 = 0.8%). For nuclides with a half-life greater than 6 days, the change in activity in 24 hours will be less than 10%. 10 HVL (half-value layers) attenuates approximately by 10-3. There is 0.64 mm3 of radon gas at STP in transient equilibrium with 1 Ci of radium. The natural background from all sources in most parts of the world leads to an equivalent dose rate of about 0.04 to 4 mSv per year for the average person. About 84% of this comes from terrestrial sources, the remainder from cosmic rays. The U. S. average is about 3.6 mSv/yr but can range up to 50 mSv/yr in some areas. A passenger in a plane flying at 12,000 meters receives 5 µSv/hr from cosmic rays (as compared to about 0.03 µSv/hr at sea level). The ICRP recommended exposure limit to man-made sources of ionizing radiation (Reference 2) is 20 mSv/yr averaged over 5 years, with the dose in any one year not to exceed 50 mSv. A whole-body dose of about 3 Gy over a short time interval will typically lead to 50% mortality in 30 days assuming no medical treatment.
Units The gray (Gy) is the SI unit of absorbed dose; it is a measure of the mean energy imparted to a sample of irradiated matter, divided by the mass of the sample. Gy is a special name for the SI unit J/kg. The sievert (Sv) is the SI unit of equivalent dose, which is defined as the absorbed dose multiplied by a weighting factor that expresses the longterm biological risk from low-level chronic exposure to a specified type of radiation. The Sv is another special name for J/kg. 1 curie (Ci) = 3.7⋅1010 becquerel (Bq); i.e., 3.7⋅1010 disintegrations per second. 1 roentgen (R) = 2.58⋅10-4 coulomb per kilogram (C/kg); a measure of the charge (positive or negative) liberated by x-ray or gamma radiation in air, divided by the mass of air. 1 rad = 0.01 Gy 1 rem = 0.01 Sv REFERENCES 1. Padikal, T.N., and Fivozinsky, S.P., Medical Physics Data Book, National Bureau of Standards Handbook 138, U. S. Government Printing Office, Washington, D.C., 1981. 2. 1990 Recommendations of the International Commission on Radiological Protection, ICRP Publication 60, Annals of the ICRP, Pergamon Press, Oxford, 1991. 3. Radiation: Doses, Effects, Risks, United Nations Sales No. E.86.III.D.4, 1985. 4. Review of Particle Properties, Phys. Rev. D, 50, 1173, 1994 (p. 1268).
16-47
ANNUAL LIMITS ON INTAKES OF RADIONUCLIDES K. F. Eckerman The following table lists, for workers, the annual limits on oral and inhalation intakes (ALI) for selected radionuclides based on the occupational radiation protection guidance of the International Commission on Radiological Protection (References 1 and 2). An intake of one ALI corresponds to an annual whole body dose of 0.02 Sv (2 rem). The ALI is expressed in the SI unit of activity, the becquerel (Bq), and in the conventional unit, the microcurie (µCi); 1 µCi = 3.7⋅104 Bq. The chemical form of inhaled radionuclides is, in most instances, stated in terms of the rate of absorption to blood from the lungs and the fractional absorption from the small intestine. Type F, M, and S denote chemical forms which are absorbed from the lungs at rates characterized as fast, moderate, and slow, respectively. The time to absorb 90% of the deposited radionuclide, in the absence of radioactive decay, corresponds to about 10 minutes, 150 days, and 7000 days for Type F, M, and S compounds, respectively. Type F compounds can be considered to be more soluble than M or S, S being the most insoluble. Chemical form consideration for ingestion is specified by the fractional absorption from the small intestine, denoted as f1. The f1 values range from 10–5 to 1. Higher fractional absorption is associated with greater solubility of the compound. REFERENCES 1. 1990 Recommendations of the International Commission on Radiological Protection, ICRP Publication 60, Annals of the ICRP 21, (1—3), Pergamon Press, Oxford, 1991. 2. Dose Coefficients for Intakes of Radionuclides by Workers, ICRP Publication 68, Annals of the ICRP, 24(4), Pergamon Press, Oxford, 1995.
Inhalation intakes Physical half-life 3H
12.3 y
11C
0.340 h
14C
5730 y
18F
1.83 h
22Na 32P
2.60 y 15.0 h 14.3 d
35S
87.4 d
24Na
42K
51Cr
12.4 h 22.6 h 163 d 4.53 d 27.7 d
54Mn
312 d
52Fe
8.28 h
55Fe
2.70 y
43K 45Ca 47Ca
Chemical form Type/f1 HT gas HTO vapor CO CO2 Organic compounds CO CO2 Organic compounds F 1.000 M 1.000 S 1.000 F 1.000 F 1.000 F 0.800 M 0.800 Inorganic compounds F 0.800 M 0.800 Vapor Organic compounds F 1.000 F 1.000 M 0.300 M 0.300 F 0.100 M 0.100 S 0.100 F 0.100 M 0.100 F 0.100 M 0.100 F 0.100 M 0.100
Oral intakes
ALI
Chemical form f1
Bq
µCi
ALI
Bq
µCi
1.1E+13 1.1E+09 1.7E+10 9.1E+09 6.2E+09
3.0E+08 3.0E+04 4.5E+05 2.5E+05 1.7E+05
1.000
1.1E+13
3.0E+08
1.000
8.3E+08
2.3E+04
2.5E+10 3.1E+09 3.4E+07
6.8E+05 8.3E+04 9.3E+02
1.000
3.4E+07
9.3E+02
3.7E+08 2.2E+08 2.2E+08 1.0E+07 3.8E+07 1.8E+07 6.9E+06
1.0E+04 6.1E+03 5.8E+03 2.7E+02 1.0E+03 4.9E+02 1.9E+02
1.000
4.1E+08
1.1E+04
1.000 1.000 0.800
6.3E+06 4.7E+07 8.3E+06
1.7E+02 1.3E+03 2.3E+02
2.5E+08 1.8E+07 1.7E+08
6.8E+03 4.9E+02 4.5E+03
0.800 0.100
1.4E+08 1.1E+08
3.9E+03 2.8E+03
1.000
2.6E+07
7.0E+02
1.000 1.000 0.300 0.300 0.100 0.010
4.7E+07 8.0E+07 2.6E+07 1.3E+07 5.3E+08 5.4E+08
1.3E+03 2.2E+03 7.1E+02 3.4E+02 1.4E+04 1.5E+04
0.100
2.8E+07
7.6E+02
0.100
1.4E+07
3.9E+02
0.100
6.1E+07
1.6E+03
1.0E+08 7.7E+07 8.7E+06 9.5E+06 6.7E+08 5.9E+08 5.6E+08 1.8E+07 1.7E+07 2.9E+07 2.1E+07 2.2E+07 6.1E+07
2.7E+03 2.1E+03 2.4E+02 2.6E+02 1.8E+04 1.6E+04 1.5E+04 4.9E+02 4.5E+02 7.8E+02 5.7E+02 5.9E+02 1.6E+03
16-48
ANNUAL LIMITS ON INTAKES OF RADIONUCLIDES (continued) Inhalation intakes Physical half-life 59Fe
44.5 d
57Co
271 d
58Co
70.8 d
60Co
5.27 y
64Cu
12.7 h
59Ni
75000 y
63Ni
96.0 y
65Zn 67Ga
244 d 3.26 d
68Ga
1.13 h
68Ge
288 d
75Se
120 d
79Se
65000 y
86Rb 85Sr
18.6 d 64.8 d
87mSr
2.80 h
89Sr
50.5 d
90Sr
29.1 y
99Mo
2.75 d
99mTc
6.02 h
99Tc
213000 y
106Ru
1.01 y
111In
2.83 d
113mIn
1.66 h
113Sn
115 d
123I
13.2 h
125I
60.1 d
129I
1.57⋅107 y
Chemical form Type/f1 F 0.100 M 0.100 M 0.100 S 0.050 M 0.100 S 0.050 M 0.100 S 0.050 F 0.500 M 0.500 S 0.500 F 0.050 M 0.050 Vapor F 0.050 M 0.050 Vapor S 0.500 F 0.001 M 0.001 F 0.001 M 0.001 F 1.000 M 1.000 F 0.800 M 0.800 F 0.800 M 0.800 F 1.000 F 0.300 S 0.010 F 0.300 S 0.010 F 0.300 S 0.010 F 0.300 S 0.010 F 0.800 S 0.050 F 0.800 M 0.800 F 0.800 M 0.800 F 0.050 M 0.050 S 0.050 F 0.020 M 0.020 F 0.020 M 0.020 F 0.020 M 0.020 F 1.000 Vapor F 1.000 Vapor F 1.000
Oral intakes
ALI Bq
µCi
6.7E+06 6.3E+06 5.1E+07 3.3E+07 1.4E+07 1.2E+07 2.8E+06 1.2E+06 2.9E+08 1.3E+08 1.3E+08 9.1E+07 2.1E+08 2.4E+07 3.8E+07 6.5E+07 1.0E+07 7.1E+06 1.8E+08 7.1E+07 4.1E+08 2.5E+08 2.4E+07 2.5E+06 1.4E+07 1.2E+07 1.3E+07 6.5E+06 1.5E+07 3.6E+07 3.1E+07 9.1E+08 5.7E+08 1.4E+07 3.6E+06 6.7E+05 2.6E+05 5.6E+07 1.8E+07 1.0E+09 6.9E+08 5.0E+07 6.3E+06 2.0E+06 1.2E+06 5.7E+05 9.1E+07 6.5E+07 1.1E+09 6.3E+08 2.5E+07 1.1E+07 1.8E+08 9.5E+07 2.7E+06 1.4E+06 3.9E+05
1.8E+02 1.7E+02 1.4E+03 9.0E+02 3.9E+02 3.2E+02 7.6E+01 3.2E+01 7.9E+03 3.6E+03 3.6E+03 2.5E+03 5.8E+03 6.5E+02 1.0E+03 1.7E+03 2.7E+02 1.9E+02 4.9E+03 1.9E+03 1.1E+04 6.7E+03 6.5E+02 6.8E+01 3.9E+02 3.2E+02 3.4E+02 1.7E+02 4.2E+02 9.7E+02 8.4E+02 2.5E+04 1.5E+04 3.9E+02 9.7E+01 1.8E+01 7.0E+00 1.5E+03 4.9E+02 2.7E+04 1.9E+04 1.4E+03 1.7E+02 5.5E+01 3.2E+01 1.5E+01 2.5E+03 1.7E+03 2.8E+04 1.7E+04 6.8E+02 2.8E+02 4.9E+03 2.6E+03 7.4E+01 3.9E+01 1.1E+01
16-49
Chemical form f1
Bq
µCi
0.100
1.1E+07
3.0E+02
0.100 0.050 0.100 0.050 0.100 0.050 0.500
9.5E+07 1.1E+08 2.7E+07 2.9E+07 5.9E+06 8.0E+06 1.7E+08
2.6E+03 2.8E+03 7.3E+02 7.7E+02 1.6E+02 2.2E+02 4.5E+03
0.050
3.2E+08
8.6E+03
0.050
1.3E+08
3.6E+03
0.500 0.001
5.1E+06 1.1E+08
1.4E+02 2.8E+03
0.001
2.0E+08
5.4E+03
1.000
1.5E+07
4.2E+02
0.800 0.050 0.800 0.050 1.000 0.300 0.010 0.300 0.010 0.300 0.010 0.300 0.010 0.800 0.050 0.800
7.7E+06 4.9E+07 6.9E+06 5.1E+07 7.1E+06 3.6E+07 6.1E+07 6.7E+08 6.1E+08 7.7E+06 8.7E+06 7.1E+05 7.4E+06 2.7E+07 1.7E+07 9.1E+08
2.1E+02 1.3E+03 1.9E+02 1.4E+03 1.9E+02 9.7E+02 1.6E+03 1.8E+04 1.6E+04 2.1E+02 2.4E+02 1.9E+01 2.0E+02 7.3E+02 4.5E+02 2.5E+04
0.800
2.6E+07
6.9E+02
0.050
2.9E+06
7.7E+01
0.020
6.9E+07
1.9E+03
0.020
7.1E+08
1.9E+04
0.020
2.7E+07
7.4E+02
1.000
9.5E+07
2.6E+03
1.000
1.3E+06
3.6E+01
1.000
1.8E+05
4.9E+00
ALI
ANNUAL LIMITS ON INTAKES OF RADIONUCLIDES (continued) Inhalation intakes Physical half-life 131I
8.04 d
129Cs
141Ce
1.34 d 2.06 y 13.1 d 30.0 y 32.5 d
144Ce
284 d
133Ba 169Yb
10.7 y 12.7 d 32.0 d
198Au
2.69 d
198mAu
2.30 d
197Hg
2.67 d
134Cs 136Cs 137Cs
140Ba
203Hg
201Tl
46.6 d
207Bi
3.04 d 22.3 y 38.0 y
210Po
138 d
224Ra
228Th
3.66 d 1600 y 5.75 y 1.91 y
230Th
77000 y
232Th
1.40⋅1010 y
234U
2.44⋅105 y
210Pb
226Ra 228Ra
Chemical form Type/f1
Oral intakes
ALI
Chemical form f1
Bq
µCi
1.000
9.1E+05
2.5E+01
1.000 1.000 1.000 1.000 5.0E-04
3.3E+08 1.1E+06 6.7E+06 1.5E+06 2.8E+07
9.0E+03 2.8E+01 1.8E+02 4.2E+01 7.6E+02
5.0E-04
3.8E+06
1.0E+02
0.100 0.100 5.0E-04
2.0E+07 8.0E+06 2.8E+07
5.4E+02 2.2E+02 7.6E+02
0.100
2.0E+07
5.4E+02
0.100
1.5E+07
4.2E+02
1.000 0.400
2.0E+08 1.2E+08
5.5E+03 3.2E+03
ALI
Bq
µCi
Vapor F 1.000 Vapor F 1.000 F 1.000 F 1.000 F 1.000 M 5.0E-04 S 5.0E-04 M 5.0E-04 S 5.0E-04 F 0.100 F 0.100 M 5.0E-04 S 5.0E-04 F 0.100 M 0.100 S 0.100 F 0.100 M 0.100 S 0.100 Inorganic compounds F 0.400
2.1E+05 1.8E+06 1.0E+06 2.5E+08 2.1E+06 1.1E+07 3.0E+06 7.4E+06 6.5E+06 8.7E+05 6.9E+05 1.1E+07 1.3E+07 9.5E+06 8.3E+06 5.1E+07 2.0E+07 1.8E+07 3.4E+07 1.0E+07 1.1E+07
5.6E+00 4.9E+01 2.7E+01 6.7E+03 5.6E+01 2.8E+02 8.1E+01 2.0E+02 1.7E+02 2.4E+01 1.9E+01 3.0E+02 3.4E+02 2.6E+02 2.3E+02 1.4E+03 5.5E+02 4.9E+02 9.2E+02 2.7E+02 2.8E+02
2.4E+08
6.4E+03
Vapor Organic compounds F 0.020 M 0.020 Inorganic compounds F 0.400
4.5E+06
1.2E+02
2.0E+08 7.1E+07
5.4E+03 1.9E+03
0.020
8.7E+07
2.4E+03
2.7E+07
7.2E+02
1.000 0.400
1.1E+07 1.8E+07
2.8E+02 4.9E+02
Vapor Organic compounds F 0.020 M 0.020 F 1.000 F 0.200 F 0.050 M 0.050 F 0.100 M 0.100 M 0.200 M 0.200 M 0.200 M 5.0E-04 S 2.0E-04 M 5.0E-04 S 2.0E-04 M 5.0E-04 S 2.0E-04 F 0.020 M 0.020 S 0.002
2.9E+06
7.7E+01
3.4E+07 1.1E+07 2.6E+08 1.8E+04 2.4E+07 6.3E+06 2.8E+04 9.1E+03 8.3E+03 1.7E+03 1.2E+04 8.7E+02 6.3E+02 7.1E+02 2.8E+03 6.9E+02 1.7E+03 3.1E+04 9.5E+03 2.9E+03
9.2E+02 2.8E+02 7.1E+03 4.9E-01 6.4E+02 1.7E+02 7.6E-01 2.5E-01 2.3E-01 4.5E-02 3.2E-01 2.4E-02 1.7E-02 1.9E-02 7.5E-02 1.9E-02 4.5E-02 8.4E-01 2.6E-01 7.9E-02
0.020
3.7E+07
1.0E+03
1.000 0.200 0.050
2.1E+08 2.9E+04 1.5E+07
5.7E+03 7.9E-01 4.2E+02
0.100
8.3E+04
2.3E+00
0.200 0.200 0.200 5.0E-04 2.0E-04 5.0E-04 2.0E-04 5.0E-04 2.0E-04 0.020 0.002
3.1E+05 7.1E+04 3.0E+04 2.9E+05 5.7E+05 9.5E+04 2.3E+05 9.1E+04 2.2E+05 4.1E+05 2.4E+06
8.3E+00 1.9E+00 8.1E-01 7.7E+00 1.5E+01 2.6E+00 6.2E+00 2.5E+00 5.9E+00 1.1E+01 6.5E+01
16-50
ANNUAL LIMITS ON INTAKES OF RADIONUCLIDES (continued) Inhalation intakes Physical half-life
Oral intakes
Chemical form Type/f1
Bq
µCi
F 0.020 M 0.020 S 0.002 F 0.020 M 0.020 S 0.002 M 5.0E-04 M 5.0E-04 M 5.0E-04 S 1.0E-05
3.3E+04 1.1E+04 3.3E+03 3.4E+04 1.3E+04 3.5E+03 1.3E+03 1.8E+07 6.7E+02 1.8E+03
9.0E-01 3.0E-01 8.9E-02 9.3E-01 3.4E-01 9.5E-02 3.6E-02 4.9E+02 1.8E-02 4.9E-02
ALI
235U
7.04⋅108 y
238U
4.47⋅109 y
237Np 238Pu
2.14⋅106 y 2.36 d 87.7 y
239Pu
24100 y
M 5.0E-04 S 1.0E-05
6.3E+02 2.4E+03
1.7E-02 6.5E-02
241Pu
14.4 y
M 5.0E-04 S 1.0E-05
3.4E+04 2.4E+05
9.3E-01 6.4E+00
241Am
432 y 18.1 y 2.64 y
M 5.0E-04 M 5.0E-04 M 5.0E-04
7.4E+02 1.2E+03 1.5E+03
2.0E-02 3.2E-02 4.2E-02
239Np
244Cm 252Cf
16-51
Chemical form f1
Bq
µCi
0.020 0.002
4.3E+05 2.4E+06
1.2E+01 6.5E+01
0.020 0.002
4.5E+05 2.6E+06
1.2E+01 7.1E+01
5.0E-04 5.0E-04 5.0E-04 1.0E-05 1.0E-04 5.0E-04 1.0E-05 1.0E-04 5.0E-04 1.0E-05 1.0E-04 5.0E-04 5.0E-04 5.0E-04
1.8E+05 2.5E+07 8.7E+04 2.3E+06 4.1E+05 8.0E+04 2.2E+06 3.8E+05 4.3E+06 1.8E+08 2.1E+07 1.0E+05 1.7E+05 2.2E+05
4.9E+00 6.8E+02 2.4E+00 6.1E+01 1.1E+01 2.2E+00 6.0E+01 1.0E+01 1.2E+02 4.9E+03 5.6E+02 2.7E+00 4.5E+00 6.0E+00
ALI
CHEMICAL CARCINOGENS The following substances are listed in the 9th Report on Carcinogens 2000, released by the National Institute of Environmental Health Sciences (NIEHS) under the National Toxicology Program (NTP). Substances are grouped in two classes: - Known to be human carcinogens: There is sufficient evidence of carcinogenicity from studies in humans which indicates a causal relationship between exposure to the substance and human cancer. - Reasonably anticipated to be human carcinogens: There is limited evidence of carcinogenicity from studies in humans which indicates that causal interpretation is credible, but that alternative explanations, such as chance, bias, or confounding factors, could not be adequately excluded; or there is sufficient evidence of carcinogenicity from studies in experimental animals. The NTP report also lists many poorly defined materials such as soots, tars, mineral oils, coke oven emissions, etc. These materials are not included here. The table lists the name normally used in the Handbook of Chemistry and Physics, followed by additional names by which the substance is known. In many cases the primary name given here is different from that used in the NTP report; however, names used in the NTP report appear in the Other names column. The Chemical Abstracts Service Registry Number (CAS RN), given in the last column, is taken from the NTP report. Extensive details on each substance are given in the reference. REFERENCE Public Health Service, National Toxicology Program, 9th Report on Carcinogens, OCR Services, Inc., P.O. Box 12510, Research Triangle Park, NC 27709-2510. Also available on the Internet at http://ehis.niehs.nih.gov/roc/ Substance Known to be Human Carcinogens Aflatoxins 4-Aminobiphenyl Arsenic compounds, inorganic Asbestos Azathioprine Benzene p-Benzidine Bis(2-chloroethyl) sulfide Bis(chloromethyl) ether 1,3-Butadiene 1,4-Butanediol dimethylsulfonate Cadmium and cadmium compounds Cadmium chloride Cadmium oxide Cadmium sulfate Cadmium sulfide Chlorambucil Chloroethene 1-(2-Chloroethyl)-3-(4-methylcyclohexyl)1-nitrosourea Chloromethyl methyl ether Chromium hexavalent compounds Cyclophosphamide Cyclosporin A Diethylstilbestrol Direct Black 38, disodium salt Direct Blue 6, tetrasodium salt Erionite Ethylene oxide Lead(II) chromate Melphalan Methoxsalen (with UV therapy) 2-Naphthylamine Piperazine estrone sulfate Radon Silicon dioxide (respirable size) Silicon dioxide (respirable size) Silicon dioxide (respirable size)
Other names
CAS RN
1402-68-2 92-67-1
p-Biphenylamine
1H-Purine, 6-[(1-methyl-4-nitro-1H-imidazol-5-yl)thio][1,1'-Biphenyl]-4,4'-diamine Mustard gas
Myleran; Busulfan
Vinyl chloride; Chloroethylene
1332-21-4 446-86-6 71-43-2 92-87-5 505-60-2 542-88-1 106-99-0 55-98-1 7440-43-9 10108-64-2 1306-19-0 10124-36-4 1306-23-6 305-03-3 75-01-4
MeCCNU; Urea,
13909-09-6 107-30-2
2H-1,3,2-Oxazaphosphorin-2-amine, N,N-bis(2-chloroethyl)tetrahydro-, 2-oxide Cyclosporine
50-18-0
Oxirane L-Phenylalanine, 4-[bis(2-chloroethyl)amino]PUVA; 9-Methoxy-7H-furo[3,2-g][1]benzopyran-7-one 2-Aminonaphthalene; β-Naphthylamine Estrone, hydrogen sulfate, compd. with piperazine Quartz; Silica Cristobalite; Silica Tridymite; Silica
16-53
59865-13-3 56-53-1 1937-37-7 2602-46-2 66733-21-9 75-21-8 7758-97-6 148-82-3 298-81-7 91-59-8 7280-37-7 10043-92-2 14808-60-7 14464-46-1 15468-32-3
CHEMICAL CARCINOGENS (continued) Substance Sodium equilin sulfate Sodium estrone sulfate Strontium chromate Tamoxifen Thorium(IV) oxide Triethylenethiophosphoramide Zinc chromate, basic
Other names Estra-1,3,5(10),7-tetraen-17-one, 3-hydroxy, hydrogen sulfate, sodium salt Estrone, hydrogen sulfate, sodium salt
Thorium dioxide Thiotepa; Tris(1-aziridinyl)phosphine, sulfide
Reasonably Anticipated to be Human Carcinogens Acetaldehyde Ethanal 2-(Acetylamino)fluorene Acrylamide 2-Propenamide Acrylonitrile Propenenitrile Adriamycin, hydrochloride Doxorubicin hydrochloride 2-Amino-9,10-anthracenedione 2-Aminoanthraquinone 1-Amino-2-methyl-9,10-anthracenedione 1-Amino-2-methylanthraquinone Arochlor 1254 Polychlorinated biphenyls (54% Cl) Arochlor 1260 Polychlorinated biphenyls (60% Cl) Azacitidine 5-Azacytidine; 1,3,5-Triazine-2(1H)-one, 4-amino-1-beta-D-ribofuranosylBenz[a]anthracene Benzo[b]fluoranthene Benz[e]acephenanthrylene Benzo[j]fluoranthene Benzo[k]fluoranthene 2,3,1',8'-Binaphthylene Benzo[a]pyrene Beryllium and certain beryllium compounds Beryllium aluminum alloy Beryllium aluminum metasilicate Beryl Beryllium chloride Beryllium fluoride Beryllium hydroxide Beryllium oxide Beryllia Beryllium phosphate Beryllium sulfate Beryllium sulfate tetrahydrate Beryllium zinc silicate 2,2'-Bioxirane Diepoxybutane Bis(4-amino-3-chlorophenyl)methane 4,4-Methylene-bis(2-chloraniline); MBOCA Bis(2-chloroethyl)methylamine Nitrogen mustard hydrochloride N,N’-Bis(2-chloroethyl)-N-nitrosourea BCNU; Carmustine Bis[4-(dimethylamino)phenyl]methane Michler’s Base; 4,4-Methylenebis(N,N-dimethylbenzenamine) 1,3-Bis(2,3-epoxypropoxy)benzene Diglycidyl resorcinol ether Bis(2-ethylhexyl) phthalate DEHP; Di(2-ethylhexyl) phthalate Bromodichloromethane tert-Butyl-4-hydroxyanisole BHA; Butylated hydroxyanisole N-Butyl-N-(4-hydroxybutyl)nitrosamine N-Nitrosobutyl-N-(4-hydroxybutyl)amine Chlorendic acid 5-Norbornene-2,3-dicarboxylic acid, 1,4,5,6,7,7-hexachloroChlorinated paraffins (C12, 60% Cl) 4-Chloro-1,2-benzenediamine 4-Chloro-o-phenylenediamine 2-Chloro-1,3-butadiene Chloroprene 1-(2-Chloroethyl)-3-cyclohexyl-1-nitrosourea CCNU; Lomustine; Belustine 4-Chloro-2-methylaniline p-Chloro-o-toluidine 4-Chloro-2-methylaniline hydrochloride p-Chloro-o-toluidine hydrochloride 1-Chloro-2-methylpropene Dimethylvinyl chloride 3-Chloro-2-methylpropene Chlorozotocin D-Glucose, 2-[[[(2-chloroethyl)nitrosoamino]carbonyl]amino]-2-deoxyC.I. Basic Red 9, monohydrochloride Cupferron
16-54
CAS RN 16680-47-0 438-67-5 7789-06-2 10540-29-1 1314-20-1 52-24-4 13530-65-9
75-07-0 53-96-3 79-06-1 107-13-1 25316-40-9 117-79-3 82-28-0 11097-69-1 11096-82-5 320-67-2 56-55-3 205-99-2 205-82-3 207-08-9 50-32-8 7440-41-7 12770-50-2 1302-52-9 7787-47-5 7787-49-7 13327-32-7 1304-56-9 13598-15-7 13510-49-1 7787-56-6 39413-47-3 1464-53-5 101-14-4 55-86-7 154-93-8 101-61-1 101-90-6 117-81-7 75-27-4 25013-16-5 3817-11-6 115-28-6 108171-26-2 95-83-0 126-99-8 13010-47-4 95-69-2 3165-93-3 513-37-1 563-47-3 54749-90-5 569-61-9 135-20-6
CHEMICAL CARCINOGENS (continued) Substance Dacarbazine Decabromobiphenyl cis-Diaminedichloroplatinum 2,4-Diaminoanisole sulfate 4,4'-Diaminodiphenyl ether 4,4'-Diaminodiphenylmethane Dibenz[a,h]acridine Dibenz[a,j]acridine Dibenz[a,h]anthracene 7H-Dibenzo[c,g]carbazole Dibenzo[a,e]pyrene Dibenzo[a,h]pyrene Dibenzo[a,i]pyrene Dibenzo[a,l]pyrene 1,2-Dibromo-3-chloropropane 1,2-Dibromoethane 2,3-Dibromo-1-propanol, phosphate (3:1) p-Dichlorobenzene 3,3'-Dichloro-p-benzidine 3,3'-Dichloro-p-benzidine dihydrochloride 1,2-Dichloroethane Dichloromethane 1,3-Dichloropropene (unspecified isomer) Diethyl sulfate 2,3-Dihydro-6-propyl-2-thioxo4(1H)-pyrimidinone 1,8-Dihydroxy-9,10-anthracenedione 3,3'-Dimethoxybenzidine p-(Dimethylamino)azobenzene 2',3-Dimethyl-4-aminoazobenzene Dimethylcarbamic chloride 1,1-Dimethylhydrazine Dimethyl sulfate 1,6-Dinitropyrene 1,8-Dinitropyrene 1,4-Dioxane 1,2-Diphenylhydrazine Disperse Blue No. 1 Epichlorohydrin 1,2-Epoxy-4-(epoxyethyl)cyclohexane Estra-1,3,5(10)-triene-3,17-diol, (17β)Estrone N-(4-Ethoxyphenyl)acetamide Ethyl carbamate Ethyl methanesulfonate N-Ethyl-N-nitrosourea Formaldehyde Furan Hexabromobiphenyl (unspecified isomer) Hexachlorobenzene 1,2,3,4,5,6-Hexachlorocyclohexane, (1α,2α,3β,4α,5α,6β) 1,2,3,4,5,6-Hexachlorocyclohexane, (1α,2α,3β,4α,5β,6β) 1,2,3,4,5,6-Hexachlorocyclohexane, (1α,2β,3α,4β,5α,6β) Hexachlorocyclohexane (unspecified isomer) Hexachloroethane Hexamethylphosphoric triamide
Other names 1H-Imidazole-4-carboxamide, 5-(3,3-dimethyl-1-triazenyl)Cisplatin 1,3-Benzenediamine, 4-methoxy, sulfate 4,4-Oxydianiline 4,4'-Methylenedianiline
Naphtho[1,2,3,4-def]chrysene Dibenzo[b,def]chrysene Benzo[rst]pentaphene Dibenzo[def,p]chrysene Ethylene dibromide; EDB Tris(2,3-dibromopropyl) phosphate 1,4-Dichlorobenzene [1,1'-Biphenyl]-4,4'-diamine, 3,3'-dichloro3,3'-Dichloro-[1,1'-biphenyl]-4,4'-diamine dihydrochloride Ethylene dichloride Methylene chloride
Propylthiouracil Danthron; 1,8-Dihydroxyanthraquinone Dianisidine
CAS RN 4342-03-4 13654-09-6 15663-27-1 39156-41-7 101-80-4 101-77-9 226-36-8 224-42-0 53-70-3 194-59-2 192-65-4 189-64-0 189-55-9 191-30-0 96-12-8 106-93-4 126-72-7 106-46-7 91-94-1 612-83-9 107-06-2 75-09-2 542-75-6 64-67-5 51-52-5
Firemaster FF-1 Perchlorobenzene Lindane; γ-Hexachlorocyclohexane
117-10-2 119-90-4 60-11-7 97-56-3 79-44-7 57-14-7 77-78-1 42397-64-8 42397-65-9 123-91-1 122-66-7 2475-45-8 106-89-8 106-87-6 50-28-2 53-16-7 62-44-2 51-79-6 62-50-0 759-73-9 50-00-0 110-00-9 67774-32-7 118-74-1 58-89-9
α-Hexachlorocyclohexane
319-84-6
β-Hexachlorocyclohexane
319-85-7
Perchloroethane Hexamethylphosphoramide; Tris(dimethylamino)phosphine oxide
608-73-1 67-72-1 680-31-9
o-Aminoazotoluene; 4-o-Tolylazo-o-toluidine Dimethylcarbamoyl chloride UDMH
Hydrazobenzene 9,10-Anthracenedione, 1,4,5,8-tetraamino(Chloromethyl)oxirane 4-Vinyl-1-cyclohexene dioxide Estradiol-17β Phenacetin Urethane ENU; N-Nitroso-N-ethylurea
16-55
CHEMICAL CARCINOGENS (continued) Substance Hydrazine Hydrazine sulfate 2-Imidazolidinethione Indeno[1,2,3-cd]pyrene Kanechlor 500 Kepone Lead(II) acetate Lead(II) phosphate Mestranol o-Methoxyaniline hydrochloride 2-Methoxy-5-methylaniline o-Methylaniline o-Methylaniline hydrochloride 2-Methyl-1,3-butadiene 5-Methylchrysene 4,4-Methylenedianiline dihydrochloride Methyl methanesulfonate N-Methyl-N’-nitro-N-nitrosoguanidine N-Methyl-N-nitrosourea Methyloxirane Metronidazole Mirex Nickel Nickel(II) acetate Nickel(II) carbonate Nickel carbonyl Nickel(II) hydroxide Nickel hydroxide (unspecified oxidation state) Nickelocene Nickel(II) oxide Nickel(III) sulfide Nitrilotriacetic acid 2-Nitroanisole 6-Nitrochrysene Nitrofen 2-Nitropropane 1-Nitropyrene 4-Nitropyrene N-Nitrosobutyl-N-(3-carboxypropyl)amine N-Nitrosodibutylamine N-Nitrosodiethanolamine N-Nitrosodiethylamine N-Nitrosodimethylamine 4-(N-Nitrosomethylamino)-1(3-pyridyl)-1-butanone N-Nitroso-N-methylvinylamine 4-Nitrosomorpholine N-Nitrosonornicotine N-Nitrosopiperidine N-Nitroso-N-propyl-1-propanamine N-Nitrosopyrrolidine N-Nitrososarcosine Norethisterone 19-Norpregna-1,3,5(10)-trien-20-yne-3, 17-diol, (17α)Ochratoxin A Octabromobiphenyl (unspecified isomer) 2-Oxetanone
Other names
Ethylene thiourea 1,10-(1,2-Phenylene)pyrene Polychlorinated biphenyls Chlordecone
19-Norpregna-1,3,5(10)-trien-20-yn-17-ol, 3-methoxy-, (17 α)o-Anisidine hydrochloride p-Cresidine; 5-Methyl-o-anisidine o-Toluidine o-Toluidine hydrochloride Isoprene Benzenamine, 4,4'-methylenedi-, dihydrochloride
N-Nitroso-N-methylurea 1,2-Propylene oxide 2-Methyl-5-nitro-1H-imidazole-1-ethanol 1,3,4-Metheno-1H-cyclobuta[cd]pentalene, 1,1a,2,2,3,3a,4,5,5,5a,5b,6-dodecachlorooctahydro-
Bis(η5-2,4-cyclopentadien-1-yl)nickel Nickel subsulfide N,N-Bis(carboxymethyl)glycine 1-Methoxy-2-nitrobenzene Benzene, 2,4-dichloro-1-(4-nitrophenoxy)-
Butyl(3-carboxypropyl)nitrosoamine Ethanol, 2,2'-(nitrosoimino)DEN; Diethylnitrosamine DMN; Dimethylnitrosamine NNK; Ketone, 3-pyridyl-3-(N-methyl-N-nitrosamino)propyl Ethenamine, N-methyl-N-nitrosoN-Nitrosomorpholine
CAS RN 302-01-2 10034-93-2 96-45-7 193-39-5 37317-41-2 143-50-0 301-04-2 7446-27-7 72-33-3 134-29-2 120-71-8 95-53-4 636-21-5 78-79-5 3697-24-3 13552-44-8 66-27-3 70-25-7 684-93-5 75-56-9 443-48-1 2385-85-5 7440-02-0 373-02-4 3333-67-3 13463-39-3 12054-48-7 11113-74-9 1271-28-9 1313-99-1 12035-72-2 139-13-9 91-23-6 7496-02-8 1836-75-5 79-46-9 5522-43-0 57835-92-4 38252-74-3 924-16-3 1116-54-7 55-18-5 62-75-9 64091-91-4
Glycine, N-methyl-N-nitroso19-Norpregn-4-en-20-yn-3-one, 17-hydroxy-, (17 α)Ethinylestradiol
4549-40-0 59-89-2 16543-55-8 100-75-4 621-64-7 930-55-2 13256-22-9 68-22-4 57-63-6
β-Propiolactone
303-47-9 61288-13-9 57-57-8
1-Nitrosopiperidine N-Nitrosodipropylamine
16-56
CHEMICAL CARCINOGENS (continued) Substance Oxiranemethanol Oxymetholone Phenazopyridine hydrochloride Phenolphthalein Phenoxybenzamine hydrochloride Phenytoin Polychlorinated biphenyls Procarbazine hydrochloride Progesterone 1,3-Propane sultone Propyleneimine Reserpine Safrole Selenium sulfide Streptozotocin Sulfallate 2,3,7,8-Tetrachlorodibenzo-p-dioxin Tetrachloroethene Tetrachloromethane Tetrafluoroethene N,N,N’,N’-Tetramethyl-4,4'diaminobenzophenone Tetranitromethane Thioacetamide Thiourea o-Tolidine Toluene-2,4-diamine Toluene diisocyanate (unspecified isomer) Toxaphene 1H-1,2,4-Triazol-3-amine 1,1,1-Trichloro-2,2-bis(4-chlorophenyl)ethane Trichloroethene Trichloromethane (Trichloromethyl)benzene 2,4,6-Trichlorophenol 1,2,3-Trichloropropane
Other names Glycidol Androstan-3-one, 17-hydroxy-2-(hydroxymethylene)-17-methyl2,6-Pyridinediamine, 3-(phenylazo)-, monohydrochloride 3,3-Bis(4-hydroxyphenyl)-1(3H)-isobenzofuranone Benzenemethanamine, N-(2-chloroethyl)-N(1-methyl-2-phenoxyethyl)-, hydrochloride 5,5-Diphenyl-2,4-imidazolidinedione PCBs Pregn-4-ene-3,20-dione 1,2-Oxathiolane, 2,2-dioxide 2-Methylaziridine 5-(2-Propenyl)-1,3-benzodioxole D-Glucopyranose, 2-deoxy-2-[[(methylnitrosoamino)carbonyl]amino]N,N-Diethyldithiocarbamic acid, 2-chloroallyl ester TCDD; Dioxin Perchloroethylene Carbon tetrachloride Tetrafluoroethylene Bis(dimethylamino)benzophenone; Michler’s Ketone
3,3-Dimethylbenzidine 2,4-Diaminotoluene Polychlorocamphene Amitrole DDT; Dichlorodiphenyltrichloroethane Trichloroethylene Chloroform Benzotrichloride
16-57
CAS RN 556-52-5 434-07-1 136-40-3 77-09-8 63-92-3 57-41-0 1336-36-3 366-70-1 57-83-0 1120-71-4 75-55-8 50-55-5 94-59-7 7446-34-6 18883-66-4 95-06-7 1746-01-6 127-18-4 56-23-5 116-14-3 90-94-8 509-14-8 62-55-5 62-56-6 119-93-7 95-80-7 26471-62-5 8001-35-2 61-82-5 50-29-3 79-01-6 67-66-3 98-07-7 88-06-2 96-18-4
